Using Lewis structures, write balanced equations for the following reactions:(a) HCl(g) + PH3(g) ⟶(b) H3 O+ + CH3 − ⟶(c) CaO + SO3 ⟶(d) NH4 + + C2 H5 O− ⟶

Q: What is the pH of a solution with [H3O+]=2.42 x 10-4?

A: pH of any solution is given by  pH = -log[H3O+] where [H3O+]= concentration of H3O+ ions

Q: What is the concentration of Cl- ions in a solution of 0.30 M FeCl3 (aq) ?

A: The reaction can be represented as given below.

Q: Which of the following is an acidic salt? O NaBr O KNO3 HI O NH4CI O NACIO

A: Acidic salt : strong acid and weak base combination.

Q: What is the pH of a 7.7 × 10⁻⁴ M HClO₄ solution?

A: The HClO4 is a strong acid and it fully dissociates in water as H+ and ClO4- So the concentration of…

Q: Al, Al2O3 en Al(OH)3 is amphoteric. A) Explain what the statement means? B)Give reaction equations…

A: Amphoteric substances are those substances which reacts with both acid and base due to having…

Q: The neutralization of a strong acid and strong base has an enthalpy change, ∆H°, = -55.9 kJ/mol. The…

A: The relationship between ∆S°, ∆H° and ∆G° is given by  ∆G° = ∆H° - T∆S° where T = temperature in…

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: 8. What are the [H3O+] and [OH–] of Diet Coke that has a pH of 3.17?

A:

Q: .Write a balanced equation for the dissociation of each of the following Bronsted- Lowry acids in…

A: Bronsted-Lowry acid-base theory: The Bronsted-Lowry acid-base theory states that the acid is a…

Q: which of the following would be a the reaction of Ca o plus NaF

A: When calcium oxide reacts with sodium fluoride gives calcium fluoride and disodium oxide.

Q: If log K, for Ag(NH3)2* is 3.31 and log K2 is 3.91, what is K,?

A:

Q: Write the chemical reaction of HC2H3O2 with water.

A:

Q: Oxides can react with water to form acids or bases. Identify each of the following oxides as acidic…

A: Oxides of compounf of elements reacts with water and produces either acidic compounds or basic…

Q: Each day the stomach produces 2.0 L of gastric juice that contains 0.10 M HCl. Phillips Milk of…

A: Given ,  Molarity of HCl (M1) = 0.10 M Volume of HCl (V1) = 0.093 L = 93. mL  Concentration of…

Q: Determine the pH of a 0.461 M C3H5CO,H M solution if the K, of C6H5CO2H is 6.5 x 105. 4.52 11.74…

A: pH  is commonly known power of hydrogen,  it measures the concentration of hydrogen ion in the…

Q: calculate the ph of a 0.600 solution of Na2S

A: When Na2S dissolved in water - Na2S + 2H2O <===> 2NaOH + H2S Thus, sodium Sulfide is a salt of…

Q: What is the pH of a 1.47 mol/L solution of HCN(aq) if its Ka = 3.5 ´ 10-11?

A: HCN is a weak acid hence it can dissociate partially Ka value of HCN=3.5×10^-11

Q: A glass of milk has a pH of about 6 and a cup of tea has a pH of 5. Which one has more hydronium…

A: GivenpH of milk = 6pH of tea = 5

Q: Calculate the pH of a 3.97×10³ M solution of NaF, given that the Ka of HF = 6.80 x 10-4 at 25°C.

A:

Q: Complete and balance the following acid-base equations:(a) A solution of HClO4 is added to a…

A: Precipitation reaction It is the formation of an insoluble salt when two solutions containing…

Q: What is the pH of a 0.870 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Answer:- This question is answered by using the simple concept of hydrolysis of the salt formed by…

Q: Write the basic equilibrium equation for PO4º 3-

A: The balanced chemical equation for the reaction contains equal number of atoms on both the sides of…

Q: Write a net ionic equation for the equilibrium that causes the solution of KHTar in water to be…

A: KHTar is used for potassium acid tartarate. A solution is said to be acidic when there is the…

Q: What is AH for the following reaction? H2O2(1) → H2(g) + 02(g)

A:

Q: are there sodium hydroxide properties in vinegar?

A: The vinegar solution is aqueous form of acetic acid.

Q: Which is the stronger acid, HClO4 or HBrO4? Why?

A: Chlorine (Cl) and bromine (Br) are halogens which belong to group VII A with a valence electron…

Q: Predict the electrolytic activity of NaBr and C2H5OH, respectively.

A: 1. Substance that dissociates into ions are called electrolytes and the substance that never…

Q: For  K w, the product of [H 3O +] and [OH -] is

A: Kw is the water constant and is defined as product of hydronium ion and hydroxyl ion  Kw = [H3O+]…

Q: What is the concentration of lithium ions in 0.215 M Lİ2SO4?

A:

Q: What is the pH of a 2.7 × 10⁻⁴ M HClO₄ solution?

A: The question is based on the concept of PH calculations. we have been given perchloric acid. We have…

Q: Calculate the pH and percent ionization of a 2.5 x 102 45 x 10:4)

A:

Q: What is the pH of a 6.7 × 10⁻⁴ M HClO₄ solution?

A: Consider the dissociation of HClO₄ in water is as follows;      It is given that one molecule of…

Q: K eq for the following Write the formula for the reaction: 2NH, () +3H28) N26) 3 (g) edio

A: Keq is the equillibrium constant.  It gives the relation between concentration of product and…

Q: Based on the pH measured for the solution of (NH4)2CO3, is NH4+ is a stronger acid or is CO2−3…

A: Given: To determine whether (NH4)2CO3  is strong acid or strong base.   Definition: (NH4)2CO3 is…

Q: What is the hydronium ion concentration [H3O+] of sea water which has a pH of 8?

A:

Q: Is Mg(OH)2 a acid, base, or neither?

A: According to the Arrhenius concept of acids and bases :-  Acids donate H+ ions in water and bases…

Q: The neutralization of a strong acid and strong base has an enthalpy change, ∆H°, = -55.9 kJ/mol. The…

A:

Q: Al, Al2O3 en Al(OH)3 is amphoteric. Explain what the statement means? Give reaction equations to…

A: The substances which are capable of showing dual character (acidic and basic) in aqueous solution…

Q: 3. Write a net ionic equation for the equilibrium that causes the solution of KHTar in water to be…

A: The potassium acid tartrate, KHTar salt is obtained from neutralization reaction of tartaric acid by…

Q: What is the pH of a 2.72.7 M solution of HClO4?

A:

Q: If pH = 5.7, what is [OH ] ?

A: Given a PH = 5.7  Calculate the [OH-] concentration.    calculate the [OH-] of first of calculate…

Q: 4. When H,PO, reacts with H,O in an acid/base reaction, H;O° acts as the acid. The conjugate base of…

A:

Q: The elements sodium, aluminum, and chlorine are in the same period.(a) Which has the greatest…

A: Across the 3rd period, on moving left to right the size of the element decreases continuously…

Q: Consider the weak base ammonia.  a) Write a balanced net ionic equation for aqueous solutions of…

A: Equilibrium constant in terms of concentration is the ratio of the concentration of product to the…

Q: What is the pH of the solution with a hydronium concentration [H3O+] 1.47 x 10-4?

A: The pH of any solution gives the calculative estimate of the concentration of the hydrogen ions…

Q: What is the molar concentration of all the ions in a solution of 0.120M Al2(SO4)3?

A:

Q: Complete and balance the following acid–base and acid-carbonate reactions:(a) Al(OH)3+H2SO4

A: A chemical reaction is symbolic representation of the conversion of substances to new substances.In…

Q: What is the pH of a 2.12.1 M solution of HClO4?

A:

Q: A solution of 1.5 M chlorous acid has a pH of 0.91.  What is the percent ionization of the chlorous…

A: Given, A solution of 1.5 M chlorous acid has a pH of 0.91.  KA = 1.1 x 10−2.

Q: 8 g of potassium chloride is dissolved in a quart of distilled water. Calculate the pH value of the…

A: