In the early stages of an action, the herbicide "Spartan Green" is planned to be applied to kill the vegetation onsite so the site can be cleared. If the equilibrium concentration of Spartan Green in the soil after a big rainfall event is 1,312.5 mg/kg soil, determine the equilibrium concentration of the chemical in the water that is in contact with the soil. The following reaction applies: SpartanGreen(aq)+→ SpartanGreen(@ds s) Ka =12,500 mg/kg soil per mg/L water

In the early stages of an action, the herbicide "Spartan Green" is planned to be applied to kill the vegetation onsite so the site can be cleared. If the equilibrium concentration of Spartan Green in the soil after a big rainfall event is 1,312.5 mg/kg soil, determine the equilibrium concentration of the chemical in the water that is in contact with the soil. The following reaction applies: SpartanGreen(aq)+→ SpartanGreen(@ds s) Ka =12,500 mg/kg soil per mg/L water

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.34PAE: 1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
What is Le Chteliers principle? Consider the reaction 2NOCI(g)2NO(g)+Cl2(g) If this reaction is at equilibrium. what happens when the following changes occur? a. NOCI(g) is added. b. NO(g) is added. c. NOCI(g) is removed. d. Cl2(g) is removed. e. The container volume is decreased. For each of these changes, what happens to the value of K for the reaction as equilibrium is reached again? Give an example of a reaction for which the addition or removal of one of the reactants or products has no effect on the equilibrium position. In general, how will the equilibrium position of a gas-phase reaction be affected if the volume of the reaction vessel changes? Are there reactions that will not have their equilibria shifted by a change in volume? Explain. Why does changing the pressure in a rigid container by adding an inert gas not shift the equilibrium position for a gas-phase reaction?
. Mercury(I) chloride, Hg2Cl2, was formerly administered orally as a purgative. Although we usually think of mercury compounds as highly toxic, the K of mercury(I) chloride is small enough (1.31018)that the amount of mercury that dissolves and enters the bloodstream is tiny. Calculate the concentration of mercury(I) ion present in a saturated solution of Hg2Cl2.