Quinoline, C9H7N (MW = 129, pKb = 9.5) is used as a preservative for anatomical specimens and to make dyes. How many grams of quinoline must be dissolved in a 1.5-L solution such that its pH will be 8.58?

Q: What is the pH of a 3.50 M solution of NH4CI (Ká of NH3= 1.8 x 105)?

A:

Q: What is the pH of a 0.250 M solution of aniline (C₆H₅NH₂, Kb = 4.3 × 10⁻¹⁰)?

A: Given data,Molarity of aniline=0.250MKb=4.3×10-10

Q: Ethylammonium chloride, CH;CH;NH3CI, is an acidic salt. (i) Write equations to show the dissolving…

A: fullscreen

Q: You have a 1.25 L solution with 2.14 g of NaIO and the pH is 11,32. What is the Kb of NaIO?

A: Solution pH, pKa, pKb, Ka, and K ar employed in chemistry to explain however acidic or basic an…

Q: What is the pH of a 0.590 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of a 1.00 x 10^-9 molar solution of MgCl2?

A: The pH of a 1.00 x 10^-9 molar solution of MgCl2 is given below

Q: What is the pH of a 0.0500 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: HONH3Cl is a salt and in solution it gets dissociated as HONH3Cl → HONH3+ + Cl- The hydrolysis…

Q: What is the pH of a 0.680 M solution of Ca(NO2)2 (Ka of HNO, is 4.5 x 104)?

A:

Q: What is the pH of a 0.0730 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A: Given :- concentration of methylamine solution  = 0.0730 M  Kb for methylamine = 4.4 × 10-4  To…

Q: A solution is made by dissolving 26.5 g of Ba(NO₂)₂ in 500.0 mL of water. Using Kb(NO₂⁻) = 2.2 ×…

A: Given that, Weight of Ba(NO₂)₂  = 26.5 g Weight of Ba(NO₂)₂  = 26.5 g/261.337 g/mol = 0.1014 mol…

Q: What is the pH of a 0.0250 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: pH can be calculated as follows

Q: A student does a titration of 86.0 mL of a 0.37 M solution of methylamine (CH3NH2(aq) (pKb =3.36)…

A: PH+Poh=14. This is basic buffer equation  Poh=pkb+log[salt]/base Use this equation and get the…

Q: What is the pH of a 0.232 M solution of ammonia, a weak base with a K of 1.7 x 10-5?

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: What is the pH of a 0.720 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of a 0.0650 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A:

Q: Calculate the pH of the following solutions: a. 2.0 M morphine hydrochloride, C,„H,„NO,•HCI (pK, =…

A: In order to solve this question, we will be using simple concepts of chemical and ionic equilibrium.…

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: What is the pH of a 0.650 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: the laboratory, a general chemistry student measured the pH of a 0.428 M aqueous solution of…

A: PH is  defined as the power of Hydrogen.it measure acidity, basicity or neutrality of aqueous…

Q: What is the pH of a 0.0490 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A:

Q: Calculate the pH of the solution that contains 0.145 M NH3 and 0.192 M NH4Cl.  The Ka of NH4+ is…

A: The solution will be the buffer solution if the weak acid and its corresponding conjugate base are…

Q: What is the pH of a 0.050 M triethylamine, (C2HS)3N, solution? Kb for triethylamine is 5.3 x 10-4

A: We should know that the amine us a basic Compound that will dissociate in solution to give basic…

Q: Determine the pH of a 0.461 M C3H5CO,H M solution if the K, of C6H5CO2H is 6.5 x 105. 4.52 11.74…

A: pH  is commonly known power of hydrogen,  it measures the concentration of hydrogen ion in the…

Q: What is the pH of a 1.47 mol/L solution of HCN(aq) if its Ka = 3.5 ´ 10-11?

A: HCN is a weak acid hence it can dissociate partially Ka value of HCN=3.5×10^-11

Q: What is the pH of a 0.150 M solution of acetic acid (pKa=4.75) at 25 degree celsius?

A: Given, the concentration of acetic acid =0.150 Mand pKa of acetic acid =4.75 at 25 °Cwe are asked to…

Q: 1,2-diaminoethane, H2N-CH2-CH2-NH2, is used extensively in the synthesis of compounds containing…

A: The dissociation reaction is given as, H2N-CH2-CH2-NH2 + H2O →H2N-CH2-CH2-NH3+ + OH-

Q: What is the pH of a 0.870 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Answer:- This question is answered by using the simple concept of hydrolysis of the salt formed by…

Q: What is the pH of a 0.510 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Given information: Concentration of solution = 0.510 M

Q: What is the pH of a 0.0930 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A:

Q: A study of the acid shows that the pH of an acid HA O.12 MIK2.62. What is the K, of this acid?

A: Acid Dissocaition constant, Ka has to be determined for the Acid HA of 0.12 M with pH 2.26.

Q: What is the pH of a 0.380 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of a 0.300 M solution of aniline (C₆H₅NH₂, Kb = 4.3 × 10⁻¹⁰)?

A: CH3NH2 is a weak base that partially dissociates in water. C6H5NH2(aq) ↔ OH-(aq) + C6H5NH3+(aq)…

Q: Phenoxide ion (C,HsO) is a weak base, with Kp = 7.70 x 10. Calculate the pH of a 0.50 M aqueous…

A: Given that  Kb = 7.70 × 10-5  Peroxide ion is a weak base

Q: The pH of a 1.00 M Solution -1 of Nitrous acid HNO2 (pKb =10.6) is

A: HNO2 is a weak acid. pH of 1M solution need to be found out here. Dissociation of this weak acid in…

Q: What is the pH of the following solution? Hydrogen sulphide is a weak acid and has a pka of 8.9 x…

A: Please be noted that the value given for H2S is Ka not pKa. Therefore, pKa(H2S)=8.9×10-8.

Q: On dissolving 7.258 gm of HCN (Ka=7.2x10 1) in water, the solution become 100 ml so the degree of…

A: HCN is a Weak acid the degree of dissociation of a weak acid or base or an electrolyte was explained…

Q: What is the pH of a 1.63 M solution of XOH, a weak monobasic compound (Kb = 1.7 x 10^-9)?

A: Given data in above Concentration of XOH = 1.63 M  Kb = 1.7 ×10-9

Q: What is the pH of a 0.0380 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: pH = 3.73

Q: Calculate the pH of a 0.10-M solution of aluminum chloride, which dissolves completely to give the…

A: The hydration of aluminum chloride to furnish [Al(H2O)6]3+ ion is expressed as follows:…

Q: What is the pH of a 0.1055 M CH3COOH solution (K, = 1.75 x 10-5)? %3D

A: Answer: ICE table for the dissociation of weak monoprotic acid is shown below:

Q: What is the pH of a 0.500 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of a 0.0500 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A: Given  the base association constant, Kb = 4.4 * 10-4 Concentration of methylamine = 0.0500 M The…

Q: What is the pH of a 0.0680 M solution of hydrocyanic acid, HCN (Ка %3D 4.9 х 10-10)?

A:

Q: What is the pH of a 0.420 M solution of C5H,NHB (Kb of C5H,N is 1.7 × 10-9)?

A: Given:: [C5H5NHBr]=0.420 M =concentration of salt=c Kb of C5H5N = 1.7×10-9 pH=?

Q: How many mols of HBr are used to neutralize 18.66 mL of a 0.2299 M Ca(OH)₂ solution?

A:

Q: If the KbKb of a weak base is 1.6×10−6,1.6×10−6, what is the pH of a 0.18 M0.18 M solution of this…

A: Concentration of the solution is 0.18 M. Kb = 1.6 x 10-6 The Ka value is calculated by following…

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.