Use a sum or difference formula to find the exact value of the following. 3n sin cos 15 + cos sin 5 15

Q: Use a sum or difference formula to find the exact value of the following. 2л Cos 15 2л sin 15 CoS 5…

A: Given,         cosπ5cos2π15-sinπ5sin2π15We know that,         cosA+B=cosAcosB-sinAsinB

Q: Which of these is equal to cos 19? A) sin 71° B) sin 81° C. cos 71° D) Cos 81°

A: We have to find cos19

Q: Use the product-to-sum formula to find the exact value: VA - B If cos 37.5° sin 7.5° then 4 A = B

A: Here use basic product to sum formulas of trigonometry.

Q: Add the sum and difference formulas for cosine to derive the following product to sum formula:  Cos…

A:

Q: Find the exact value of each expression.

A: The given expression can be evaluated using the cosine of sum of angles formula or the compound…

Q: Jse a sum or difference formula to find the exact value of the following. 9n cos 28 sin cos sin 7 7…

A: To evaluate the expression:sin4π7cos9π28-cos4π7sin9π28

Q: Use the sum-to-product formula to find the exact value: If cos 255° cos 195° VA then LA

A:

Q: 2. Use the sum and difference formulas to evaluate the following. 5TT COS 12 sin (-) 7Tt а. b. 12

A:

Q: 2. Given sin ß =- in QII, find the exact value of the following: %3D 13 a. sin(2B) b. cos (28) C.…

A: sinβ=513

Q: Find the exact value of the following.                                                       a.…

A: The solution for the above question is as shown below.

Q: Find the exact values of the following. 1. cos 585° 2. csc 600° 3. sec(-420°) 4. cot 4 117 5. sin…

A:

Q: Verify the identity by following the steps below. sin(x)cot(x) cos(x) 1) Write the left-hand side in…

A:

Q: Find the following special values: sin 0 (5) cos sin 6 (6) sin 3 COS (7) sin 7 sin - (8) (27) cos ||…

A: These angles are all standard angles and hence referring to the table of trigonometric ratios all…

Q: Find the exact value of each expression. (a) sin 22° cos 8° + cos 22° sin 8° (b) sin 75° (c) 11T sin…

A:

Q: Assume sin(θ)=18/29 where π/2<θ<π and cos(ϕ)=−13/21 where π<ϕ<3π/2.Use the appropriate…

A: Given:

Q: Find the exact value of the expression. Not a decimal.   cos^-1 (sin 7Pi/6)

A:

Q: 3) Use the sum, difference, double or half-angle formulas to find the exact value of cos(sin-1+…

A:

Q: Use a sum or difference formula to find the exact value of the following. sin cos 15 10 + cos 10 sin…

A: given,

Q: Use a sum or difference formula to find the exact value of the following. 6T TC Cos 42 TC cos + sin-…

A: Solve equation

Q: Use a sum or difference formula to find the exact value of the following. 31A 7L 31 7TL sin CoS +…

A: Given : sin31π60cos7π30 + cos31π60sin7π30

Q: Use the sum and difference identities to determine the exact value of the following expression. If…

A:

Q: 3n 8 If tan 0= find the exact value of each of the following. 2 cos (20)

A:

Q: Use a sum or difference formula to find the exact value of the following. 19n 197 sin COS 30 sin COS…

A: Given that sin19π30cos7π15-cos19π30sin7π15we know that…

Q: Find the exact value of each expression.

A: We have to find the exact value of the following trigonometric expression:…

Q: Given cos 0 0 < 0 < Find the EXACT values of the following sin 20 cos 20 tan 20

A:

Q: Use a sum or difference formula to find the exact value of the following. 25л 67 25 t sin cos cos…

A: NOTE: Refresh your page if you can't see any equations. . use the formula

Q: Find the exact value of the expression. sin 25° cos 35° + cos 25° sin 35° O 1 O 5 12

A:

Q: Prove that the given equation is an identity. sin 30 = 3 sin e - 4 sin3 e Working from the left-hand…

A: Given that, sin(3θ)=3sinθ-4sin3θ We have to prove that sin(3θ)=3sinθ-4sin3θ is an identity. First,…

Q: Use half angle or power reduction formulas to fill in the blanks in the identity below: 1 (sin(2x))*…

A:

Q: Use the given information to find the exact value of each of the following. a. sin 20 b. cos 20 c.…

A: We use double angle formulas to solve these Questions

Q: Use a sum or difference formula to find the exact value of the following. 25 Tt 25T + sin 42 cos Cos…

A:

Q: Use a sum or difference formula to find the exact value of the following. cos 7 21 6n + sin 7 sin 21…

A: To find the sum

Q: What expression is equal to the given expression below? 1-cos 8x 1+cos 4x A. 2 sin 2x B. tan 2x

A: Given: y=1-cos8x1+cos4x We know that 1-cos2θ=2sin2θ…

Q: Use a sketch to find the exact value of the following expression. 8. Cos 1 sin 10 8 cos 1 sin (Type…

A: We know cos(sin-1(x))= 1-x2 for all x in  [-1, 1]

Q: Find the exact value of cos 285° by writing 285 as a sum and using the sum identity.

A: Sum identity is cos(A+B)=cosAcosB-sinAsinB

Q: Use a sum or difference formula to find the exact value of the following. 19t sin 30 197 cos -+ cos…

A:

Q: Use a sum or difference formula to find the exact value of the following. 31n 11n 31n + sin 18 11a…

A:

Q: 12. sin 82.5° cos 37.5°

A: Since :  Sin(82.5°) Cos(37.5°).

Q: 3. cot-(cos) 3 4. sec(cos-12 + sin-1) 3 3

A: We have to find exact value of the given expression.

Q: Use half angle or power reduction formulas to fill in the blanks in the identity below: 1 cos( 1…

A: Using the half-angle formula we get: (sin(4x))4 =(sin2(4x))2…

Q: Find the exact value.. 1. Cos 70°cos40°+sin70°sin40° 2. Sin 7π/12 using the fact the 7π/12= π/3 +π/4

A:

Q: Use half angle or power reduction formulas to fill in the blanks in the identity below: 1 cos( 1…

A: Given:sin7x4

Q: Find the exact value of the expression whenever it is defined. (If an answer is undefined, enter…

A: Please see the answer below.

Q: Use a sum or difference formula to find the exact value of the following 2n sin + cos sin cos - 3 12…

A:

Q: Use a sum or difference formula to find the exact value of the following. 13t cos 15 13л cos + sin…

A:

Q: Add the sum and difference formulas for sine to derive the following product to sum formula:  sin α…

A:

Q: Given sinb =5/13 in QII, find the exact value of the following. A. Sin (2b) B. Cos (2b) C. Tan (2b)

A:

Q: Apply the sum and difference identities to find the exact value of the given expression.…

A: Given expression as

Q: Use a sum or difference formula to find the exact value of the following. 17n sin cos 36 5T 17t sin…

A: You know, According to the sum formula:

Q: find the exact value of the given expression cos(7pi/12)cos(pi/6)-sin(7pi/12)sin(pi/6)

A:

Equations and Inequations

Equations and inequalities describe the relationship between two mathematical expressions.

Linear Functions

A linear function can just be a constant, or it can be the constant multiplied with the variable like x or y. If the variables are of the form, x2, x1/2 or y2 it is not linear. The exponent over the variables should always be 1.