Sodium fluoroacetate (Nao:C:H:F) is a common poison used in New Zealand to control invasive species, such as rats. It can be prepared by the substitution of a C-CI bond in sodium chloroacetate (NaO:C.H:CI) for a C-F bond. What is the approximate enthalpy change for this substitution reaction on a 6.500 mole sample, based on the following bond energies? C-CI = 339.0 kJ/mol C-F- 485.0 kJ/mol

Sodium fluoroacetate (Nao:C:H:F) is a common poison used in New Zealand to control invasive species, such as rats. It can be prepared by the substitution of a C-CI bond in sodium chloroacetate (NaO:C.H:CI) for a C-F bond. What is the approximate enthalpy change for this substitution reaction on a 6.500 mole sample, based on the following bond energies? C-CI = 339.0 kJ/mol C-F- 485.0 kJ/mol

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.44QE

See similar textbooks

Similar questions

Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Use Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
9.99 The chemical reaction BBr3(g)+BCl3(g)BBr2Cl(g)+BCl2Br(g) , has an enthalpy change very close to zero. Using Lewis structures of the molecules, all of which have a central boron atom, provide a molecular-level description of why H for this reaction might be very small.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.