What is the compound name of Hg2(CH3COO)2 ?

Q: Give the name or condensed structural formula, as appropriate: CH3CH2CH(C2H5)CH2CH2CH2CH3

A: The first and the foremost step while naming the IUPAC name of an organic compound is the…

Q: لملسم The monomers H₂N- -NH2 and HD- would react with each other to form O a polyester O a…

A: Polyester: It is a category of polymers that contain ester functional group in every repeating unit…

Q: The group having the condensed structural formula “CH3CH2CH(CH3)–” is called ___ .

A:

Q: How To Draw the Chair Form of Cyclohexane ?

A: In Chemistry, one of the most accurate ways to represent the aromatic rings like Cyclohexane rings…

Q: Draw the carbon-skeleton structure of CH3CH3.

A: The skeletal structure of an organic compound is the series of atoms bonded together that form the…

Q: Give the systematic (IUPAC) names for these molecules. -OCCH2CH3

A: In this question, we have to write down the correct IUPAC name of given compound by the help of…

Q: Give the IUPAC name for this molecule. CH3 CH3CHCH2CH½CH2CH

A: Given : The above chemical compounds   To find:  Find IUPAC Name for the following compounds

Q: give the bond polarity for each type of bond in the molecule for ch3coch3?

A: Bond polarity is the separation of electric charge along a bond, leading to a molecule or its…

Q: How many isomers does C3H6Br2 have and what are their names?

A: Isomers :  Isomers has same molecular formula but different in their structures.

Q: Give the name or condensed structural formula, as appropriate: CH3CH2CH(CH3)CH2CH(CH3)2

A: The given compound is in condensed structural form. The structure can be also be drawn as,…

Q: O₂N O OCH 3 H₂, Pd-C draw structure ...

A:

Q: What is the following molecule? CH3 CH2 CH2 CH3 CH CH2 . CH CH3 CH3 CH3 но Glucose Ketone Sterol…

A: The given structure is not Glucose, because Glucose molecular formula C6H12O6. The given structure…

Q: what is the name of CH3COO-

A: CH3COOH (aq) + H2O(l) <---> CH3COO-(aq) + H3O+(aq)  According to Lewis Concept, A substance…

Q: H. CH2CH3 .CI H.

A: Given  We have to write the IUPAC name of this molecule.

Q: Give the IUPAC name for this molecule. CH3 CH3CHCH2CH2CH IUPAC name: 4-methylhexanal

A:

Q: LOH H3PO4

A:

Q: Draw the structure for 2-ethylcyclopentanecarbaldehyde :

A: The Structure of 2-ethylcyclopentanecarbaldehyde is given as:

Q: 4. Draw structural formulas for and name three isomers of C4H&O

A: Three isomers of C4H8O given below:

Q: name the organic composition CH3CH2CH2CH2CHClCH (C3H7) CH2CH3

A: IUPAC Rules for Alkane Nomenclature Find out and name the longest continuous carbon chain. Choose…

Q: Name the organic structure. CH3CH2 CH2CH2 C = C CH3 H.

A: Given : structure of the compound.  To find : name of the organic compound. Solution : As we know…

Q: Is the compound CH3CH=CH2 saturated or unsaturated? Explain.

A: Saturated Hydrocarbons — contain only carbon- carbon single bonds. Saturated hydrocarbons are named…

Q: What is the name of this chiral molecule?

A: The name of the chiral molecule is given below:

Q: H3C CH3

A: IUPAC name is given by.

Q: what is the correct IUPAC name for Ca(C₂H₃O₂)₂?

A: The IUPAC nomenclature of inorganic chemistry is a systematic method of naming inorganic chemical…

Q: What is the name of this compound? CH3(CH2)16COCH2CH2CH3

A: Interpretation:  IUPAC name for the given compound has to be given. Concept introduction:

Q: What is the main IM Force in BrO3- ?

A: The interaction that exists in molecules leads to the generation of intermolecular forces (IM).…

Q: 1. NaOCH2CH3 2. CH3CH,CH2I

A: Nucleophilic substitution then, Ester hydrolysis and finally decarboxylation. Beta keto-ester have…

Q: NaOCH3 ? CH3OH

A:

Q: Name the following organic compound containing oxygen. CH3CH2- CH2CH2" 0-CH3

A:

Q: Explain Compounds Containing a C=O Group ?

A: The functional group composed of a carbon atom double-bonded to an oxygen atom, i.e, C=O is called…

Q: a) • Name the compounds represented by the following line structures b) CH₂CH₂CH3 I CH3

A:

Q: What is the IUPAC namefor the compound with structure CH, CHCH,? CN

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: The chiral carbon atom is: a. A carbon atom that has a double bond b. A carbon atom that has no…

A: The answer is given as follows  A chiral carbon is that carbon which have four different group,…

Q: Which substance, CH3CH3 or CH3NH2 has the higher boiling point? Explain

A: Given molecules are CH3CH3 and CH3NH2 Molecules with hydrogen bonds will always have higher boiling…

Q: What is the correct IUPAC name for Cl₂O₇?

A: The most accepted name of a chemical compound is governed by IUPAC. The IUPAC name is governed by a…

Q: CH3 H3C.

A: A functional group in a molecule is a substituent that is responsible for the molecule's chemical…

Q: ОН H3C- CH3 ОН

A: Alcohols have hydroxy group (-OH) attached as a functional group to the carbon chain. There are…

Q: Name the organic structure. CH3CH2CH2CH2 C = C CH3

A: Given organic compound is,

Q: what is the IUPAC name of {Pt(Cl) (H) (Et3P)2 } ?

A: Given compound is a mononuclear coordination compound. First, the groups that surround the central…

Q: Which molecule is a saturated fatty acid? O CH3COOH O CH3CH=CH(CH2)6COOH CH3(CH2)7CH2COOH O…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: There are ________ covalent bonds in CH3CH2CH2CHCl2

A: The covalent bond is formed by the sharing of the elections. If two atoms share one electron pairs…

Q: What is the number of components in CH3COONH4,H2O,NH4+,CH3COO-

A: The number of components is defined as the presence of the chemically independent species in a…

Q: CH3 CH3CHCH3 + Br,

A:

Q: H3C. CI //

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Draw the organic product formed when CH3CH,C=C¯Na" reacts with (CH3),CHCH,CH,CI. Click the "draw…

A: Nucleophilic substitution reactions (NSR) :  Given acetylide ion acts as like  nucelophile, this…

Q: The chiral carbon atom is: a. A carbon atom that has a double bond O b. A carbon atom that has no…

A: The valency of carbon atom is four which implies the carbon atom can be attached with four atoms of…

Q: CH2 H3C.

A: IUPAC name of the above compound has to be given below,