Use a sum or difference formula to find the exact value of the following. 22n 22n cos cos + sin sin 21 21 7

Q: Use a sum or difference formula to find the exact value of the following. 2л Cos 15 2л sin 15 CoS 5…

A: Given,         cosπ5cos2π15-sinπ5sin2π15We know that,         cosA+B=cosAcosB-sinAsinB

Q: 7. Which of the following is equal to cos 108°? A. sin 198° B. cos 198° C. sin 72° D. cos 72°

A:

Q: 2. Express each of the following expressions as a single trigonometric ratio and then evaluate to an…

A:

Q: Which of the following is a valid step in proving the identity 1/ sin theta - sin theta  = cos 2…

A: Given identity 1sinθ-sinθ=cos2θsecθ Find which of the following is valid for proving the above…

Q: 3. * What value of 0 makes the statement true? cos 0 = sin ( - 10) 15 60 O 75 O 150

A:

Q: Which of these equations could be used to find x? CHOOSE ALL that a 55 23cm O cos 55=23/x O sin…

A:

Q: Find the exact value of each expression.

A: The given expression can be evaluated using the cosine of sum of angles formula or the compound…

Q: nd the exact values of the following sec( 765) 7.7 cot 6 sin(- 90°) tan(60°) - cos(600 ese:/1|+…

A: We have to find the exact value of the given following conditions

Q: Which of the following is not equivalent to cos (-? 4 a. sin O b. sin(45°) cos С. cOS d. cos 4

A: Given that: cos-π4

Q: Use the sum-to-product formula to find the exact value: If cos 255° cos 195° VA then LA

A:

Q: 2. Use the sum and difference formulas to evaluate the following. 5TT COS 12 sin (-) 7Tt а. b. 12

A:

Q: Use a sum or difference formula to find the exact value of the following. 3n sin cos 15 + cos sin 5…

A: To determine the value of the following.

Q: Suppose sin(0) -3/5 and sin(¢) = -/17, with both angles are in the interval T, 3 /2]. What must be…

A:

Q: Which of these is equal to sin 21°? A) Cos 21° B) Cos 69° C) sin 69° D) tan 69°

A:

Q: Find the exact value of each expression. (a) sin 22° cos 8° + cos 22° sin 8° (b) sin 75° (c) 11T sin…

A:

Q: 2) Use the Sum and Difference formulas to evaluate the following expression cos (345°)

A: Formula ' s  1 ) cos ( A - B )=   cos A cos B + sin A sin B    2 )  cos ( 360 ° - A ) = cos A

Q: If sin 0 = 7, 0 < 0 < <, find the exact value of each of the following. 2 (a) sin (20) (b) cos (20)…

A:

Q: Use a sum or difference formula to find the exact value of the following. sin cos 15 10 + cos 10 sin…

A: given,

Q: Use a sum or difference formula to find the exact value of the following. 31A 7L 31 7TL sin CoS +…

A: Given : sin31π60cos7π30 + cos31π60sin7π30

Q: Use the sum and difference identities to determine the exact value of the following expression. If…

A:

Q: Use a sum or difference formula to find the exact value of the following. 19n 197 sin COS 30 sin COS…

A: Given that sin19π30cos7π15-cos19π30sin7π15we know that…

Q: Use a sum or difference formula to find the exact value of the following. 25л 67 25 t sin cos cos…

A: NOTE: Refresh your page if you can't see any equations. . use the formula

Q: Assume sin(θ)=29/34 where π/2&lt;θ&lt;π and cos(ϕ)=−31/46 where π&lt;ϕ&lt;3π/2.Use the appropriate…

A: Given:

Q: II. Find the exact value of the following expression= 1. cos(26.5°) sin(-63.5°) – cos(-63.5°)…

A:

Q: Find the exact value of cos 165° by writing 165° as 120° + 45° and using a sum identity. -1 + v? 2 4…

A:

Q: Using the exact values of the sine and cosine of both 2π/3 and π/4 and an angle sum identity, show…

A:

Q: 1. Find the exact value of the following using either half-angle or sum/difference identities. a.…

A: We will use sum and difference identities.

Q: Use a sum or difference formula to find the exact value of the following. 25 Tt 25T + sin 42 cos Cos…

A:

Q: Use a sum or difference formula to find the exact value of the following. cos 7 21 6n + sin 7 sin 21…

A: To find the sum

Q: Use a sum or difference formula to find the exact value of the following. 19t sin 30 197 cos -+ cos…

A:

Q: Use a sum or difference formula to find the exact value of the following. 31n 11n 31n + sin 18 11a…

A:

Q: 1. Using the figure below, find sin(20) and cos(20). 3 8

A:

Q: 12. sin 82.5° cos 37.5°

A: Since :  Sin(82.5°) Cos(37.5°).

Q: 8) Which of these pairs are equal? A) sin 49° and sin 51° C) cos 28° and sin 72°

A: Some of the properties of the trigonometric sinπ-θ=sinθ cos(2π+θ)=cosθ cos(2π-θ)=cosθ cosπ2-θ=sinθ…

Q: If sin 8 is given and 8 E QII, find cos 6. 5 sin 8 = 26 cos e 8 =

A: sinθ=-526 By using the identity sin2θ+cos2θ=1, we get…

Q: Use a product-to-sum formula to rewrite sin 6b cos 5b as a sum or difference. sin 6b cos 5b = || %3D…

A: We know that sin(A+B) = sinA.cosB + cosA.sinB sin(A-B) = sinA.cosB - cosA.sinB

Q: Next Using a double-angle or half-angle formula to simplify the given expressions. (a) If 2…

A:

Q: Which of the following correctly expresses sin 0 + sin (70) as a product? Select the correct answer…

A: sinθ+sin7θ sin4θ - 3θ+sin4θ + 3θ Now, using the formula, sin(A + B) = sin A cos B + cos A sin B…

Q: Use a sum or difference formula to find the exact value of the following. 11 T 11 t sin 42 sin cos 7…

A: To find the value of  sinABC=sinBAC=sinCABsin90o16.76=sinB5=sinC16116.76=sinB5=sinC16⇒sinB=516.76,…

Q: 5. sin 0 ( 2 cos 0 – 1) = 0

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Given that cos 0 = <0 <n, find the exact value of each of the following. 3 (a) sin (20) (b) cos (20)…

A:

Q: Use a sum or difference formula to find the exact value of the following 2n sin + cos sin cos - 3 12…

A:

Q: how is this solved ?

A: see 2nd step.

Q: Use the sum-to-product identities to rewrite the expression. sin 18° + sin 10° Which expression is…

A:

Q: Use a sum or difference formula to find the exact value of the following. 13t cos 15 13л cos + sin…

A:

Q: Determine a value of x for each of the following. Give answers in simplest exact form. cos11π/ 31 =…

A: We know, if sin x = sin y  ⇒ x=y+2πn,  x=π-y+2πn  where n is any integer. if cot x = cot y  ⇒ x =…

Q: Use a sum or difference formula to find the exact value of the following. 17n sin cos 36 5T 17t sin…

A: You know, According to the sum formula:

Q: find the exact value of the given expression cos(7pi/12)cos(pi/6)-sin(7pi/12)sin(pi/6)

A:

Equations and Inequations

Equations and inequalities describe the relationship between two mathematical expressions.

Linear Functions

A linear function can just be a constant, or it can be the constant multiplied with the variable like x or y. If the variables are of the form, x2, x1/2 or y2 it is not linear. The exponent over the variables should always be 1.