How many isomers could found for a molecule with 5 chiral centers O 10 O 32 O 8 16 O 5

Q: How many chiral centers are present in the molecule below? OH A.7 B. 5 C. 6 D. 8 H H

A:

Q: Give three different examples of chiral compounds that do not have an asymmetrically substituted…

A:

Q: Which of the following is considered as chiral molecule? Br CH3 H3C CH3 А В. Br- H CI H H3C CI

A: A chiral molecule is non-superimposable with its mirror ​image. Chiral carbon has four different…

Q: How many chiral centers are in this compound? A) 3 B) 4 C) 5 D) 6

A: Carbon atoms that are attached to four different substituents are called chiral carbons. Carbon…

Q: NO2 ZI %24

A:

Q: Which of the organic compounds shown below exhibit cis-trans isomerism? Select one: O a.…

A: In organic chemistry , there are different type of compounds which are related with each other as…

Q: Look at the image shown. What does this image represent? Linear molecule with one domain Linear…

A: The given image represents what has to be given.

Q: How many chiral carbon? Br 2 3 O 5 4.

A: If a carbon atom in the molecule is attached with four different groups, then the carbon is known as…

Q: Part 9 a> 애 'OH OH

A: If the molecule contains a carbon atom attached with four different types of atoms or groups known…

Q: Identify the functional groups. Cl- OCH3

A: To identify the functional group in the given molecule

Q: How many optical isomers does the given compound have? Write the number only Br C6H5 CN

A: Optical isomers : Optical isomers are the group of compounds which have same molecular formula and…

Q: Classify the following compounds as CIS or TRANS structures. Write NA if the compounds are not cis

A:

Q: Why do we need to know the concept of chiral molecules?

A: When a carbon atom in an organic compound is bonded to four different groups from all four sides…

Q: Which of the following compounds is/are chiral? 2 a. only 1 b. only 1 and 2 c. only 2 and 3 d. 1,2…

A: If a molecule doesn't have alternating axis of symmetry (Sn), centre of symmetry (i) or, plane of…

Q: what type of isomerism are found in the following compound 1)C7H16 2)C7H14 3)C7H12

A: C7H16 is n-heptane. It can have 9 constitutional isomers. They are the following: (1)…

Q: How many chiral centers are in the following molecule? 03 02 5 04 OH

A: We have given the organic compound we have to find how many chiral centre present in the given…

Q: 43 46 please answer both

A:

Q: If pk1= 2.34 and pk2= 9.60, then the isoelectric point pl is? A. 5.87 B. 5.97 C. 3.67 D. 4.56

A: The isoelectric point (PI) of amino acid with one carboxylic acid and one amine group can be…

Q: The (R,R) isomer of methylphenidate (Ritalin) is used to treat attention deficit hyperactivity…

A: A chiral center is an sp3 hybridized carbon atom that is bonded to four different groups. The…

Q: Choose the atom(s) that are chiral centers in this alkane. A) 1 B) 2 C) 3 3. D) 4 E) 3 and 4

A: How many chiral centers in this alkane ?

Q: For the compound MoCl5 what is the charge on molybdenum?    a. 6 b. -1 c. -5   d. 5 e. 4

A: combining capacity of an element in compound is known as oxidation state of element

Q: Using the molecular models to explain the answer, determine if 2-chlorobut-1-ene is polar or…

A: The molecule is 2-chlorobut-1-ene. It has one Cl-group ,one double bond and 4 C.

Q: How many chiral carbon atoms are in this molecule? a. 1 b. 2 c. 3 d. 4

A: Chiral carbon atoms (asymmetric carbon atoms) are bonded to four different groups of atoms.

Q: J. Write the Conderised for mula of the ft. 1) &, 2 di methyl cyclo pentanecarbaldehyda , 2 Chloro…

A: We need to write condensed  formulae of given compounds.    Note : The question contain multiple…

Q: How many chiral carbon are there? " H C=0 Н-С— ОН НО — С— Н НО — С— Н Н —С— ОН CH,OH 3 5 2.

A: Given molecule is a aldohexose. It is a carbohydrates.

Q: Identify the approximate bond angles in these molecules: I. Alanine II. Aspartic III. Threonine IV.…

A:

Q: 2) Are these compounds chiral? Build models and take a picture, utilize online sketching software…

A: Chiral carbon: The carbon which is connected to four different groups/atoms is called as chiral…

Q: 29) Which of the following compounds exhibits geometric isomerism? A) CH₂=CH₂ B) CH₂=CCl2 C) 1₂C=CHI…

A: Since, In geometrical isomerism, rotation is restricted. It means that, two different types of group…

Q: What would the structure look like for the following: (CH3)2CFCBr3

A:

Q: d) FeCl3 + SO2 + H2O → FeCl2 + HCl + H2SO4

A:

Q: Choose the atom(s) that are chiral centers in this alkane. A) 1 1 B) 2 34 2 C) 3 D) 4 E) 3 and 4

A:

Q: How many chiral carbon? CI CI O 2 O 3 5.

A: The number of chiral carbons in given compound has to be given.

Q: Give the chemical names of the corresponding structures for compounds A and B. „NH2 CH3COCI + A…

A:

Q: How many chiral centers are in the following compound? Но. O 2 O 3 O 4 0 5 0 6

A: The molecule given is,

Q: meo Eto

A:

Q: How many chiral center(s) is/are present in the structure below: O a. 12 b. 10 O c. 11 O d. 8 ÕH 27…

A:

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: Which of the following is a chiral molecule? HO- OH "O., 1 OA 1 O B. 2 O. 3 O D.4 3.

A: We have to predict the chiral molecule.

Q: How many chiral centers are in the following molecule? (dashes and wedges purposefully not…

A: The chiral centre are that sp3 hybridized centre which contains four different groups.

Q: Draw projection drawings and perspective drawings of all possible isomers of C3H8.

A: Isomers are the molecules with same molecular formula but have different structural arrangement of…

Q: Draw all possible isomers of C4H3C12.

A:

Q: How many isomers could found for a molecule with 5 chiral centers O 10 O 32 8. O 16

A: The question is based on the concept of isomerism. We have to identify how many isomers possible for…

Q: how to draw skeletal structure for C9H20

A: The general formula for the alkane is shown below: CnH2n+2 Where; n = number of carbon atoms

Q: NC CH2CH,CH,OH III -SH I II

A:

Q: Examine the structure of PGF2a. Identify all chiral centers and all double bonds about which…

A:

Q: Which of the following statements can be used to prove that carbon is tetrahedral? a. CH3Br does not…

A: Constitutional Isomers: The compounds that have the same molecular formula but different in their…

Q: 69. The line structure for ( CH3)3CCH2CH2CH(CH3)2 is : 2.

A: Organic and biological chemists use an abbreviated drawing convention called line structure or the…

Q: 2. Draw the structure of the following compounds 3-ethyl, 1fluorohexane (i) (ii) 2-bromo, 4-chloro,…

A:

Stereochemistry and Isomerism

Stereochemistry deals with the three-dimensional structure and properties of molecules. It explains the arrangement of atoms and their manipulation within a molecule in a 3D structure. Stereochemistry can be dealt with all types of molecules. Based on the stereochemistry of a molecule, the physical and chemical properties of the molecules vary.