Griven 2 half cells Reduction half Reaction | Reducitur potentialu) Cu2+ caa) +26 C4 (5) Ni (aq) + 2e- → Ni(s) 0.34 -0.25 Griven Starting Consor Concentration are [cu²+] = 0.67M [Ni²+] = 0.092 m Assume 298.15k is the temperature Find out is (A) calculate the BUTO for this cell (B) what is initial Ecell ? (c) what is the cell potential when s26 [ Cu2+] crached 0.26 m2 concentration (1) what is the of when Ecell = 0.56 V ? Ni2+ when

Griven 2 half cells Reduction half Reaction | Reducitur potentialu) Cu2+ caa) +26 C4 (5) Ni (aq) + 2e- → Ni(s) 0.34 -0.25 Griven Starting Consor Concentration are [cu²+] = 0.67M [Ni²+] = 0.092 m Assume 298.15k is the temperature Find out is (A) calculate the BUTO for this cell (B) what is initial Ecell ? (c) what is the cell potential when s26 [ Cu2+] crached 0.26 m2 concentration (1) what is the of when Ecell = 0.56 V ? Ni2+ when

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 92QRT

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.