3. For the balanced equation 2CO(g) + 0,(g) I 2CO,(g), the ratio 2:1:2 refers to allthe following excepta. volumes.b. moles.c. molecules.O d. pressures.4. If the temperature of a gas remains constant, then the pressure of the gas willincrease if thea. mass of the gas molecules decreases.b. diffusion of the gas molecules increases.c. size of the container is decreased.O d. number of gas molecules in the container is decreased.

In the chemical reaction, each coefficients tells how much moles, or volume or atoms or molecules…

Answered: pressure of the gas will

Science

Chemistry

pressure of the gas will

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU3: Weather: Phase Changes And Behaviour Of Gases

Section: Chapter Questions

Problem 9RE

See similar textbooks

Related questions

Q: Concerning the pressure of gases, volume and gas pressure are

A: empirical relation between volume and pressure given by Robert's Boil's law

Q: Calculate the volume of each gas sample at STP.

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: The pressure of this gas sample

A: Given data - T = 6 oC = 279 K V = 22.30 L n = 1.19 mol Thus

Q: = pressure at

Q: A sample of gas at 0.6 atm of is the pressure of the gas in at

A: Boyle's Law- It states that at constant temperature and constant moles of gas, the pressure of a gas…

Q: The gas low that stotes when at constont volume, the pressure of a gas is

A: Gas laws are related to pressure (P) , volume (V), temperature (T) and no.of moles of gas (n) ,…

Q: The RMS speed of helium is of helium changes at the same temperature. as the mole variable constant

Q: Pressure =

Q: What is the pressure of the H,

Q: What is the volume of one mole of any gas at STP?

A: According to the mole concept, in terms of volume, the amount of substance in moles is equal to the…

Q: How does the pressure of gas changes if the Kelvin temperature of gas doubles, if the volume and…

Q: Aerosol can is thrown into the fire and eventually heats up causing it to explode. What gas law is…

A: A can containing aerosol is when thrown into fire then on heating its temperature increases and the…

Q: At constant temperature, if the pressure of a gas increases the volume will

A: Ideal Gas Law :- PV = nRT P is the pressure of gas V is the volume occupied by gas n is the…

Q: what is the new volume of the gas?

A: Given :- Initial volume = 4.00 L Initial temperature = 25.0°C Final temperature = 500.0°C To…

Q: Calculating pressure of hydrogen gas given denisty and temperature (Chemistry)

A: The ideal gas equation discussed below in Step 4 is sufficient for calculating the pressure of…

Q: B. increasing the air pressure on the water

A: Boiling point is the temperature at which liquid boils to vapour. At his temperature pressure of…

Q: The pressure of this gas sample IS atm.

Q: liter iHer of a certin gas Weighs grams at STP the mass of mole of gas is?

Q: When car tires are on hot pavement for too long, the pressure inside will______ and the volume…

A: Kinetic energy is energy possessed by moving particle. For example flying aeroplane possess kinetic…

Q: State the equation for the ideal gas law.

A: Ideal gas law = It is an equation for hypothetical ideal gases, which follows both Charles's law and…

Q: he pressure when

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: A gas is at STP with molar volume. How many moles is this gas?

A: Any gas at Standard, Temperature and Pressure at molar volume has 1 mole of that gas. Hence a gas at…

Q: how at high temperature volume of gas is negligible?

A: We need to explain the principle that at high temperature volume of gas is negligible in comparison…

Q: Gay Lussac's Law because the temperature of football decreased which caused the pressure of the…

A: Ideal gases are those gas which have no mass, there is no intermolecular attraction or repulsion and…

Q: After the compression, what is the gas pressure (atm)?

Q: what volume will I

Q: What pressure will be exerted,

A: Ideal Gas Law :- PV = nRT P is the pressure of gas V is the volume occupied by gas n is the…

Q: What will happen to the movement of solid, liquid and gas molecule of neon when the temperature rise…

A: Interatomic distance among gas molecules is highest then interatomic distance among liquid molecules…

Q: 5. When high pressure is applied to a gas, its

A: Pressure and volume follows Boyle's law

Q: If a person adds gas (air) to a rigid tank what will happen to the air pressure?

A: If the gas is added to a rigid tank, the pressure will increase inside the tank.

Q: The volume of a gas is always equal to the volume of its?

A: The volume of gas is actually equal to the volume of container in which it is held. The gases have…

Q: What will happen to the movement of solid, liquid and gas molecule of argon when the temperature…

A: State of matter:- A molecule or atom exist in any state i.e the solid , liquid and gas…

Q: Calculate the volume in liters that a 5.12 mol sample of carbon monoxide gas will occupy at STP.…

A: The standard temperature is taken as 273.15 K The standard pressure is taken as 1 atm Using ideal…

Q: volume

A: Mayonnaise is a type of emulsion . Its a type of oil in water emulsion and this oil is distributed…

Q: tial pressure in atı

A: Partial pressure of N2 gas is given in kiloPascal which can be converted to atm using conversion…

Q: B. In the following graphs, velocity represents the molecular speed, A Relative number of molecules

Q: Pressure is the force per unit of...

A: Gases exert uniform pressure in all the directions on the walls of the container in which they are…

Q: What is the pressure

A: Formula used :- Gaylussac's Law P1/T1 = P2/T2 (at constant volume)

Q: Form hypothesis: If the volume of a gas is held constant, how do you think the pressure will change…

A: Their were various relationship are made in between the measurable properties and such relationship…

Q: The equation that interrelate pressure, volume, temperature and amount of substance is referred to…

A: When Pressure is inversely proportional to Volume called Boyle's law. When Volume is direactly…

Q: s the pressure of a gas increases at constant temperature, its volume

A: Applying Boyle's low at constant temperature. P proportional to 1/V

Q: According to Charles' Law as the temperature of a gas decreases its volume will remain constant…

A: There are 4 gas laws - Charle's lawBoyle's lawAvogadro's lawGuy-Lussac's law 1) According to…

Q: According to Boyle's law as the pressure of a gas increases its volume decreases increases…

Q: -what is the new pressure?

Q: What are the values of temperature and pressure used for standard temperature and pressure?

Q: 10. Determine the pressure and temperature of a gas at STP.

A: The gaseous state is the state of matter with least intermolecular force of attraction between…

Q: (b) Consider the reaction between nitrogen gas and hydrogen gas to produce ammonia gas at STP. Infer…

Q: So the pressure of gas is directly proportional to the temperature of the gas why does the pressure…

A: Explanation :- When pressure is directly proportional to temperature. They follow Charles's law.

Q: If the pressure decrease, what will happen to the volume?

A: Volume will increase

Concept explainers

Kinetic-Theory of Gases

Kinetic theory of gases is the model or method which was developed in the 19th century by Maxwell and Boltzmann. This is possible as the interatomic force which is of short-range forces that are important for solids and liquids can be neglected for gases. This theory or gas law gives a molecular interpretation of the pressure and temperature of a gas and is consistent with gas laws and Avogadro’s hypothesis. This theory is very helpful to correctly explain the specific heat capacities of many gases, kinetic energy and it also explains the transport qualities such as viscosity, thermal conductivity, and diffusion with molecular parameters. As stated in the kinetic-molecular theory, the temperature of a substance or gas particle is related to the average kinetic energy of the particles of that substance. When a substance is heated, some of the absorbed energy is stored within the particles, while some of the energy increases the motion of the particles, called average kinetic energy.

Question

3. For the balanced equation 2CO(g) + 0,(g) I 2CO,(g), the ratio 2:1:2 refers to all
the following except
a. volumes.
b. moles.
c. molecules.
O d. pressures.
4. If the temperature of a gas remains constant, then the pressure of the gas will
increase if the
a. mass of the gas molecules decreases.
b. diffusion of the gas molecules increases.
c. size of the container is decreased.
O d. number of gas molecules in the container is decreased.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1 role of coefficient in the Reaction

VIEW

Step 2 Ratio of coefficient represent

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
How many moles of gaseous boron trifluoride, BF3, are contained in a 4.3410-L bulb at 788.0 K if the pressure is 1.220 atm? How many grams of BF3?
Carbon dioxide, CO2, was shown lo effuse through a porous plate at the rate of 0.033 mol/min. The same quantity of an unknown gas, 0.033 moles, is found to effuse through the same porous barrier in 104 seconds. Calculate the molar mass of the unknown gas.
105 The decomposition of mercury(II) thiocyanate produces an odd brown snake-like mass that is so unusual the process was once used in fireworks displays. There are actually several reactions that take place when the solid Hg(SCN)2 is ignited: 2Hg(SCN)2(s)2HgS(s)+CS2(s)+C3N4(s)CS2(s)+3O2(g)CO2(g)+2SO2(g)2C3N4(s)3(CN)2(g)+N2(g)HgS(s)+O2(g)Hg(l)+SO2(g) A 42.4-g sample of Hg(SCN)2 is placed into a 2.4-L vessel at 21°C. The vessel also contains air at a pressure of 758 torr. The container is sealed and the mixture is ignited, causing the reaction sequence above to occur. Once the reaction is complete, the container is cooled back to the original temperature of 21°C. (a) Without doing numerical calculations, predict whether the final pressure in the vessel will be greater than, less than, or equal to the initial pressure. Explain your answer. (b) Calculate the final pressure and compare your result with your prediction. (Assume that the mole fraction of O2 in air is 0.21.)
Methanol (CH3OH) can be produced by the following reaction: CO(g)+2H2(g)CH3OH(g) Hydrogen at STP flows into a reactor at a rate of 16.0 L/min. Carbon monoxide at STP flows into the reactor at a rate of 25.0 L/min. If 5.30 g methanol is produced per minute, what is the percent yield of the reaction?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
Plot the data given in Table 5.3 for oxygen at 0C to obtain an accurate molar mass for O2. To do this, calculate a value of the molar mass at each of the given pressures from the ideal gas law (we will call this the apparent molar mass at this pressure). On a graph show the apparent molar mass versus the pressure and extrapolate to find the molar mass at zero pressure. Because the ideal gas law is most accurate at low pressures, this extrapolation will give an accurate value for the molar mass. What is the accurate molar mass?
perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.
At elevated temperatures, sodium chlorate decomposes to produce sodium chloride and oxygen gas. A 0.8765-g sample of impure sodium chlorate was heated until the production of oxygen gas ceased. The oxygen gas collected over water occupied 57.2 mL at a temperature of 22C and a pressure of 734 torr. Calculate the mass percent of NaClO3 in the original sample. (At 22C the vapor pressure of water is 19.8 torr.)