Q: Propose an efficient synthesis of 2,7-dimethyl-4-octanone, using organic building blocks containing…
A: In this question, we want to Synthesized 2,7-dimethyl-4-octanone by using 4 or less carbon. You…
Q: Write the reagents used to synthesise the following compound starting from the benzoic acid CH3 ?…
A: Since you have posted multiple questions, we are entitled to answer the first only.
Q: The –OH, -OR, -NH2 groups cannot be substituted directly by electrophilic substitution on the…
A:
Q: CH-CH, —С—ОН
A: In the organic synthesis, suitable reagent converts the reactants into products. Reagents attacks…
Q: Explain why carboxylic acids do not undergo nucleophilic acyl substitution reactions with amines.
A: A chemical species which has high electron density or a lone pair of electrons, by using which it…
Q: (a) Benzene to 1-t-butyl-3-ethylbenzene (b) Benzene to m-bromobenzoic acid (c) Benzene to…
A: Since you have posted question with sub-parts , we are entitled to answer the first three sub-parts…
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A: The answer is given as follows
Q: Rank the compounds in each group in order of increasing reactivity in nucleophilic acyl…
A: The rate of nucleophilic substitution increases if the compound has high electrophilicity.
Q: Identify the products obtained by the hydrolysis of the given compound. оо -COC- Select one: one…
A:
Q: What is the major product of bromination of p-methylbenzoic acid reactions?
A: p-methylbenzoic acid is an aromatic compound in which benzene ring is substituted with a carboxylic…
Q: 3-Hexanone can be synthesized from butanal and ethane using a Grignard reaction. The first step must…
A:
Q: Explain why trichloroacetic anhydride [(Cl3CCO)2O] is more reactive than acetic anhydride…
A: The nucleophiles are the type of substances that have tendency to donates the pair of electrons to…
Q: Provide the reagents needed to complete the following synthesis.
A: Given : reactants and products
Q: Rank the following three carboxylic acids in order of increasing acidity.
A: Acidic behavior of compounds is explained on their tendency to give H+ ions. In organic molecules,…
Q: Draw the structure of the aromatic product from the following reaction. но H2N° 1 equivalent
A: Since N is less electronegative than the O, Hence the attack will happen by the N and not O.
Q: ...Br t-BUOH
A:
Q: Carboxylic acids are synthesized from alkyl halides via Grignard reagent carboxylation or nitrile…
A: Let's discuss both reactions and then check which one can be easily done. 1. Firstly, the alkyl…
Q: Propose a synthesis route to prepare 2‐phenylacetaldehyde starting from benzene:
A:
Q: Write the reagents used to synthesise the following compound starting from the benzoic acid CH3 `NH-…
A: This is an example of amide formation reaction. For this transformation OH of carboxylic is first…
Q: How can you synthesize 3-methyl-1-benzenesulfonic acid and 4-methyl-1-benzenesulfonic acid starting…
A:
Q: CH3COOH + NaOH --> CH3COONa + H2O Write an equation showing the reaction of each carboxylic acid…
A: Given that - Carboxylic acid, ethanoic acid is treated with sodium hydroxide to give sodium acetate…
Q: How to predict the products of electrophilic aromatic substitution reactions ?
A: An electrophilic substitution reaction is a chemical reaction in which the functional group attached…
Q: Write reactions of 3-methylpentanol with the following reagents: a. Na b. H2SO4 conc. t = 0°C
A: 3-methylpentanol is an organic reactant. When alcohol reacts with metal, it results in the formation…
Q: How to synthesize trans-2-methylcyclohexanol from cyclohexanone?
A:
Q: Hw! -bromotoluene + NaNH, NM, () ® CH₂ NH₂ o-toluldine direct-substitution product CH3 -NH₂…
A: Initially NaNH2 will react with liq NH3 to form NH2- NaNH2 + NH3(liq) →NH2-
Q: The major product that will form during the nitration of benzoic acid is? OA H-N OR ON oc OD. COOH…
A:
Q: metayl - s peade nie 4 Bromo butanoic aad З т 3
A:
Q: acidity and bascity of carboxylic acids and its derivatives
A: The acidity and basicity of carboxylic acid depends on the type of substituent attached to it. The…
Q: Draw the structure of organic compound m-t-butylanisole Name and Draw the structures of all possible…
A: In this question, we have to find out the correct answer of given problem by the help of the…
Q: Rank the attached three carboxylic acids in order of increasing acidity ?
A: Acidic behavior of compounds is explained on their tendency to give H+ ions. In organic molecules,…
Q: Show how to synthesize 3-nitro-4-propoxybenzoic acid from phenol, C6H5OH and any reagents that you…
A: First, the phenol compound reacts with NaH and I-CH2CH2CH3 results to form following compound A.
Q: Complete this reaction of a carboxylic acid with a strong base. reaction: C_{6}H_{5}COOH…
A: A question based on stoichiometry, which is to be accomplished.
Q: What is the structural difference between p-nitrotoluene and p-nitrobenzoic acid?
A: Interpretation - To tell about the structural difference between p-nitrotoluene and p-nitrobenzoic…
Q: Which one of the following carboxylic acid derivatives can undergo nucleophilic acyl substitution…
A: Nucleophilic acyl substitution (acyl transfer reaction) occurs by a two-step mechanism. First,…
Q: Benzoic acid reacts with conc. HNO3 and conc.H2SO, to give a. o-nitrobenzoic acid b. p-nitrobenzoic…
A: Given, Choose the correct product of the reaction = ?
Q: Explain mechanism - Base-Catalyzed Addition of H2O to a Carbonyl Group ?
A: Addition of H2O is referred to as Hydration. Compounds containing Carbonyl group such as ketones and…
Q: Synthesize p-nitrobenzoic acid from benzene.
A: Benzoic acid is electron withdrawing group which makes the benzene ring suitable for electrophilic…
Q: When considering electrophilic aromatic substitution reactions, aldehydes are described as... *…
A: Generally, the carbonyl carbon is more electrons deficient in nature because it forms a double bond…
Q: meta-Chloroperoxy- benzoic acid H H エーO
A:
Q: how to synthesize 2-phenylclohexanone from cyclohexanone?
A: Synthesis of 2-phenylcyclohexanone from cyclohexanone:
Q: Which are the products of the Cannizzaro reaction * Carboxylic acid and ketone Carboxylic acid and…
A:
Q: Write the reagents used to synthesise the following compound starting from the benzoic acid CH3 HO.…
A:
Q: Starting from benzene, synthesize the following substances by choosing the appropriate reagents. a)…
A: Benzene is a cyclic six-membered aromatic hydrocarbon and has the π-electron cloud above and below…
Q: НО О СНСОН + CH,CH,OH Ethanol HCI Reaction of Esters with Grignard Reagents MgBr, ether 1. 2 OCH 2.…
A: Reaction an acid ( RCOOH )with alcohol ( R'OH ) yields esters ( RCOOR' ) with the elimination of a…
Q: 1. Propose a stepwise process for the synthesis of the aromatic compound from benzene. C₂H5 CH3 a.…
A: Given compounds are : Propose a stepwise synthesis of the given compounds = ?
Q: What groups favor the nitration of benzene and what groups do not favor it?
A: In nitration of benzene one hydrogen atom of benzene ring is substituted by one -NO2 group.…
Q: Write reactions of 2-oxopropanoic acid with the following reagents: a. KOH; b. HCN;
A: 2-oxopropanoic acid contains three C-atoms, one carbon of the carboxylic acid, the second carbon of…
Q: Propose a synthesis route to prepare 4-nitrobenzoic acid starting from benzene:
A: 4-nitrobenzoic acid can be synthesized as - Benzene reacts with methyl Chloride in presence of…
Q: COOH ČH,CH3
A: The malonic ester synthesis is the organic reaction. In which the diethyl malonate reacts with…
Step by step
Solved in 2 steps with 1 images
- Synthesize each compound from benzonitrile (C6H5CN) as the only organic starting material; that is, every carbon in the product must originate in benzonitrile.3) Beginning from acetylene and any alkyl halide needed, how would you prepare the following compound, there may be more than one step. HC=CH CH;CH,CH,CH,CH,CH,CH;An important step in one synthesis of carboxylic acids is the deprotonation of diethyl malonate and its alkyl-substituted derivative: Base CH;CH2O OCH,CH3 CH;CH,0 OCH2CH3 H2 Diethyl malonate Base CH;CH,0 °C `OCH,CH3 CH;CH,O OCH,CH3 R Alkyl substituted diethyl malonate NaOH can deprotonate diethyl malonate effectively, but NaOC(CH3)3 is typically used to deprotonate the alkyl-substituted derivative. Explain why.
- How can you synthesize 3-methyl-1-benzenesulfonic acid and 4-methyl-1-benzenesulfonic acid starting from benzene.Draw the structure of Kodel, a polyester formed from 1,4-dihydroxymethylcyclohexane and terephthalic acid. Explain why fabrics made from Kodel are stiff and crease resistant. он ноос- -COOH но 1,4-dihydroxymethylcyclohexane terephthalic acidA 6-membered heterocycle aromatic ring with two N atoms positioned two carbons apart. a Pyridine b Pyrazine c Purine d Pyrrole
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
- 19) What is the IUPAC name for this compound? CH3 H3C- -сн—сH,—CH2--с— он O 2-methyl-4-butanoic acid pentanoic acid 2-methyl butyric acid 3-methylbutanoic acid O 2-methylbutanoic acidDraw the keto and enol forms of (a) propanal and (b) 3-pentanone.Give the systematic (IUPAC) names for these molecules. Boononon cnolonongron. НаСНз CHОССH2СH2СНCHЗ CH3 phenyl propanoate |4-methyl pentane methanoat Incorrect. You mixed up the acyl and alkoxy portions of the molecule. Name the alkoxy part first, followed by the acyl part.