Magnesium metal is burned in the presence of atmospheric oxygen to form magnesium oxide. Student 1 data 0.1715 g 0.2870 g Mass Mg Mass after reaction Using the given data, calculate the stoichiometric ratio of magnesium ions to oxygen ions in this magnesium oxide sample. Express the ratio as a decimal. Include four significant figures. decimal ratio: What is the empirical formula of magnesium oxide based on this data?

Magnesium metal is burned in the presence of atmospheric oxygen to form magnesium oxide. Student 1 data 0.1715 g 0.2870 g Mass Mg Mass after reaction Using the given data, calculate the stoichiometric ratio of magnesium ions to oxygen ions in this magnesium oxide sample. Express the ratio as a decimal. Include four significant figures. decimal ratio: What is the empirical formula of magnesium oxide based on this data?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 167CP: Zinc and magnesium metal each reacts with hydrochloric acid to make chloride salts of the respective...

See similar textbooks

Similar questions

Tin metal (Sn) and purple iodine (I2) combine to form orange, solid tin iodide with an unknown formula. Sn metal + solid I2 solid SnxIy Weighed quantities of Sn and I2 are combined, where the quantity of Sn is more than is needed to react with all of the iodine. After SnxIy has been formed, it is isolated by filtration. The mass of excess tin is also determined. The following data were collected: Mass of tin (Sn) in the original mixture 1.056 g Mass of iodine (I2) in the original mixture 1.047 g Mass of tin (Sn) recovered after reaction 0.601 g What is the empirical formula of the tin iodide obtained?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
hat do the coefficients of a balanced chemical equation tell us about the proportions in which atoms and molecules react on an individual (microscopic) basis?
An experiment is conducted in which varying amounts of solid iron are added to a fixed volume of liquid bromine. The product of the reaction is a single compound, which can be separated from the product mixture and weighed. The graph shows the relationship between the mass of iron in each trail versus the mass of the product compound. Explain why the group has a positive slope for low masses of iron and a zero slope when the mass of iron added becomes larger.
Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
Zinc and magnesium metal each reacts with hydrochloric acid to make chloride salts of the respective metals, and hydrogen gas. A 10.00-g mixture of zinc and magnesium produces 0.5171 g of hydrogen gas upon being mixed with an excess of hydrochloric acid. Determine the percent magnesium by mass in the original mixture.
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
What mass of solid NaOH (97.0% NaOH by mass) is required to prepare 1.00 L of a 10.0% solution of NaOH by mass? The density of the 10.0% solution is 1.109 g/mL.
Can the subscripts in a chemical formula be fractions? Explain.