Q1: B: How does alkylation with sulphuric acid and hydrofluoric acid work, and what are the governing process parameters? Which one is preferred for alkylation and why?

Q: Which of the following compounds will undergo radical bromination (using Br₂ and light) with the…

A:

Q: a-pinene en a-pinene reacts with 1. BH3; 2. H₂O₂, NaOH, H₂O ssible cis,trans isomers can be formed,…

A: According to the question, we need to draw the major product formed when pinene is treated with BH3…

Q: Refer to reaction sequence below then answer the following question: oxidation CH,OH oxidtion The…

A: The oxidation of alcohol depends on the number of hydrogen atoms attached to the carbon atom that…

Q: Chapter 2 Homework Molecular Representations H ||| 7. The lone pair on oxygen in the following…

A: IUPAC Name :

Q: Determine the density of as follows in g/L. a. Nitrogen gas at standard temperature and pressure. b.…

A: Given :  a. Standard temperature (T)= 273.15 K  Standard pressure (P) = 1 atm  b. Temperature (T) =…

Q: Given the balanced chemical reaction: 2CH3OH + 302 - 2 + 4H₂0 Use the mass of the following elements…

A:

Q: Convert 522mm Hg to atm

A: Given, Convert the following unit of pressure: 522 mmHg = ? atm Note:  760 mmHg = 1 atm

Q: In a saturated solution of BaCO3 at 298K, [Ba2+(aq)]  =  7.07 x 10-5 mol L-1;     [CO32- (aq)]  =…

A: Ksp is the solubility product constant, is defined as equilibrium constant for a solid substance…

Q: What is the hydroxide ion concentration in a solution that containing 0.50 mole of ammonium…

A: Given : No. of moles of Ammonium hydroxide = 0.50 mol No. of moles of Ammonium chloride = 0.05 mol…

Q: Draw the structural condensed formula of 4,4-dimethyl-2-hexene.

A:

Q: pres 10) Which of the following equations demonstrates the formation of NaHCO3 from its respective…

A: In formation reaction one mole of a compound is formed from its constituent elements in their…

Q: How can the electrons in a catalyst (complex) be counted in neutral and in ionic form? When do the…

A: There are two methods for counting electrons.Neutral or covalent method or effective atomic no or…

Q: empirical formula for a compound that contains 20.24% aluminum and 79.76% chlorine.

A:

Q: Use the following set of equations: a) Metallic tin reacts with a solution of lead(II) nitrate to…

A: Chemical equation : The symbolic representation of a chemical reaction in the form of symbols and…

Q: 11. Propose a mechanism for the following reaction: OH H₂SO4 Heat

A: In this question, we will write the reaction mechanism for this given alcohol in acidic medium.  You…

Q: obey the Arrhenius equation, and to have an activation energy Ea -1 -1 action is 1.1 x 108 M¹s at…

A: According to the question, the rate constant of a certain reaction is known to obey the Arrhenius…

Q: (9.6) Which of the following is in the correct order of increasing atomic radius? O Cs > S > Si Cs >…

A: Atomic radius: The distance between the nucleus and the outermost electron is known as the atomic…

Q: 9.4)Which of the following is the correct ground state electron configuration for Rb? s²2s…

A:

Q: empirical formula for a compound that is 24.74 % K, 34.76 % Mn, and the rest O

A: % of oxygen = 100 – ( 24.74 + 34.76) = 40.5 %  Let total amount of compound 100 g Therefore amount…

Q: Describe the difference between a buffered and an unbuffered solution. Explain the significance of a…

A:

Q: Consider an imaginary bacterial cell that contains equal concentrations of 900 different enzymes in…

A: Given Data: Molar Mass of Protein or Enzyme = 120000g/mol   Specific Gravity of Cytosol = 1.25  % by…

Q: A or N(CH3)2 quaternary salt more a to E ² (EN) N hypider роналисэд 10 блаwosi вимород тур до почут

A:

Q: Th e volume of a gas at 75 kPa is 4.0 L. What is the volume of the gas if the pressure increases to…

A: Given,  Initial volume of the gas = V1 = 4.0 L  Initial pressure = P1 = 75 kPa  Final pressure = P2…

Q: The molar solubility of PbBr2 is 2.17 x 10-3 M at a certain temperature. Calculate Ksp for PbBr2.

A:

Q: HERE IS THE DESCRIPTION: Start with the condensed structural formula CH3-C(CH3)=CH-C(CH3)2-CH(CH3)2…

A:

Q: A student takes a 25.0 mL volume from a stock solution of 1.14 mol L-1 magnesium chloride. How many…

A:

Q: the atoms of elements or molecules of compounds when a chemical change occurs and when a physical…

A: Chemical reaction and chemical change: A chemical reaction bonds between atoms are broken and new…

Q: A sample of nitrogen gas has a volume of 478 cm³ and a pressure of 104.1 kPa. What volume would the…

A:

Q: Classify the Ba-S as ionic, non-polar covalent, or polar covalent. O ionic polar covalent non-polar…

A: A bond between two atoms can be classified based on the electronegativity difference between the…

Q: 15 kg a perfect gas is heated at constant pressure from 15 °C to 368.15 K, the heat required is 1130…

A:

Q: Suppose also k₁»k₂. That is, the first step is much faster than the second. Write the balanced…

A:

Q: clopropanation of allylic ethers as shown in the scheme below. Ph Et₂Zn + CICH₂l Toluene 3 h, -20°C…

A:

Q: 9. Determine whether the following drugs comply with Lipinski's rule. Also investigate the…

A: Lipiniski rule States --> 1.Not more than 5 hydrogen bond donars. 2. Not more than 10 H bonding…

Q: K/U Which of the following molecules or ions can act as an acid or a base? Write the two possible…

A:

Q: Given the reaction I2 + Br2  2IBr, both reactants have an initial concentration of 2mol/L at 500K.…

A:

Q: (0); B 1. CO, 125 °C 2. H₂O₂, OH- 1. CO, H₂O, 125 °C 2. H₂O₂, OH-

A: Trialylborane react with CO and followed by oxidation with H2O2 to give carbonyl compounds.

Q: Consider the following reaction schemes involving the reaction of an imine with an organolithium…

A: Lithium halogen exchange reaction :

Q: Objective 9.2 (bolded objective) Use the following set of equations: a) Metallic tin reacts with a…

A: a) When metallic tin reacts with lead (II) nitrate Solution then metallic lead and a Solution of tin…

Q: 2. Acetic acid is a weak acid that ionizes in solution as follows: CH3COOH(aq) → CH3COO- (aq) + H+…

A: ∆Tf = i × kf × molality Where , i = van't hoff factor , kf = freezing point depression constant of…

Q: Determine the types (Type I, Type II, or Type III) AND the names of the following binary compounds:…

A: A question based on introduction to chemistry that is to be accomplished.

Q: mation pictured, Draw the structure of the zinc reage

A: The mechanism can be drawn as,

Q: Draw the line-angle formula of the enol formed in the following alkyne hydration reaction and then…

A: When alkyne react with borane and NaOH will give enol and leads to carbonyl compound

Q: Which of the following electrons experience the greatest effective nuclear charge?

A:

Q: Carbon dioxide in high levels can cause death. One method of removing carbon dioxide from the air of…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: 2. Carbonyl bromide decomposes to carbon monoxide and bromine. COBr2(g) → CO(g) + Br₂(g) Kc is 0.190…

A:

Q: is the study of transformations of energy and matter as they approach the state of equilibrium…

A: Definition :

Q: The first step in the mechanism for the reaction of an amine with a carboxylic acid to produce an…

A:

Q: OH raw the structure of the aldehyde or ketone that reacts with acetylide ion to give this alkynol.…

A: -> Aldehyde or ketone has carbonyl center which has electrophilic character hence, any…

Q: (2)Match the process in Group I with the catalyst in Group II Group I P. Polymerization of ethylene,…

A: To match the process in Group I with the catalyst in Group II

Q: C₂Hs CH₂ TE H₂CC. CCH₂ H₂C CH₂ Compound A Select the correct answer which highlights teh lipophilic…

A: Hydrophilic molecules or part contains dipoles and thus they are polar in nature. Therefore they are…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.