Suppose that after you mixed 10 mL of milk with 1 mL of lactase solution and waited three minutes, you found that your mixture of milk and lactase contained glucose. What are two possible interpretations of this result? (Hint: Think about the possibility that, before digestion, milk contains either a disaccharide or a monosaccharide.)

Suppose that after you mixed 10 mL of milk with 1 mL of lactase solution and waited three minutes, you found that your mixture of milk and lactase contained glucose. What are two possible interpretations of this result? (Hint: Think about the possibility that, before digestion, milk contains either a disaccharide or a monosaccharide.)

Biology Today and Tomorrow without Physiology (MindTap Course List)

5th Edition

ISBN:9781305117396

Author:Cecie Starr, Christine Evers, Lisa Starr

Publisher:Cecie Starr, Christine Evers, Lisa Starr

Chapter4: Energy And Metabolism

Section: Chapter Questions

Problem 3CT: Dixie Bee wanted to make JELL-O shots for her next party, but felt guilty about encouraging her...

See similar textbooks

Similar questions

An example of a monosaccharide is ________. a. fructose b. glucose c. galactose d. all of the above
When simple monosaccharides are linked together into larger oligosaccharides by the process of dehydration synthesis, what other molecule is created?
70 degree Celcious is the melting point of stearic acid, and 4 degree Celcius is the melting point of oleic acid. Explain using the concept of lipids why their melting point is so different.
Describe two conditions when it is more advantageous to use carbohydrates as a metabolic fuel rather than lipids, and explain why . Why might lipids be more advantageous under the opposite condition?
Which of the following statements best describes glucose? a. It is an aldohexose. b. It is produced from dietary starch by the action of α-amylase. c. It is utilized in biological systems only in the L-isomeric form. d. It is a disaccharide.
If both cellulose and starch are just polymers of glucose, why can we only get glucose from starch, while cellulose cannot be digested by our bodies? What is missing for cellulose?
How does the degree of unsaturation and structure of fats affects its functionality, for example in the case of trans fats? Explain for 6 sentences
What does the term “lipid divide” imply?
What is the metabolic basis for the observation that many adults cannot ingest large quantities of milk without developing gastric difficulties? What is the benefit of fiber in the diet? Why is it advantageous that polysaccharides can have branched chains? No animal can digest cellulose. Reconcile this statement with the fact that many animals are herbivores that depend heavily on cellulose as a food source.
How do each pair of the following molecules resemble/differ from each other. (a) glycogen and cellulose; (b) maltose and sucrose (c) D-glucose and D-fructose??
The symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)
Maltase is an enzyme that catalyzes the hydrolysis of the disaccharide maltose. This process occurs during human digestion when maltase is secreted by the intestine and then converts maltose into glucose. Which two classes of biomolecules are directly involved in this process?