The reaction between aluminum and iron(III) oxide can generate temperatures approaching 3000°C and is used in welding metals: 2Al + Fe2O3Al2O3 + 2Fe. In one process, 148 g of Al is reacted with 601 g of Fe₂O3. Calculate the mass (in grams) of Al2O3 formed, and determine the amount of excess reagent left at the end of the reaction. Mass of Al2O3 formed: g Amount of excess reagent: g of What is the limiting reactant?

The reaction between aluminum and iron(III) oxide can generate temperatures approaching 3000°C and is used in welding metals: 2Al + Fe2O3Al2O3 + 2Fe. In one process, 148 g of Al is reacted with 601 g of Fe₂O3. Calculate the mass (in grams) of Al2O3 formed, and determine the amount of excess reagent left at the end of the reaction. Mass of Al2O3 formed: g Amount of excess reagent: g of What is the limiting reactant?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 106E: The reaction between potassium chlorate and red phosphorus takes place when you strike a match on a...

See similar textbooks

Similar questions

Fulgurites are the products of the melting that occurs when lightning strikes the earth. Microscopic examination of a sand fulgurite shows that it is a globule with variable composition that contains some grains of the definite chemical composition Fe 46.01%, Si 53.99%. Determine the empirical formula of these grains.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Nitrogen fixation in the root nodules of peas and other legumes occurs with a reaction involving a molybdenum-containing enzyme named nitrogenase. This enzyme contains two Mo atoms per molecule and is 0.0872% Mo by mass. Calculate the molar mass of the enzyme.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
The compound As2I4 is synthesized by reaction of arsenic metal with arsenic triiodide. If a solid cubic block of arsenic (d = 5.72 g/cm3) that is 3.00 cm on edge is allowed to react with 1.01 1024 molecules of arsenic triiodide, what mass of As2I4 can be prepared? If the percent yield of As2I4 was 75.6%, what mass of As2I4 was actually isolated?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)