H₂O(g) + Cl₂O(g) = 2HOCI(g)K = 0.0900 @ 298 KThe sealed 2.00 L reaction vessel wascharged with 3.00 moles H₂O and 4.00 molesCl₂O and HOCI. Calculate the equilibriumconcentrations of the components. What isthe equilibrium concentration of H₂O?[H₂O] = [?] M[H₂O], MEnter CO(g) + H₂O(g) = H₂(g) + CO₂(g)Kc = 7.3 @ 823 K-A closed 5.0 L container initially holds3.0 moles CO and 6.0 moles H₂O. Calculatethe concentrations of each material atequilibrium. What is the equilibriumconcentration of H₂O?[H₂O] = [?] M[H,O], MEnter

H₂O(g) + Cl₂O(g) ⇒ 2HOCI(g) K = 0.0900 @ 298 K The sealed 2.00 L reaction vessel was charged with 3.00 moles H₂O and 4.00 moles Cl₂O and HOCI. Calculate the equilibrium concentrations of the components. What is the equilibrium concentration of H₂O? [H₂O] = [?] M [H,O], M Enter

H₂O(g) + Cl₂O(g) ⇒ 2HOCI(g) K = 0.0900 @ 298 K The sealed 2.00 L reaction vessel was charged with 3.00 moles H₂O and 4.00 moles Cl₂O and HOCI. Calculate the equilibrium concentrations of the components. What is the equilibrium concentration of H₂O? [H₂O] = [?] M [H,O], M Enter

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.34PAE: 1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was...

See similar textbooks

Similar questions

Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of CI2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm? Cl2(g)+Br2(g)2BrCl(g)KP=4.7102
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?