Suppose the formation of nitrogen dioxide proceeds by the following mechanism:elementary reaction2 NO(g) N₂O₂(9)N₂O₂(g) + O₂(g) → 2NO₂(g)step12Write the balancedchemical equation for theoverall chemical reaction:Suppose also k₁ <

Overall chemical reaction Rate lawExpression of the rate constant k for the overall chemical…

Suppose the formation of nitrogen dioxide proceeds by the following mechanism: elementary reaction rate constant 2 NO(g) N₂O₂(9) k₁ N₂O₂(g) + O₂(9) k₂ Suppose also k₁ «k₂. That is, the first step is much slower than the second. step 1 2 - Write the balanced chemical equation for the overall chemical reaction: Write the experimentally- observable rate law for the overall chemical reaction. Note: your answer should not contain the concentrations of any intermediates. Express the rate constant k for the overall chemical reaction in terms of k1, K2, and (if necessary) the rate constants k.1 and k-2 for the reverse of the two elementary reactions in the mechanism. 2 NO₂(g) 0 rate = k k = 0

Suppose the formation of nitrogen dioxide proceeds by the following mechanism: elementary reaction rate constant 2 NO(g) N₂O₂(9) k₁ N₂O₂(g) + O₂(9) k₂ Suppose also k₁ «k₂. That is, the first step is much slower than the second. step 1 2 - Write the balanced chemical equation for the overall chemical reaction: Write the experimentally- observable rate law for the overall chemical reaction. Note: your answer should not contain the concentrations of any intermediates. Express the rate constant k for the overall chemical reaction in terms of k1, K2, and (if necessary) the rate constants k.1 and k-2 for the reverse of the two elementary reactions in the mechanism. 2 NO₂(g) 0 rate = k k = 0

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section16.5: Entropy And The Second Law Of Thermodynamics

Problem 16.6CE

See similar textbooks

Similar questions

Calculate H when a 38-g sample of glucose, C6H12O6(s), burns in excess O2(g) to form CO2(g) and H2O() in a reaction at constant pressure and 298.15 K.
Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.
Amoxicillin is an antibiotic packaged as a powder. When it is used to treat babies and small animals, the pharmacist or veterinarian must suspend it in water, so that it can be administered orally with a medicine dropper. The label says to dispose of unused suspension after 14 days. It also points out that refrigeration is required. In the context of this chapter, what is implied in the latter two statements?
Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?
Use the appropriate tables to calculate H for (a) the reaction between copper(II) oxide and carbon monoxide to give copper metal and carbon dioxide. (b) the decomposition of one mole of methyl alcohol (CH3OH) to methane and oxygen gases.
Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.
What would you expect to be the general temperature and pressure conditions for an optimum yield of nitrogen monoxide, NO, by the oxidation of ammonia? 4NH3(g)+5O2(g)4NO(g)+6H2O(g);H0
Calcium carbide, CaC2, is manufactured by reducing lime with carbon at high temperature. (The carbide is used in turn to make acetylene, an industrially important organic chemical.) Is the reaction endothermic or exothermic?
Which of the following quantities can be taken to be independent of temperature? independent of pressure? (a) H for a reaction (b) S for a reaction (c) G for a reaction (d) S for a substance
Consider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?
9.72 Although it can be a nuisance when a laptop computer freezes up and needs to be rebooted, we accept that as somewhat inevitable. But clearly the need to occasionally reboot the control system for the power grid would not be acceptable. Use the web to research ways that engineers ensure the reliability of crucial systems like the control infrastructure of the grid, and write a paragraph summarizing the main strategies employed.
Natural gas, which is mostly methane, CH4, is a resource that the United States has in abundance. In principle, ethane can be obtained from methane by the reaction 2CH4(g)C2H6(g)+H2(g) (a) Calculate G° at 25°C for the reaction. Comment on the feasibility of this reaction at 25°C. (b) Couple the reaction above with the formation of steam from the elements: H2(g)+12O2(g)H2O(g)G=228.6kJ What is the equation for the overall reaction? Comment on the feasibility of the overall reaction.