Answered: In medical practice, the Na2B4O7.10H2O…

In medical practice, the Na2B4O7.10H2O is used as an antiseptic. Calculate the mass of this substance if the amount of substance equivalent = 0.5 mol

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter15: Solutions

Section: Chapter Questions

Problem 77QAP: 77. Explain why the equivalent weight of H2SO4 is half the molar mass of this substance. How many...

See similar textbooks

Related questions

Q: How many moles of Zn would be required to produce 4 moles of hydrogen gas using the following…

A: Given : number of moles of H2 = 4 mol Zn and H2 are present in ratio 1:2

Q: 1. Aqueous dilution of I0, results in the following reaction: 10. jac) + 2H,O H,lO. (ac) and K = 3.5…

A: GIVEN:-

Q: Complete and balance the following reaction as written. What are the products after balancing the…

A: Since in reaction it is given that we have only 1 HCl Hence only 1 H+ will react with 1 OH- forming…

Q: Carbon dioxide is removed from the atmosphere of spacecapsules by reaction with a solid metal…

A: a) The balanced reaction of LiOH with CO2 is as follows: Molar mass of LiOH is 23.95 g/mol Molar…

Q: Predict the products of the following reaction. If no reaction will occur, use the NO REACTION…

A: Balance Chemical equation means no of atoms should be equaal in both side reactant and product.

Q: O3(g) + 2 I-(aq) + H2O(l) → O2(g) + I2(aq) + 2 OH-(aq) How many grams of ozone can be removed from…

A: As per the given balanced chemical equation, 1 mol of ozone is removed using 2 mol of iodide ions.

Q: Suppose you have a glass of water with 15 ppb of lead in it. How many atoms of lead ar in the glass…

A: Calculate the mass of lead present in water then convert the mass into number of atoms.The…

Q: What is the balanced net ionic equation? Co(C2H3O2)2 * 4H2O + CH3COOH →

Q: What ions are produced when sodium phosphate, Na3PO4, dissolves in water?

A: Ions of Na3PO4 in water = ?

Q: Which of the following is the oxidizing agent in the following reaction? 2Al + Cr2O3 → Al2O3 + 2Cr

A: Oxidizing agent is the agent where addition of electrons takes place. So Cr oxidation state goes…

Q: 1. Calculate the amount of moles of oxygen that is needed to react with 2.4 mol of ammonia to…

A: 1) Given, 2NH3 + 3O2 + 2CH4 ➝ 2HCN + 6H2O moles of ammonia (NH3) react = 2.4 mol moles of oxygen…

Q: What is the net ionic equation of the reaction of MgCl2MgCl2 with NaOHNaOH? What is the net…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: Given a stock solution of 30% (w/w) hydrogen peroxide, how much solution, in mL, would you need to…

A: Given 30% (w/w) hydrogen peroxide 100.0 mL of a 5.0 M hydrogen peroxide solution Molar mass of…

Q: Suppose the following chemical reaction can take place in this mixture: 2 SO2(9)+O,(g) → 2 SO3(g)

A: The chemical reaction which has been given in the question is written as-…

Q: Predict the products of the following reaction. If no reaction will occur, use the NO REACTION…

A: The balanced equation of the chemical reaction has total charge and mass of each species is balanced…

Q: What is the equivalent weight of Na₂S₂O3.5H₂O? Na = 23.0, S = 32.1, O = 16.0, H = 1.0

A: finding the equivalent weight of Na2s2o3.5h2o

Q: How many grams of oxygen are produced when 582 grams of water decomposes? 2H2O (l) --> 2H2 (g) + O2…

Q: Briefly describe the difference from PM 2.5 and PM 10 . PM-Particulate Matter

A: given PM 2.5 PM 10

Q: complete and balance the reaction equation Rh2SO4 (aq) + CaI2 (aq) ⎯→

A: In this question, the given equation is to completed and balanced. The given equation is : H2SO4 aq…

Q: Which of the following chemicals are insoluble in water? a. Al(C2H3O2)3 b. Ba(C2H3O2)2 c. Mo(NO3)2…

Q: what is the net ionic eguation. Naz Co3 + 2HCI 2Nacl + COz +H2O to

A: Balance chemical equation is defined as which has equal number of atoms or ions in both sides…

Q: What is the molecularity of the following reaction? CH4(g) + 2O2(g) → CO2(g) + 2H2O(g)

A: The molecularity of a reaction is defined as the sum of number of reactant molecules reacts to bring…

Q: Which species is the oxidizing agent in the following reaction? Mg + 2 HCl → MgCl2 + H2

A: Oxidizing agent - It is a reactant that removes electrons from other reactants during a redox…

Q: What is the theoretical oxygen demand in liters of air for a 50 mg/L solution of acetone, C3H6O to…

Q: 93.3 mL of dry Gas A, at 21°C and an atmospheric pressure of 0.987 atm, reacted with 18.6 mL of a…

A: The formula used to obtained number of moles: P is the pressure. V is the volume. n is the number…

Q: Which substance is injected in gas fuel to remove SO3 gas M9SO4.7H20 ; Mgo Mg

A: The substance which is injected in gas fuel to remove SO3 gas is

Q: (a) Write chemical equations to show what happens when each of the following substances is mixed…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Seawater contains an average of 1.08 x 103 ppm of Na* and 270 ppm of SO42. Calculate the molar…

A: Given, Concentration of Na+ ion = 1.08 * 103 ppm Concentration of SO42- ion = 270 ppm Average…

Q: Determine the concentration of the stock solution in molarity from which 50.0 mL was taken in order…

Q: Write and upload the complete and balanced equation for the following two reactions. 1) The…

A: The Chemical reaction follows the law of conservation of mass. According to the law of conservation…

Q: 3. What is the percentage of sulfur in a sample of 2 gm of coal that gave a precipitate of 0.084 g…

A: Moles of sulfur ( S ) atoms = moles of BaSO4 = given mass of BaSO4molar mass of BaSO4 = 0.084233.4…

Q: Write the equation for the reaction: when nitrogen gas (N2) reacts with sodium metal (Na), solid…

A: Sodium nitride (Na3N) is formed from the reaction of nitrogen gas with sodium metal. Here,…

Q: The concentration of a stock solution of potassium dichromate is 0.50 mol/L. If you were to take 200…

Q: Describe how to calculate the ocean concentration of CO32- using the data collected from 2015. You…

A: pH = -log[H+]; HENCE FROM pH we can get [H+] concentration.

Q: the aluminum (FW= 26.98 g/mol) in a 1.200 g sample of impure ammonium aluminum sulfate was…

A: molar mass of NH4(AlSO4)2= 237.1452g/mol molar mass of Al2O3=101.96g/mol molar mass of Al…

Q: Complete the balanced dissociation equation for the compound NaBr(s) ------>

Q: Calculate the mass of oxygen that will be prepared through the decomposition of 50 kg of potassium…

A: Potassium chlorate decomposes into potassium chloride and oxygen. The equation for the balanced…

Q: , how many grams of AgNO is required to prepare a volume of 100 ml at a concentration of 05 M,…

Q: One can prepare homemade lavender perfume by steam distillation. One of the main components in the…

A: The explanation is given below-

Q: Hydrogen cyanide is produced industrially from reactions; ammonia gas, oxygen and methane, with the…

A: We can determine the mass of cyanide gas produced by using the stoichiometry of the given reaction.…

Q: The Le Blanc Process for the manufacture of soda ash encompasses the four steps: NaCl + H2SO4 =…

A: The Le Blanc Process for the manufacture of soda ash encompasses the four steps. The balanced…

Q: You buy some Kool-Aid mixture packets from the grocery store. You put 1.89 liters (L) of water in a…

A: Molarity is the number of moles of solute dissolve in 1 litre of solvent. It determines the strength…

Q: State whether the following analysis is quantitative or qualitative analysis or both. i)…

A: In qualitative chemical analysis, we identify whether a chemical substance of interest is present in…

Q: The method used to determine COD in water is chemically called: O 1. Replacement reaction O 2.…

A: COD (Chemical Oxygen Demand) is a measurement of amount of oxygen that can be consumed by Reactions…

Q: Given the following reaction: 5H2O2 + 2KMnO4 + 3H2SO4 -> K2SO4 + 2MnSO4 + 8H2O + 5O2 If it…

A: From the given balanced reaction we can see that 5 moles of H2O2 is reacting with 2 moles of KMnO4…

Q: student tried to detect the presence of calcium ion (Ca2+) in milk by adding Na2SO4 solution to a…

Q: Write the complete formula equation and balance the following: 1, decomposition of water 2.…

A: The equations are as follows:

Q: Calculate the molar mass of barium hydroxide octahydrate, Ba(OH)2•8H,O(s). (Hint: The molar mass of…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

In medical practice, the Na2B4O7.10H2O is used as an antiseptic. Calculate the mass of this substance
if the amount of substance equivalent = 0.5 mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the molarity of a solution of strontium chloride that is prepared by dissolving 4.11 g SrCl2 in enough water to form 1.00-L solution? What is the molarity of each ion in the solution?
What is the molarity of a solution of sodium hydrogen sulfate that is prepared by dissolving 9.21 g NaHSO4 in enough water to form 2.00-L solution? What is the molarity of each ion in the solution?
Calculate the molarity of solutions prepared by dilution or calculate the quantities needed to carry out a dilution to prepare a solution of a specified concentration.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
The US Environmental Protection Agency (EPA) places limits on the quantities of toxic substances that may be discharged into the sewer system. Limits have been established for a variety of substances, including hexavalent chromium, which is limited to 0.50 mg/L. If an industry is discharging hexavalent chromium as potassium dichromate (K2Cr2O7), what is the maximum permissible molarity of that substance?
77. Explain why the equivalent weight of H2SO4 is half the molar mass of this substance. How many hydrogen ions does each H2SO4 molecule produce when reacting with an excess of OH ions?
3.120 1f you have 32.6 g of sodium carbonate that is dissolved to give 2.10 L of solution, what is the molarity of the solution? What is the molarity of the sodium ions?
When 10. L of water is added to 3.0 L of 6.0 M H2SO4, what is the molarity of the resulting solution? Assume the volumes are additive.
A sample of a hydrocarbon (a compound consisting of only carbon and hydrogen) contains 2.59 1023 atoms of hydrogen and is 17.3% hydrogen by mass. If the molar mass of the hydrocarbon is between 55 and 65 g/mol, what amount (moles) of compound is present, and what is the mass of the sample?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.