What is the intramolecular Aldol condensation product for the following reaction? Η H NaOEt

Q: Explain the differences in pKa (vs. benzoic acid) of these substituted benzoic acids based on…

A: More the acidity lesser the Pka value.

Q: Give a systematic (IUPAC) name for the following alcohol: CH₂OH Spell out the full name of the…

A:

Q: Give detailed Solution with explanation needed. Don't give Handwritten answer

A: Step 1: Step 2: Step 3: Step 4:

Q: Give detailed mechanism Solution with explanation needed..don't give Handwritten answer...

A:

Q: Question 4 Metal Specific Heat (J/g°C) Calcium 0.647 Iron 0.449 Silver 0.235 Gold 0.129 4 pts In…

A:

Q: Please show me in paper using hess law, also include steps

A: Thank you.

Q: 11.7 For each of the following free-ion terms, determine the values of L, ML, S, and Ms: a. 2D(d³)…

A: To determine the values of L, ML​, S, and MS​ for the given free-ion terms, we'll follow these steps…

Q: 11) A 520 ml solution contains 0.130 M formic acid (K, = 1.80 x 10) and 0.130 M sodium formate.…

A: First, we need to determine the pH of the initial solution. This is a buffer solution, so we can use…

Q: 2. Predict the product and draw the mechanism for the following reaction. You can write…

A:

Q: Draw the energy level diagram which shows the effect of incorporating a ë-donor ligand into an…

A:

Q: Please don't provide handwritten solution ....

A: Step 1: The Fischer projection of the compound is drawn for easy understanding. It is L-mannose.…

Q: Please answer in tipping format

A: Step 1:Sulphur dioxide gas is mixed with oxygen gas to give sulfur trioxideSulphur dioxide =…

Q: The non-polar molecule among the following is CI CI C H H Type here to search Εί prime video CI…

A: A molecule is considered polar if it has a net dipole moment, meaning that it has a positive charge…

Q: Chemistry

A: Given: ΔtΔ[NO]​=−0.028M/s2NO(g)​+O2(g)​→2NO2(g)​Step 1: Write the rate expression from each…

Q: Please help me solve the following question, explain it and make sure everything is correct,…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Above were the formula's of a given items or terms. Below are it's drawings   A.   B.C.  D.

Q: 2. The equilibrium constant of the reaction COCl2(g) CO(g) + Cl2(g) was found to fit the expression…

A:

Q: NaBH Which of the following monosaccharides gives optically inactive alditols on reduction with…

A: Optical activity is a property of certain substances to rotate the plane of polarized light. In the…

Q: Draw the major organic product(s) for the following. - You may assume each reaction occurs just one…

A:

Q: Cyclopentadiene H

A: Part 2: Explanation:Step 1: Identify the reactants and products.- Reactant: Cyclopentadiene (C₅H₆)-…

Q: Image uploaded solution is not allowed please dear expert bro

A: The IUPAC nomenclature of organic compounds follows this naming format:Writing the name of organic…

Q: Naming alkyl side chains For each organic compound in the table below, name the highlighted side…

A: Step 1: Step 2: Step 3: Step 4:

Q: Give detailed Solution with explanation needed of all. Don't give Handwritten answer. don't copy the…

A: Step 1:Here's the completed table with the chemical formulae of the species present at…

Q: A volume of 25.0mL 0.100M CH3CO2 is titrated with 0.100M NaOH (Ka for CH3CO2H = 1.8E-5) (a) What is…

A: Step 1:4.3 Step 2: Step 3: Step 4:

Q: Chemistry

A: Step 1:Step 2:

Q: 4. Explain the Hybridization around all the atoms for NO2 Hybridization steps N -1 Isolated atoms…

A: In the NO2 molecule, we have three isolated atoms: one Nitrogen (N) and two Oxygen (O) atoms. The…

Q: Plz draw out a detailed mechanism for the ortho product !

A: Step 1: Step 2: Step 3: Step 4:

Q: (a) At 2000°C, the equilibrium constant for the reaction: N2(g) + O2(g) > 2 NO(g) is 4.1 x 10-4…

A: The reaction is N2(g) + O2(g) > 2 NO(g) and the equilibrium constant (K) is 4.1 x 10^-4. The…

Q: OH H₂O (excess) H+

A: The given reaction is a typical acid-base reaction where a hydroxide ion (OH-) reacts with water…

Q: Show work. Avoid handwritten Solution. don't copy answer anywhere

A: Step 1:The reaction of formation of Helium-3 from Dueterium (2H1) is as follows2H1 + 2H1 = 3He2 +…

Q: None

A: To calculate the mass of gallium (Ga) deposited during electrolysis, we start with a current of…

Q: Picture below is an important precursor to the entry of pyruvate into the TCA cycle. Fill in the…

A: Detailed explanation:

Q: 2. Consider a hypothetical trigonal bipyramidal Fe(III) complex [FeF2(OH)3]². We need to divide the…

A: The complex [FeF2(OH)3]² is a trigonal bipyramidal complex. The point group of a trigonal…

Q: Show work. Give correct answer..avoid handwritten Solution

A: Dear student,To calculate the time it takes for the concentration of NH₃ to decrease to 17.0% of its…

Q: Give detailed mechanism Solution with explanation needed. Don't give Handwritten answer..don't copy…

A: pSSteppSStep  It is an example of E2 elimination reaction where base takes up the proton which…

Q: A pharmaceutical scientist wants to deliver a drug as a single enantiomer shown below. Which…

A: Step 1: Step 2: Step 3: Step 4:

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Explanation : We know, unit conversion :1 km = 1000 m and 1 m = 100 cm  Therefore, 1 km = 1000 x 100…

Q: c) Using energy as the vertical axis, in the space below make a sketch that includes each of the…

A:

Q: The painkiller and anti-tussive codeine is a weak base with a pKb of 7.95. A solution with 1 gram of…

A: First, we need to calculate the moles of acid used to reach the equivalence point. The moles of a…

Q: None

A: For transformation A, you will conduct an electrophilic aromatic bromination reaction on benzene.…

Q: 2. Identify the functional groups present in the following molecules. Molecule a. CH2CH3OH b.…

A: Step 1:A. This is an alcohol compound. We can see the hydroxyl bond -OH attached to an alkyl groupB.…

Q: Predict the electron pair geometry and molecular geometry for the following substances by drawing…

A: The Lewis structure for BH3 is as follows: B is in the center with three H atoms surrounding it.…

Q: None

A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…

Q: The discovery of the Haber process for the production of ammonia from nitrogen was a turning point…

A: First, we need to calculate the standard Gibbs free energy change (∆G°) for the reaction. The ∆G°…

Q: None

A: Given information:Molality of the ethanol solution = 14.06 mDensity of the ethanol solution = 1.100…

Q: What would be the product if one molecule of cinnamaldehyde reacted with one molecule of acetone in…

A: Step 1:NaOH catalyses the aldol condensation reaction. NaOH takes up proton from acetone (1) CH3…

Q: 3 moles of liquid water at 100\deg C and 1 atm go to the vapor phase at 160\deg C and 0.5 atm.…

A: To calculate the changes in enthalpy (ΔH), entropy (ΔS), Gibbs free energy (ΔG), and Helmholtz free…

Q: None

A:  Rule to convert in stable chair conformation1. Bulky group should be in equatorial position2. When…

Q: Please help me solve the following question, explain and make sure everything is correct 100% thanks

A: Step 1: BeH2Number of valence electrons of Beryllium : 2 electrons.Number of valence electrons of…

Q: 3.1). The following plot represents the potentiometric curve of acid with NaOH. Volume of NaOHL m a)…

A: Step 1: From the graph, the equivalence point is 22 mL.The volume of NaOH at which there is a steep…