The value of Kc for the the following reaction is 0.550 at 473 K. N,04(g) 2NO, (g) 3rd attempt Part 1 See Periodic Table If a reaction vessel at that temperature initially contains 0.0350 M NO2 and 0.0350 M N204, what is the concentration of NO2 at equilibrium? .105 M Part 2 O See Hint What is the concentration of N204 at equilibrium? M

The value of Kc for the the following reaction is 0.550 at 473 K. N,04(g) 2NO, (g) 3rd attempt Part 1 See Periodic Table If a reaction vessel at that temperature initially contains 0.0350 M NO2 and 0.0350 M N204, what is the concentration of NO2 at equilibrium? .105 M Part 2 O See Hint What is the concentration of N204 at equilibrium? M

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 96QRT

See similar textbooks

Similar questions

Consider the decomposition of ammonium hydrogen sulfide: NH4HS(s)NH3(g)+H2S(g) In a sealed flask at 25C are 10.0 g of NH4HS, ammonia with a partial pressure of 0.692 atm, and H2S with a partial pressure of 0.0532 atm. When equilibrium is established, it is found that the partial pressure of ammonia has increased by 12.4%. Calculate K for the decomposition of NH4HS at 25C.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At 25C. Kp = 5.3 105 for the reaction N2(g)+3H2(g)2NH3(g) When a certain partial pressure of NH3(g) is put into an otherwise empty rigid vessel at 25C, equilibrium is reached when 50.0% of the original ammonia has decomposed. What was the original partial pressure of ammonia before any decomposition occurred?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
Calculate the equilibrium concentrations of NO, O2, and NO2 in a mixture at 250 C that results from the reaction of 0.20 M NO and 0.10 M O2. (Hint: K is large; assume the reaction goes to completion then comes back to equilibrium.) 2NO(g)+O2(g)2NO2(g)Kc=2.3105 at 25 C
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Consider the decomposition equilibrium for dinitrogen pentoxide: 2N2O5(g)4NO2(g)+O2(g) At a certain temperature and a total pressure of 1.00 atm, the N2O5 is 0.50% decomposed (by moles) at equilibrium. a. If the volume is increased by a factor of 10.0. will the mole percent of N2O5 decomposed at equilibrium be greater than, less than. or equal to 0.50%? Explain your answer. b. Calculate the mole percent of N2O5 that will be decomposed at equilibrium if the volume is increased by a factor of 10.0.
Solid ammonium iodide decomposes to ammonia and hydrogen gases at sufficiently high temperatures. NH4I(s)NH3(g)+HI(g)The equilibrium constant for the decomposition at 400C is 0.215. Twenty grams of ammonium iodide are sealed in a 7.50-L flask and heated to 400C. (a) What is the total pressure in the flask at equilibrium? (b) How much solid NH4I is left after the decomposition?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?