In air at 25 °C and 1.00 atm, the N2 concentration is 0.01 M and the O2 concentration is 0.033 M. The reactionN2(g) + O2(g) 2NO(g)has K 4.8 x 10-31 at 25 °C.Taking the N2 and O2 concentrations given above as initial values, calculate the equilibrium NO concentration that should exist inour atmosphere from this reaction at 31 °C, KC = 2.0E-30.Make simplifying assumptions in your calculations. (Express your answer in scientific notation.)[NO] - iM

Step 1:For any reaction, value of equilibrium constant Kc is equal to the ratio of molar…

Answered: In air at 25 °C and 1.00 atm, the N2…

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.35PAE: In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial...

See similar textbooks

Similar questions

Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?

SEE MORE QUESTIONS

Recommended textbooks for you

Chemistry for Engineering Students

Chemistry

ISBN:

9781337398909

Author:

Lawrence S. Brown, Tom Holme

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781133949640

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry for Engineering Students

Chemistry

ISBN:

9781337398909

Author:

Lawrence S. Brown, Tom Holme

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781133949640

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781337399074

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS