Answered: Hydrogen gas and nitrogen gas react to…

Hydrogen gas and nitrogen gas react to form ammonia gas. What volume of ammonia would be produced by this reaction if 7.0 m3 of nitrogen were consumed?

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter13: Gases

Section: Chapter Questions

Problem 89A

See similar textbooks

Related questions

Q: A sample of oxygen gas initially at 329 K was heated to 383 K. If the volume of the oxygen gas…

Q: A sample of oxygen gas initially at 333 K was heated to 387 K. If the volume of the oxygen gas…

A: Charles’s law states that “the volume and the Kelvin temperature of a gas are directly related to…

Q: What volume of propane (C3H8) is required to produce 106 liters of water according to the following…

A: The balanced equation of the given reaction equation is,

Q: Hexane, C6H14, burns according to the following equation: 2C6H14(g) + 19O2(g) 12CO2(g) + 14H2O(g)…

A: Given: Volume of Hexane = 8.00 L Chemical reaction is given by, 2C6H14(g) + 19O2(g) → 12CO2(g) +…

Q: Fluorine gas and water vapor react to form hydrogen fluoride gas and oxygen. What volume of oxygen…

A: The balanced reaction can be given as

Q: 3. A weather balloon is filled to the volume of 150.L on a day when the temperature is 19°C. If no…

A: Initially: Volume of the weather balloon (V1) = 150 L Temperature (T1) = 19°C = (19 + 273.15) K =…

Q: If 68.00 g fluorine gas takes up 12.45 L of space, how many grams of carbon dioxide would it take to…

Q: If 3.75 L of nitrogen gas and 2.57 L of hydrogen gas were allowed to react, how many liters of…

Q: what is the theoretical volume of carbon dioxide you are adding to the air?

A: Number of moles = mass/molar mass 1 mol gas = 22.4 L

Q: 3. Why is the density of a gas much lower than that of a liquid or solid under atmospheric…

A: Density of a substance is defined as its mass per unit volume.

Q: What is the total volume of gaseous products formed when 166 liters of ammonia react completely…

A: Balanced equation for the given reaction is,

Q: A 22.5 g sample of O2 at standard temperature and pressure (STP) would occupy what volume in litres?

A: Ideal gas equation is: PV = nRT . . . (1) Here, P…

Q: please see attached

A: The given reaction as follows,

Q: A sample of oxygen gas initially at 367 K was heated to 421 K. If the volume of the oxygen gas…

A: At constant pressure, the volume of the gas increases with an increase in temperature. According to…

Q: What volume of methane (CH) is required to react with 129 liters of carbon tetrachloride according…

A: The reaction taking place is given as, => methane (CH4 (g)) + carbon tetrachloride (CCl4 (g))…

Q: Hydrogen chloride gas and oxygen react to form water vapor and chlorine gas. What volume of water…

Q: How fast will nitrogen gas travel if carbon dioxide moves at a rate of 9.56 x 1026 molecules per…

A: According to Graham’s law, if a mixture contains two gases, then the rate of effusion at constant…

Q: Using Graham’s Law, if the speed of oxygen gas at room temperature is 1066 mi/hr, what is the speed…

Q: If 5.98 mol of NO, occupy 32.1 L, how many liters will 3.40 mol of NO, occupy at the same…

A: Consider the given information is as follows; Initial moles of NO2 n1 = 5.98 molInitial volume V1 =…

Q: Determine the molecular mass of a gas where 3.42 g occupies 0.92 L at standard conditions of…

Q: 233 mL nitrogen gas reacts with 583 mL hydrogen gas. Both gases are at the same temperature and…

A: It is given that 233 mL of nitrogen is reacting with 583 mL of hydrogen gas at the same temperature…

Q: A 29.5 g sample of O₂ at standard temperature and pressure (STP) would occupy what volume in litres?

A: Given: The mass of O2=29.5 g. The molar mass of O2=32 g/mol. Therefore, the number of moles of O2,…

Q: Ammonia gas and oxygen gas react to form water vapor and nitrogen monoxide gas , what volume of…

Q: N2(g) + 3H2(g) → 2NH3(g) 8.99 L of N2(g) is mixed with 7.64 L of H2(g) and reacts with 100% yield.…

A: Based on limiting reagent we should calculate the percentage of yield 22.4 L occupied 1 mole of…

Q: Describe the relationship between the volume and number of moles of a gas

A: Avogadro's law states that under the same conditions of temperature and pressure, equal volumes of…

Q: One of the gas laws states that the volume of a gas is proportional to its temperature. What final…

A: Initial temperature (T1) = 100°c (1°c = 273 K ) , T1 =(273 + 100)K T1 = 373 K Initial volume ( V1…

Q: What volume is occupied by 0.105 mol of helium gas at a pressure of 0.96 atm and a temperature of…

A: Consider the gas behaves ideally. Then using PV= nRT the volume occupied by the gas can be…

Q: What volume of carbon dioxide is produced when 31.2 g of calcium carbonate reacts completely

A: Given :- mass of calcium carbonate = 31.2 g To calculate :- volume of CO2 produced (in liters)…

Q: Avogadro proposed that equal volumes of gases at the same temperature and pressure contain an equal…

A: According to avogadro's law at same temperature and pressure equal volume of gases contain equal…

Q: Convert the following measurement. kg 2.0 x 10 mol dl. mol L

Q: How much space (liters) of Ne gas does

Q: If 10.52 grams of aluminum fluoride are decomposed, what volume of fluorine gas is produced?

A: The question is based on the concept of Reaction Stoichiometry. We have to calculate how much…

Q: Hydrogen chloride gas and oxygen react to form water vapor and chlorine gas. What volume of chlorine…

A: Given that,Hydrogen chloride gas reacts with oxygen gas to give chlorine gas and water.

Q: You are holding two balloons of the same volume at STP. One balloon contains 1.0 g of helium. The…

A: Mass of helium given = 1.0 g Molar mass of helium = 4.0 g/mol

Q: If 0.00864 mol neon gas at a particular temperature and pressure occupies a volánie of 228 ml, what…

Q: If 14.0 LL of hydrogen chloride gas reacts with 49.5 LL of oxygen gas, what is the volume of…

A: We have to calculate the volume of oxygen gas

Q: Methane burns in oxygen to produce CO2 and H2O. CH4(g)+2O2(g)→2H2O(l)+CO2(g) What volume of…

A: From the given reaction, it is clear that one mole of methane reacts with two moles of oxygen to…

Q: n the combustion of methane, if 75 L of CO2 are produced by stoichiometric volumes of the reactants,…

A: The balanced chemical reaction: The given reaction is combustion reaction. Combustion reaction is…

Q: Propane burns in air according to the equation: C3H8(g) + 5O2(g) -> 3CO2(g) + 4H2O(g). What volume…

A: The number of moles of propane is calculated as shown below where V is the volume of propane and Vm…

Q: A sample of gas consisting of 9.04 mol occupies a volume of 10.01 L. If another sample of the same…

A: For sample -1 mole (n1)= 9.04 mole Volume (V1)= 10.01 L For sample -2 Mole(n2)= 22.79 mole Volume…

Q: Convert the following measurement. kg 6.1 x 10 mol dL mol L

A: Convert the following measurement--

Q: Consider the following reaction, which is found in some portable stoves: 1302 (e) 8CO2 e 10H,0 @…

A: Use PV=nRT n=PV/RT

Q: What is the total volume of gaseous products formed when 127 liters of bromine trifluoride react…

A: 2BrF3(g) = Br2(g) + 3 F2 (g) Now using reaction stoichiometry we can calculate the volume of gaseous…

Q: A 24.6 g sample of chlorine gas occupies a volume of 1.37 L at a particular temperature and…

A: Given : Initial mass of Cl2 gas = 24.6 g Initial Volume = 1.37 L Final volume of gas = 4.85 L And…

Q: An experiment is performed to determine the volume of gas produced by the following reaction:…

A: The given reaction is: 2HClaq + Mgs → MgCl2aq + H2g Mass of Mg reacted = 16…

Q: On average, a scuba tank provides 670 L of useful air. If a resting breathe has a volume of 0.50 L,…

A: Scuba tanks contain useful air= 670 L Volume of resting breathe = 0.50 L Using Unitary method,…

Q: Using Graham’s Law, if the speed of oxygen gas at room temperature is 1066 mi/hr, what is the speed…

A: We have given that Rate of Oxygen gas = R1 = 1066 mi/hr And Rate of SF6 = R2 = ? ( That we have to…

Q: Solve the question

A: Given CH4(g) + 4 Cl2(g) -------> CCl4(g) + 4HCl(g) Volume of Cl2(g) = 1.9*106 L 1L = 10-3…

Q: What volume of nitrogen monoxide is required to react with 141 liters of hydrogen gas according to…

A: Given Reaction:- NO(g) + H2(g) ----> N2(g) + H2O(l)

Question

Hydrogen gas and nitrogen gas react to form ammonia gas. What volume of ammonia would be produced by this reaction if 7.0 m³of nitrogen were consumed?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

109 An ore sample with a mass of 670 kg contains 27.7% magnesium carbonate, MgCO3. If all of the magnesium carbonate in this ore sample is decomposed to form carbon dioxide, describe how to determine what volume of CO2 is evolved during the process. What would have to be measured to predict the needed volume in advance?
104 When a 0.817-g sample of a copper oxide is heated with excess hydrogen gas, a reaction takes place, and 0.187 g of water is formed. What is the apparent formula of the copper oxide?
A student prepares phosphorous acid, H3PO3, by reacting solid phosphorus triiodide with water. PI3(s)+3H2O(l)H3PO3(s)+3HI(g) The student needs to obtain 0.250 L of H3PO3(d=1.651g/cm3). The procedure calls for a 45.0% excess of water and a yield of 75.0%. How much phosphorus triiodide should be weighed out? What volume of water (d=1.651g/cm3) should be used?
Hydrogen chloride gas and oxygen react to form water vapor and chlorine gas. What volume of water would be produced by this reaction if 6.4 mL of oxygen were consumed?
Ammonia gas and oxygen gas react to form water vapor and nitrogen monoxide gas , what volume of water would be produced by this reaction if 9.56 cm^3 of oxygen were consumed ?
Fluorine gas and water vapor react to form hydrogen fluoride gas and oxygen. What volume of oxygen would be produced by this reaction if 4.7 mL of fluorine were consumed?
Methane gas and chlorine gas react to form hydrogen chloride gas and carbon tetrachloride gas. What volume of carbon tetrachloride would be produced by this reaction if 6.5 cm3 of methane were consumed?
If 10.52 grams of aluminum fluoride are decomposed, what volume of fluorine gas is produced?
Iron(III) chloride is used to treat drinking and waste water. It can be made by reacting iron with chlorine gas. Calculate the volume of chlorine gas (Cl2) STP that will react with 5.00 grams of iron
The balanced equation for the synthesis of ammonia is 3 H2 ( g )+ N 2( g)→2 N H3 (g). If 15.0 L of H2 and 5.0 L of N2 are combined, what volume of N H3 will be produced?
If 0.00890 mol neon gas at a particular temperature and pressure occupies a volume of 179 mL, what volume would 0.00652 mol neon gas occupy under the same conditions?
Hydrogen chloride gas and oxygen react to form water vapor and chlorine gas. What volume of chlorine would be produced by this reaction if 2.05 m^3 of hydrogen chloride were consumed?