ozone levels in urban areas reach unhealthy levels, residents are typically urged to avoid refueling their cars during daylight hours. Explain how this might help to reduce smog formation.

Q: Why chlorofluorocarbons (CFCs) are responsible for destroying ozone ?

A: Chlorofluorocarbons are chemical compounds made of chlorine, carbon and fluorine. These are…

Q: Explain what triggers the formation of the ozone hole over Antarctica.

A:

Q: Match each pollutant with their final product in our atmosphere. SO2 NO₂ CO CH4 1. CO2 2. H₂SO4 3.…

A: Answer: In this question we have to identify the chemical reaction of the air pollutant that takes…

Q: would these chnages help to produce more ozone

A: I will give you a detailed explanation for the same.  That's absolutely true that concentration,…

Q: Air pollution in the Mexico City metropolitan area is among the worst in the world. The…

A: Partial pressure in a mixture can be found using:

Q: Explain how ozone in the upper atmosphere functions to filter short-wavelength solar radiation, and…

A: Dear student I have given answer to your question in the image format.

Q: Some pollutants are difficult to break down and therefore accumulate in the environment. These are…

A: Pollutants are compounds in which pollutes the environment. They are toxic to living beings.…

Q: air pollution in the mexico city metropolitan area is among the worst in the world. the…

A: The pressure of a system is termed as the force that acts upon per unit area associated with the…

Q: Is it possible to create ozone with the technology we have today?

A: Stratospheric ozone is formed naturally through the interaction of solar ultraviolet (UV) radiation…

Q: Classify  the listed properties of ozone (a pollutant in the lower atmosphere, but part of a…

A: a. Ozone is bluish in colour. It is a physical property.   b. Ozone has pungent odour. It is a…

Q: Explain how ozone can be both beneficial and harmful?

A: good effects:  ozone is “good” because it protects living things from ultraviolet radiation from the…

Q: Discuss the possible effects of the following on greenhouses gas chemistry. (b)  CFCs cause further…

A:

Q: Calculate The number of atoms 0.1g of ozone

A: We know that, 1 mol = 6.023×1023 number of molecules.

Q: Pick a source of (SO2) emissions and describe two ways (SO2) emissions from that source can be…

A: There are many sources of sulfur dioxide emission but one of the major sources is:

Q: Classify each of the listed properties of ozone (a pollutant in the lower atmosphere but part of a…

A: Physical properties are those properties that can be observed or measured without any change in…

Q: As of the writing of this text, EPA standards limit atmospheric ozone levels in urban environments…

A: Given that Area covered by the air above Los Angeles = 4000 sq. miles = 1.036 x 1010 m2 . and height…

Q: 11.4. a) Which layer contains the most ozone? b) How thick is the troposphere? c) What type of gas…

A: Given problem is based on earth atmosphere and how this atmosphere affects the climate of the earth.

Q: If gasoline produces only carbon dioxide and water when it burns completely, why is automobile…

A: We have to tell how automobile exhaust a source of air pollution.

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: The vast majority of scientists believe that human activities are causing global warming. Describe…

A: Human activities causes global warming this can be explained by following phenomenon - 1) Due to…

Q: With respect to the chemical compounds involved, describe how smog is caused and what effects it may…

A: Smog is derived from two words –Smoke and fog. Two different types of smog are recognized:…

Q: Describe two ways that people can change their habits and choices to reduce their personal…

A: The two ways that people can change their habits and choices to reduce their personal greenhouse gas…

Q: What effect could a volcanic eruption have on the ozone layer? Use your knowledge of atmospheric…

A: The layer which is made up of ozone molecules that protects Earth from almost all the sun's harmful…

Q: What emissions from human activities lead to ozone depletion? What are the chlorine reactions that…

A: Ozone layer act as protective shield for earth's atmosphere and prevent harmful ultra violet (UV)…

Q: EXPLAIN: 1. What conclusion can you draw about the impact of environmental problems? 2. Is the…

A: Environmental problems are very huge problems on which all the humans have to focus if they have to…

Q: Climate change has impacted our planet in more ways than we can think. We can always do things…

A: In present time climate changes are rapid and it's due to excess emission of green house gases and…

Q: Give one main reason of ozone depletion?

A: Give one main reason for ozone depletion?

Q: Metal and its component are examples of what types of pollutants? A . inorganic B. Natural organic…

A: Pollutant :-  A substance introduced into atmosphere by natural or human activity and exert harmful…

Q: Compare the effect of chlorination and ozone application in water treatment

A: Ozone and chlorination  both are the process are of disinfection of water.

Q: 7) Explain how NOx and SOx gases contribute to acid rain. 8) Explain how CFCS contribute to the…

A: Answer - Acid rain - Acid rain, or acid deposition, is a broad term that includes any form of…

Q: Differentiate between London smog and Los Angeles smog?

A: Given terms,             London smog and Los Angeles smog

Q: Classify  the listed properties of ozone (a pollutant in the lower atmosphere, but part of a…

A:

Q: Match each pollutant with their final product in our atmosphere. > SO₂ NO₂ CO CH4 1. CO2 2. H₂SO4 3.…

A: Pollutants - Pollutants like SO2 , CO , CH4 ,NO2 etc combine with water and oxygen to give hazardous…

Q: Answer the following question about natural gas. How is natural gas produced in nature? What keeps…

A: 1. Natural gas is produced deep inside the earth from the decomposition of organic matter.  When the…

Q: When ozone levels in urban area reach unhealthy levels, residents are typically urged to avoid…

A: The chemical reactions that lead to the formation of smog are: Nitrogen dioxide breaks down in…

Q: Why does a smelly gas produced in a factory can move a long distance from where it was produced?

A:

Q: Describe how the ozone layer forms and why it is important.

A: The ozone layer is present in the stratosphere layer of the atmosphere, ozone layer prevents the…

Q: What is smog? The London smog is caused in which season and time of the day?

A: Smog is a mixture of smoke (the collection of airborne particulates) and fog (vapor form of water).…

Q: Why is it important to continuously monitor the concentration of pollutants in the air?

A: The beginning stage of air quality observing is to initially contemplate if a zone has an air…

Environmental Pollution

Environmental pollution occurs due to some unwanted alteration in the surroundings which results in unfavorable effects on all organisms of that surrounding.