QUESTION 9What is the correct IUPAC name for:CH3 CH3CH3CH2CHCH2CHCH31,1,3-trimethylpentane1-ethyl-1,3-dimethylbutaneO 2,4-dimethylhexane3,5-dimethylhexane

Answered: Image /qna-images/answer/89d8928e-1f98-4e06-ba61-494c6c5a0251.jpg

Answered: What is the correct IUPAC name for: CH3…

What is the correct IUPAC name for: CH3 CH3 CH3CH2CHCH2CHCH3 O 1,1,3-trimethylpentane 1-ethyl-1,3-dimethylbutane 2,4-dimethylhexane O 3,5-dimethylhexane

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter13: Unsaturated Hydrocarbons

Section: Chapter Questions

Problem 13.21EP: The following names are incorrect by IUPAC rules. Determine the correct IUPAC name for each...

See similar textbooks

Related questions

Q: What is the correct IUPAC name for the following organic molecule? a.…

Q: Name the following compound according : to the IUPAC rule CH3 CH,. CH,. CH. с. сН. СH, C,H5 CH3…

Q: What is the IUPAC name for the following alkane? CH3 CH3-CH-CH2-CH3

A: Given structure of the compound,

Q: Give the structure corresponding to each IUPAC name. a. 3-methylhexane c. 3,5,5-trimethyloctane b.…

A: IUPAC nomenclature is the most widely accepted nomenclature of organic and inorganic compounds in…

Q: Select the correct IUPAC name for: CH3 CH3 CH2CH2CH2CCH2CH3 CH2CH2CH3 A) 5-methyl-5-ethyloctane B)…

A: The correct IUPAC name of the given compound is

Q: The IUPAC name for (CH32CHCH(CH3)CH2CH=CH, is . A) 4,5-dimethyl-1-hexene B)…

A: A systematic name is given to an organic compound by IUPAC nomenclature. The set of rules which are…

Q: What is the correct IUPAC name for the following molecule? CH3 CH3CH2CH2CH2CCH2CH3 CH2CH2CH3…

Q: What is the IUPAC name for the following compound? CH3-0-CH2CH-0-CH3 CH3

A: The given compound consists of an ether functional group.

Q: What is the IUPAC name for the following alkane? CH3 CH3 CH₂-C-CH₂-CH-CH₂ CH₂

A: (1) This compound has long chain of five Carbon and there are two methyl groups attached to second…

Q: What is the IUPAC name for the compound shown? CI H3C, CH3 H3C CH3 CI The IUPAC name is: CI O…

A: We have to predict the correct IUPAC nomenclature of given structure.

Q: Give the correct IUPAC name for the following compound: CH3CH2CH2 CH3CCH2CH2 CH2CH3 CH3CH2…

A: We have a structure of compound, we have To decide the correct IUPAC nomenclature of the given…

Q: What is IUPAC name of the following compound? 3-ethyl-4,5-dimethyl-3-heptene O…

A: According to IUPAC nomenclature rule: Step 1 : Identify longest carbon chain ,here it is six member…

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: In order to write iupac name we have to follow some rule 1) first select longest carbon chain 2)…

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: Hii there, As there are multiple sub parts posted. we are answering first-three sub parts . If you…

Q: IUPAC name of the following compound is: C2H5 CH;-C-CH-CH3 CH2 A 3-Ethylbut-2-ene B 2,3…

A: The given compound is an alkene. Hence, the suffix "-ene" is used for the compound.

Q: CH3 H3C CH3 CH3 H3C

A: Given : Structure of the compound. To find : IUPAC name of the following compound. Solution : As we…

Q: The correct IUPAC name for the following compound is CH2 H2 H3C. CH3 H3C CH3 a.…

A: Answer

Q: What is the IUPAC name for each of the following compounds? a.C6H5CH2(CH2)3COOH b. Br(CH2)3COOH D-CH…

A: In this question, we will give the IUPAC name of the given three compounds. You can see the…

Q: What is the IUPAC name of this compound? CH₂CH3 CH₂-CH-CH-CH₂CH₂CH³ | CH3 Multiple Choice O…

Q: Select the IUPAC name for the following structure: CH3 CH-CH, CH,CH, CH,-CH-CH-CH,-CH-CH, CH,-C-CH,…

A: The compound given is,

Q: CH3 CH3 H3C CH2

A: Common rules of IUPAC NOMENCLATURE firstly find and name the longest continuous carbon chain.…

Q: What is the IUPAC name of the following compound? CH, O (R)-4-methyl-2-hexyne O…

Q: What is the IUPAC name of the following compound? CH;CH2C(CH3)½CH2CH(C>H5)2…

A: Rules for naming the organic compound is as follows; Choose the longest continuous carbon chain.…

Q: What is the IUPAC name of CH3-CH2-CH-C-CH2-CH2 a CH3 3-chloro-4-heptanone…

A: ->For IUPAC name first of identify long chain which contains functional group . ->Then give…

Q: What is the correct IUPAC name for the following compound? Br 3-bromo-2,3-dimethyl butane…

A: Write IUPAC NAME OF THE GIVEN STRUCTURE--

Q: CH CH₂ CH3 โจ-15-12-0-0 a chz คว 12-12-12-5-50 P

A: Name the following hydrocarbons using IUPAC rules:

Q: The IUPAC name of this disubstituted cyclohexane is trans-1-ethyl-2-methylcyclohexane CH3 CH2CH3…

Q: What is the IUPAC name of the following compound? (CH3)3CCH2CH(CH2CH3)(CH2)2CH3 O…

Q: What is the correct IUPAC name of this organic compound? O 4-methyl-3-ethyl-2-heptene O…

A: Some important rules for IUPAC naming :- Longest chain rule :- Select longest possible continuous…

Q: What is the IUPAC name for the following alkane? CH3 CH3-C-CH-CH3 CH3

Q: What is the correct IUPAC name for the compound above? a. 3-ethyl-3-methyl-1-propene b.…

A: The compound given is having longest carbon chain of 5 carbons as shown below.

Q: What is the IUPAC name of this compound? CI CH 3- CH-CH 2- CH 2- CI O dichlorobutane O…

A: There are some rules that you should use while naming organic compound. Common rules for IUPAC…

Q: What is the correct IUPAC name for the following structure? H3C H2 CH3 H2C H3C H CH3 H2 H2…

Q: What is the IUPAC name of this compound? CH 3 CH 2 CH 2 CH 2 CH 2 CH 2 CH 3 heptane butane octane…

A: -> For IUPAC naming following steps are required First of all identify the longest carbon chain…

Q: What is the correct IUPAC name for the following structure: CH3-CH2-CO-CH2-CH3

Q: Which of the following IUPAC name is incorrect O 4-penten-2-one O 2-hexene-4-ol O 2-hexen-1-ol O…

A: Option 2nd is the incorrect IUPAC name and hence this is correct answer of the given question.…

Q: What is the IUPAC name of the following compound? он CH3 CHCCH3 CH3 CH3

A: Suffix for -OH group is -ol. Choose largest carbon chain and numbering from that side from where OH…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: 1 Use the IUPAC rules to name the following formula C2H5 CH3 1,3-diethyl-4-methylbenzene O…

A: Aromatic compounds are compounds containing carbon and hydrogen atoms in the cyclic arrangement.…

Q: What is the IUPAC name for the following compound? O 2-methylcyclohexene O 1-methylcyclohex-2-ene O…

A: Rules for naming cycloalkenes: 1. The double bond in the ring is given high priority. 2. The…

Q: CH3 CH3 CH3CH2CHCH2CHCH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: CH,CH-CH3 12. CH;-CH-CH-CH3 CH--CH; What is the correct IUPAC name for the compound above? a.…

Q: What is the IUPAC name of the following compound? O 1,3-dimethylcyclopentene O…

Q: What is the IUPAC name for the following compound? CH3 CH3 HạC+ ČH3 CH3 O 1,1,3,3-tetramethylbutane…

A: The given organic compound is a saturated hydrocarbon (alkane). The number of carbon atoms in the…

Q: What is the IUPAC name of the following? (CH3)3CCOCH,CH3

A: Esters are a kind of organic molecules having functional groups, RCOO-R' where R and R' are the…

Q: The IUPAC name for the following compound is: CH3 CH3-C-CH2CH2CHCH3 CH2CH3 CH,CH3…

Q: What is the IUPAC name for the following compound? Cyclohexanebutane Butylcyclohexane…

A: The structure of the given compound is The IUPAC name of the compound is

Q: The IUPAC name for the following compound is: * CI 1,2-chloro-1,4,4-methylcyclopentane 3,4-…

Q: The correct IUPAC name for the following compound is: CH3CH2CCH2CH2CH2C1 CH2…

Q: What is the IUPAC name of the compound shown below? 1-methyl-2-butyl ethyne heptyne 2-heptyne butyl…

A: First we will see the IUPAC rules keeping in mind the above structure, 1) The first rule is to…

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Please help for all questions A) Convert the structure in condensed form.b) Identify one the functional group with its respective homologous series that exists in thecompound.c) Draw one possible structure with molecular formula C6H12 that has two tertiary carbon.d) Arrange the following compounds in increasing order of melting point.Hexane 3-methylhexane 3-ethylhexane 2,3-dimethylpentane
I posted this question afew times , but no one answered can you please help part D,E,F Can you please make sure the these answers are correct for part A,B ,C A) 1 chlorobutane 1 chlorobutane identical b) 2,3 dibromobutane 2,2 dibromotane isomers c) 2- methylpropane 2,2 dimthylpropane neither
QUESTION 7 Which of the following compounds is an alkyne? A. CH2 = CH-CH = CH2 B. CH3CH2C ≡ CH C. CH3CH2CH3 D. C3H6 E. 2-pentene
Find the common name and IUPAC name 1. C3H8O 2. C2H5OH
Give the complete IUPAC name and the common name for each of the following compounds:
The following names are incorrect by IUPAC rules. Determine the correct IUPAC name for each compound. a. 2-Ethyl-2-pentene b. 4,5-Dimethyl-4-hexene c. 3,5-Cyclopentadiene d. l,2-Dimethyl-4-cyclohexene
QUESTION 3 What is the compound represented by the following structure? A. cyclohexatriene, C6H9 B. cyclohexene, C6H10 C. cyclohexatriene, C6H12 D. benzene, C6H6 E. cyclohexane, C6H12
Question 39 Among the alkenes which one produces tertiary butyl alcohol on acid hydration? a) (CH3)2C=CH2 b) CH3-CH=CH-CH3 c) CH3CH2CH=CH2 d) CH3CH=CH2 e) CH3CH=CHCH2CH3
Draw the line structures corresponding to thefollowing IUPAC names:4. 2,3,5,6,7-pentamethylocta-1,3,4,6-tetraene5. 2,3,5-trimethyl-3-isopropylhepta-1,4,6-triene6. 1-ethyl-4-methylcyclohexa-1,2,3-triene Draw the line structures corresponding to thefollowing IUPAC names:7. trans-Pent-2-ene8. trans-3,4-Dimethylhex-3-ene9. trans-Hept-3-ene10. cis-Hept-3-ene11. cis-4-Methylpent-2-ene Write equations for the reaction of pent-2-ene withthe following:12. H2 and Pd catalyst13. Br214. H2O and H2SO4 catalyst For each of the following reagents, decide whetherchlorobenzene will react with it or not, and, if it does,draw and name the products expected from thereaction.15. Br2 and FeBr316. HNO3 and H2SO4 catalyst17. HBr Draw structures corresponding to the followingIUPAC names of aromatic compounds: 21. meta-chloroaniline22. 1,2-dichloro-4-methylbenzeneAnswer the following questions briefly:23. What do the terms saturated and unsaturatedmean?24. What does the term “aromatic” refer to whendiscussing…
Are the following names correct or incorrect? If they areincorrect, give the correct name.a. 1,3-Dimethylpentane c. 3-Butylbutaneb. 2-Ethylpropane d. 3-Ethyl-4-methyloctane
Hi! I need help on these three questions. Give the IUPAC name of the following compounds.
Question 1: What is the preferred IUPAC name of the alkene shown in Figure 1? * A- 1-ethyl-2,4,5-trimethylcyclohexene B- 5-ethyl-1,2,4-trimethylcyclohexene C- 1-ethyl-3,4,6-trimethylcyclohex-3-ene D- 4-ethyl-1,2,5-trimethylcyclohexene E- None of these names are correct