Use an addition or subtraction formula to find the exact value of tan 75° = A+ VB, and fill in the values of A and B.

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. tan 12

A:

Q: Determine the value of each angle to the nearest degree  Cos B = 0.9823

A: Given, cos B = 0.9823

Q: Use the compound angle formulae to determine the exact value of the following expressions. tan"+tan"…

A: (4) a Given that tanπ12+tanπ61-tanπ12tanπ6   It is known that tanx+y=tanx+tany1-tanxtany So,…

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. sin(15°)

A:

Q: Use the half-angle formulas to determine the exact values of the sine, cosine, and tangent of the…

A: To find: The value of sin 15°, cos 15°, tan 15°. Formula used: Half angle formula: sin θ=1-cos 2θ2…

Q: Given tanθ = - 2, 270° < θ < 360°, find the exact value of the remaining five trigonometric…

A: Given tanθ = - 2, 270° < θ < 360°, We know that  tanθ=PerpendicularBase Since the tanθ is in…

Q: Which expression represent tan(@) for the triangle shown?

A: In a right angled triangle, the tangent of an angle is: The length of the side opposite the angle…

Q: Use an Addition or Subtraction Formula to simplify the equation. cos(?) cos(2?) + sin(?) sin(2?) =…

A: cos(x)cos(2x)+sin(x)sin(2x)=22[Formula cos(A)cos(B)+sin(A)sin(B)=cos(A-B)…

Q: use the half angle formula to find the exact value, not a decimal approximation. of cos(pi/8)

A: Half angle formula of cos, cos2A=2cos2A-1 2cos2A=cos2A+1cosA=cos2A+12

Q: Find the reference angle for 6. radians JT

A:

Q: Use the reference angle to find the exact value of the given expression. 117 cos 4

A: Given : cos11π4

Q: Determine the value of each angle to the nearest degree   sin A = 0.1265

A:

Q: Find angle A rounded to the nearest tenth of a degree when cos A = 0.4104.

A:

Q: Use the appropriate compound angle formula to determine the exact value of each expression. cos (T-)…

A:

Q: Use the half-angle formula to simplify the given expression. 1 + cos 12x 2

A: The given expression is:1+cos12x2We need to simplify the above expression using half-angle formula.

Q: Use a calculator to find the value of the acute angle θ to the nearest degree, sin u = 0.2974

A: According to the question, we have to find the value of sin u=0.2974 to the nearest degree using…

Q: Use the given conditions to find the exact values of sin(2u), cos(2u), and tan(2u) using the…

A: Given,          cosu=-1517 ,  π2<u<π

Q: Find the value of each trigonometric ratio. cos C 40 B. 30 50 of

A:

Q: Use a reference angle to write cos(260∘) in terms of the cosine of a positive acute angle.

A:

Q: Determine the value of angle A that corresponds to tan A = 6.0840. Round the answer to the nearest…

A: We need to determine the angle.

Q: If cos7A = sin(A-60) where 7A is an acute angle , Find the value of A

A: Solution Given cos 7A = sin ( A - 6⁰ ) sin ( 90⁰ - 7A )= sin ( A - 6⁰ ) Since ( 90⁰ - 7A ) and  ( A…

Q: Use the half-angle formulas to determine the exact values of the sine, cosine, and tangent of the…

A:

Q: Complete the half-angle identity. sin 스 =

A: To express sin(x/2) in terms of trigonometric ratios of x.

Q: Use the half-angle formula to find the exact value of cos(165°).

A: 165 degrees is in the second quadrant. So cos 165 will be negative.  Then we use the half-angle…

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. tan(15°)

A:

Q: Use a half-angle formula to find the exact value of tan (pi/8).

A:

Q: Simplify the expression by using a Double-Angle Formula or a Half-Angle Formula. 1- cos(40°)

A: (a) Consider the given trigonometric expression 1-cos40°2=1-cos2·20°2=1-1+2 sin220°2       Since,…

Q: Use the figure shown to the right and the given values to find c, sin 0, and tan 0. α a = 8, b = 15

A:

Q: What is the reference angle associated with cos 240o ?

A: Answer is- -1/2 Explanation is given below....

Q: Convert the angle in degree to radian. Express the answer in the multiple of t . 260°

A:

Q: Convert the angle 270° to radians. Give the exact value and use pi for T. %3D

A: Angle problem.....

Q: Use an addition or subtraction formula to find the exact value of tan75 degrees =A√+1B√−1 A= B=

A: Consider the expression tan75 degrees The addition formula for tangent is given by

Q: Given the triangle below, find tan(0).

A:

Q: find tan H for the triangle

A: Using trigometric ratio

Q: cos7A = sin(A-60) where 7A is an acute angle , Find the value of A

A:

Q: Use an appropriate half-angle formula to find the exact value of the expression  tan(π/8)

A:

Q: find the angle Sin A = 0.5

A:

Q: Use a calculator to find the value of the acute angle 0 in radians, rounded to three decimal places.…

A: We have to use a calculator to find the value of the acute angle θ in radians  cos θ = 0.6302

Q: Use a reference triangle to find the given angle. 1 - 1 sin

A:

Q: Determine the value of angle A that corresponds to tan A = 6.0840. Round the answer to the nearest…

A:

Q: Use the appropriate compound angle formula to find the exact value of cos 3

A:

Q: Apply the compound angle formulas to solve the following: a) tan 75⁰ (in degrees) b) Cos +

A:

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. cos (2)

A:

Q: Determine the value of angle A that corresponds to tan A = 1.8473. Round the answer to the nearest…

A:

Q: Find all angles, os0<360, that satisfy the equation below, to the nearest 10th of a degree. 3 cos(0)…

A:

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. co()

A:

Q: The angle between 0 and 2T in radians that is coterminal with the angle T in radians is 2

A:

Q: Use a calculator to find the value of the acute angle θ to the nearest degree, cos u = 0.8771

A: Consider the provided information, cosθ=0.8771 Use a calculator to find the value of the acute angle…

Q: Convert the angle 225° to radians. Give the exact value and use pi for T.

A: