HỌ5.47 Homework Unanswered The combustion reaction of nitromethane fuel occurs as follows: 2 CH3 NO2 (1) + 3/2 O2(g) → 2 CO₂(g) + 3 H₂O(l) + N₂ (g) The standard enthalpy of this reaction is -1418 kJ. What is the standard enthalpy of formation of nitromethane in kJ/mol? Respond with the correct number of significant figures in scientific notation (Use E notation and only 1 digit before decimal e.g. 2.5E5 for 2.5 x 105) Type your numeric answer and submit * Unanswered. 3 attempts left Submit

HỌ5.47 Homework Unanswered The combustion reaction of nitromethane fuel occurs as follows: 2 CH3 NO2 (1) + 3/2 O2(g) → 2 CO₂(g) + 3 H₂O(l) + N₂ (g) The standard enthalpy of this reaction is -1418 kJ. What is the standard enthalpy of formation of nitromethane in kJ/mol? Respond with the correct number of significant figures in scientific notation (Use E notation and only 1 digit before decimal e.g. 2.5E5 for 2.5 x 105) Type your numeric answer and submit * Unanswered. 3 attempts left Submit

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.86QE: One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of...

See similar textbooks

Similar questions

One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
The combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written below. Calculate H for the combustion of 15.0 g of C2H6. 2 C2H6(g) + 7 O2(g) 4 CO2(g) + 6 H2O(g) rH=2857.3kJ/mol-rxn
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
You want to determine the value for the enthalpy of formation of CaSO4(s), but the reaction cannot be done directly. Ca(s) + S(s) + 2 O2(g) CaSO4(s) You know, however, that (a) both calcium and sulfur react with oxygen to produce oxides in reactions that can be studied calorimetrically, and (b) the basic oxide CaO reacts with the acidic oxide SO3(g) to produce CaSO4(s) with rH = 402.7 kJ. Outline a method for determining fH for CaSO4(s), and identify the information that must be collected by experiment. Using information in Appendix L, confirm that fH for CaSO4(s) = 1433.5 kJ/mol.