what functional groups are shown here

Q: I don't know how to work out how many isomers of this molecule?

A: Optical isomers:The compounds have a structural molecular formula but different in the arrangements…

Q: Which of the following molecules are isomers? (Make sure you can see all of all three structures.)…

A: Isomers are the compounds having same molecular formula but having different properties. The…

Q: Which structure is paired with wrong name?

A: Given :- structures with their IUPAC or common name  To find out :-  structure with wrong name

Q: Provide the correct systematic name for the compound shown here. ΝΗ

A: We have to give the name of this amide.

Q: Identify all functional groups in the structures below. Make sure to circle and label each  of them.…

A: A functional group is an atom or group of atoms other than the main hydrocarbon chain that is…

Q: What is the name of the structure below? CI

A: The given compound consist of a benzene ring which is bonded with four substituents.

Q: 4. For the molecule below, provide the following: ОН Н HO. CI a) number of chiral carbons:

A: The given structure is- a) A chiral carbon is the one which is bonded to 4 different types of atoms…

Q: 1) m) ou

A: Given compounds are :  Identify and circle the functional groups in the given structures ?…

Q: Locate and identify the functional groups in the following molecules:

A: Note: Since you have posted a question with multiple subparts, we will solve the first three…

Q: List the functional groups in the structures below:

A: A functional group is an atom or group of atoms bonded together in a specific manner and attached to…

Q: Identify the functional group in the compound below.

A:

Q: Provide the correct systematic name for the compound shown here.

A:

Q: Provide either the common or systematic name for the molecule below: NO2 'NO2

A: To find the common name or synthetic name of  Common names are also in the nomenclature system. It…

Q: Determine the number of primary, secondary, tertiary and quaternary carbon atom that can be found in…

A: Primary carbon atom is that which is directly linked to 1 carbon atom only. Secondary carbon atom is…

Q: Please draw the corresponding structure of the following compounds.

A: given draw the crroesponding structure

Q: What functional groups do I have? As many details as possible.

A: The spectrum shown above belongs to IR spectroscopy. IR spectroscopy is a useful technique in…

Q: Identify the functional group(s) present on the compound pictured here: CH H,C a) Alcohol b) Ether…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Which functional group is not found in the structure shown below? O H₂N OH O ether O alcohol O…

A: Functional groups are some special atoms which gives identity to the compound. Example:  1. Alcohols…

Q: Box the functional groups present in the following compounds and name them

A:

Q: What is the correct systematic name for the compound shown here? H3C CH3

A: In the given structure:- The functional group is an ester. So, the suffix will be "oate". There is a…

Q: Match correctly all functional group for the lettered molecules: . А с E OH NH₂ G в D F ОН

A: Here we have to write the name of functional group present in the following given compounds.

Q: What is the molecular formula of the structure shown? O C13H26 O C13H28 O C13H27 C13H29

A: Requirement from question:     MF: C13H28

Q: Name the molecule shown

A: If we want to determine the name of any organic molecule, we need to determine - 1. The functional…

Q: Locate and identify the functional groups in the following molecules. (a) CH2OH (b) (c) H .N. `NHCH3…

A: Functional groups refer to atoms or group of atoms that are responsible for its chemical reactivity…

Q: 2. 3. CH 3 애 CH₂ CH3N 대3

A: Names for given molecules are: (1.) 3-Cyclopentene-1-carboxylic acid  (2.) 3-Methylpentanoyl…

Q: How many structural isomers do you predict for the following compound?

A: The structure of chemical compound can be represented as structural formula. A structural formula…

Q: Identify all of the functional groups in the following compounds:

A: Functional groups The functional group is a group of atoms that have an extremely important role in…

Q: Which functional groups are present in the compound shown below? SELECT ALL THAT APPL' НО _NH, Но…

A: A functional group in an organic molecule is an atom or group of atoms that are responsible for the…

Q: Draw the cis isomer of the structure shown below.

A:

Q: (CH),) is shown below. Highlight each atom that is in a methyl group. The chemical structure of…

A:

Q: Identify the highlighted functional groups in this molecule.

A:

Q: Provide the correct systematic name for the compound shown here. ОН ОН ОН

A: Rules for IUPAC nomenclature of Alcohols: • Identify the longest continuous carbon chain. • Identify…

Q: Give A Summary about Isomers ?

A: Isomers are molecules that have the same molecular formula but different structural arrangement of…

Q: HO Identify the functional groups in the above compound. i. Carboxylic acid ii. Ether iii. Alcohol…

A: The group of atoms contains heteroatoms is known as a functional group. The functional group…

Q: What is abbreviation of the structure shown? A. TAC B. CAT C. CGT D. TGC

A: The DNA sequence is read from the 5' to the 3' end. The abbreviations for each letter is shown in…

Q: Label All the functional groups present in the structures below (to the right)

A: A functional group is a moiety in a molecule that shows the molecule's characteristic chemical…

Q: Provide the correct systematic name for the compound shown here. CH,CH3 CH2CH3

A: We have to  write  correct  systematic name of below compound.

Q: whwn naming a compound do ignore the di,tertri and the iso and juat look at the alphebets of the…

A: Interpretation -   When you did a naming of a compound then just ignore the di, tertiary and iso…

Q: Show the repeating unit which would be obtained by reacting (а) HOOC(CH,), COOH and H2N(CH2), NH2…

A: Repeating unit of a polymer is the smallest part of a polymeric chain repeats itself to form the…

Q: NH

A:

Q: Et d ene 3

A: The given organic compound is  CH3-CH2-CH(OH)-CH2-CH2-CH=CH2

Q: Which of the following illustrates an equatorial OH? нот OH "OH B. A. C. D.

A: For six membered cyclic ring, chair form is the most stable. It has two positions at each vertex…

Q: F77612.SP 100.0- 90- 80 70 60- 50 40- 30 20- 10 0.0. 3500 3000 1300 1600 S400 1200 S000 00 4000.0…

A: IR spectrum is the fingerp[rint of a molecule

Q: III. The next compound is folic acid, a vitamin important for function at the cellular level in…

A: Complete solution is given below in next step

Q: Но HN NH H2N-

A: RCOOR' = ester  ROR' = ether  RNH2 = primary amine  R2NH = 2°/ secondary amine  RCOOH = carboxylic…

Q: Identify all functional groups in the structure below. Make sure to circle and label  each of them

A: A functional group is an atom or group of atoms other than the main hydrocarbon chain that is…

Q: What are the two functional groups highlighted in the diagram

A:

Q: What is the most polar/functionality for this compound?

A:

Q: 7. How many isomers does hexane have? Draw and name them below.

A:

Q: Provide the correct systematic name for the compound shown here. O || CH3-CH2-C-O-CH3

A: The correct systematic name of the given compound is

Stereochemistry and Isomerism

Stereochemistry deals with the three-dimensional structure and properties of molecules. It explains the arrangement of atoms and their manipulation within a molecule in a 3D structure. Stereochemistry can be dealt with all types of molecules. Based on the stereochemistry of a molecule, the physical and chemical properties of the molecules vary.