What is the IUPAC name for the following alkane?O 6-isopropyl-3-methyloctane3-isopropyl-6-methyloctaneO 3-ethyl-2,6-dimethyloctaneO 6-ethyl-3,7-dimethyloctane

In this question, we will write the IUPAC name of the given compound. This compound is hydrocarbon…

Answered: What is the IUPAC name for the…

What is the IUPAC name for the following alkane? O 6-isopropyl-3-methyloctane O 3-isopropyl-6-methyloctane O 3-ethyl-2,6-dimethyloctane O 6-ethyl-3,7-dimethyloctane

Organic And Biological Chemistry

7th Edition

ISBN:9781305081079

Author:STOKER, H. Stephen (howard Stephen)

Publisher:STOKER, H. Stephen (howard Stephen)

Chapter1: Saturated Hydrocarbons

Section: Chapter Questions

Problem 1.107EP: What is the molecular formula for each of the following hydrocarbons? a. 1,2-Dimethylcyclohexane b....

See similar textbooks

Related questions

Q: 20. A 1.0 M solution of a compound with 2 ionizable groups (pka's-6.2 and 9.5; 100 mL total) has a…

A: 20. 100 mL of 1.0 M solution of a compound with 2 ionizable groups has a pH of 6.8 .…

Q: A pure solid sample of Substance X is put into an evacuated flask. The flask is heated at a steady…

Q: Summarize and analyze the chemistry of both instant ice pack and instant hot packs in the context of…

A: Instant ice packs and instant hot packs are two commonly used products for temperature regulation.…

Q: Read the following short piece titled "The Status of Qualitative Research in Criminology" by Jody…

A: Dr. Jody Miller is a renowned American academic who specializes in examining the issues of crime and…

Q: Which of the following reactions will produce acetophenone as a major product? OH I OS CI AICI 3 |||…

Q: The recommended dosage of a drug for pediatric patients is 200 mg per kilogram of a patient's…

A: We can convert units. lb and Kg are 2 units of mass. The relation between lb and kg is - 1 lb =…

Q: Round to 1 significant figure 0.141700 1.10951 Round to 2 significant figures 3.00000 10.7190…

A: By following significant figure rule we can round off the given numbers to appropriate number of…

Q: How are the following molecules related? HO Br 0 0 0 0 0 H O constitutional isomers. O enantiomers O…

A: The compound having same molecular formula and different structural formula are said to be isomers.…

Q: Order the acids based on their strengths, with the weakest on the left and strongest on the right.…

A: Given data : HCIO - Hypochlorous acid Ka = 3.0 x 10-8 NH3 - Ammonia Kb = 1.8 x 10-5 HCI -…

Q: 2MnO4−+5H2C2O4+6H+⟶2Mn2++10CO2+8H2O Reaction : Permanganate Ion Reduced by Oxalic Acid If you…

A: This is a chemical reaction that involves the reduction of permanganate ions by oxalic acid. The…

Q: Which of the following will always cause an increase in the solubility of a gas in a solvent in…

A: Answer:- This question is answered by using the simple concept of solubility of gases in liquid…

Q: Calorimetry can be used to: ANSWERS (a). test the octane rating in gasoline ( b.) determine the…

A: Calorimetry is the branch of thermodynamics that deals with the measurement of heat and heat…

Q: By how much are the fuel values different? Give the magnitude of the difference (the absolute…

A: To calculate the difference between the fuel values of pentane and hexane given that the density of…

Q: Be sure to answer all parts. Enter your answers in scientific notation. At a particular temperature,…

A: Answer :

Q: What are the concentrations of all the solute species in 1.54 M lactic acid, HC3H5O₂? What is the pH…

Q: A chemist combines 100 mL of 1.0 × 10-3 mol/ of Pb(NO3)2 to 40 mL of 0.040 mol/L NaCl. Does a…

Q: Combustion reactions are a notable source of carbon dioxide in the environment. Using the following…

A: The balanced chemical reaction for the combustion of propane is as follows: C3H8 + 5O2 → 3CO2 +…

Q: Calculate the equilibrium concentration of [N₂] if the initial concentrations are 2.26 M N₂ and 0.56…

Q: What is the structure of an atom and how does it contribute to the chemical properties of elements?

A: Atoms are the basic building blocks of matter and play a crucial role in determining the chemical…

Q: Cc.78.

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: An unknown compound contains only C, H, and O. Combustion of 7.00 g of this compound produced 15.9 g…

A: Given data is Anunknown compound contains only C, H, and O. Combustion of the 7.00 g of unknown…

Q: Write the balanced dissociation equation and calculate the amount concentration of the cations and…

A: Given Mass of NiCl3 = 10.5 g Volume of solution= 38 ml

Q: In the figure, what chemical group would be at the terminal end marked by "C"? Select an answer and…

A: In this question we have to tell the degree of carbon atom at point C .

Q: Write the General formula and Structure of the standard amino acids. A. Alkyl Glycine (Gly,G)…

A: We have to write the general formula and the structure of the below given amino acids. A. Alkyl:…

Q: Draw the structure of all compounds that fit the following descriptions. a. Five constitutional…

A: Constitutional isomers are those compounds with the same molecular formula but have different…

Q: QUESTION 1 Calculate the actual delta G of this reactions for the conditions listed below:…

A: Check the relation between G and Go. Then use that relation to calculate value of ∆G.

Q: (e) (g) =O from (c) - ОН CH3MgI H3O+ ether acetyl chloride 0 CI OH O

A: Given : structure of reactant and product

Q: The solubility of oxygen gas in water is approximately 0.00489 g/L. when the temperature is 25.0°C…

A: Henry's law: It states that the amount of dissolved gas in a liquid is directly proportional to its…

Q: Fill in the missing information about the atoms in the table below. symbol Ge Sn number of protons…

A: We know that Mass of element is the sum of masses of all atom onstituents like proton…

Q: The drawing below shows a mixture of molecules: carbon nitrogen oxygen key O hydrogen sulfur…

A: Limiting reactant: A reactant that is totally consumed when the chemical reaction is completed is…

Q: Rank the following alkanes in order of increasing boiling point. * IV OI<<< IV ON<III < | < | O II <…

A: Given : structure of alkanes Tip: boiling point is directly proportional to the surface area.

Q: 1. Provide the major product(s) of the following reactions. (a) (b) (c) Oll OH NaSH (aq) SOCI ₂ HCI

Q: 0.08, 0.08, 0.09, 0.08 µg/g late the mean, standard deviation, and relative standard deviation of…

Q: Specify the types of strain that destabilize the conformer shown below. Hint: All bonds not…

Q: 2) Below are the products of 2 different reactions with alkenes. Draw the structure of the alkene…

Q: The slope of the log K vs 1/T graph is 1.352·104K. How about value can be used to calculate the…

A: The graph between log K vs 1/T can be given as :

Q: Order the following compounds from most upfield to most downfield. Most upfield CH3-CH₂ CH, OCH…

A: In Nuclear Magnetic Resonance (NMR) spectroscopy, upfield and downfield refer to the relative…

Q: what is the importance of "synthesis" in chemistry and how does it relate to the breaking of bonds…

A: Synthesis in chemistry refers to the process of combining two or more substances to form a new…

Q: What is the predicted product of the reaction sequence shown? N `N || (CH3CH₂)2NH H₂SO4 HO N- E IV H…

Q: A pure sample of Substance S is put into an evacuated flask. The flask is then heated steadily and…

A: The steps starting from the origin are- 1) heating of solid 2) fusion 3) heating of liquid 4)…

Q: D Question 17 What is the major product of this reaction? Br₂ FeBr3

A: Given : structure of reactant Tip : aldehyde is a electron withdrawing group so meta product will…

Q: Shown below is the major resonance structure for a molecule. Draw the second best resonance…

A: Given : structure of molecule

Q: What is the reaction order? 02 0 01 [A]o =

A: Order of a chemical reaction refers to the exponent in its rate equation. The rate equation…

Q: Draw the product of this reaction. Ignore inorganic byproducts.

A: We have been given an organic reaction and we have been asked to draw the major organic product of…

Q: Determine the element symbol,mass number and a charge for an atom or ion that has a 51…

A: No.of protons = Atomic number No. of protons + No. of neutrons = Mass number For an element, No.…

Q: Compound ΔHf° (kJ/mol) CH3OH(l) –238.7 O2(g) 0.00 CO2(g) –393.5 H2O(l) –285.8 How many grams of…

A: Given data Mass of water (mwater) = 441 g Initial temperature of water (Ti) = 19.5°C Final…

Q: Write the General formula and Line Structure of the standard amino acids. A. Alkyl Glycine (Gly,G)…

A: The problem is based on biochemistry and here we are dealing with amino acids. The structures and…

Q: An aqueous solution made by dissolving 154 mg of an unknown compound (a nonelectrolyte) in enough…

Q: The rate at which a certain drug is eliminated by the body follows first-order kinetics, with a half…

Q: In the first step of the experimental procedure, you dissolved about 1.00 g of the benzoic…

A: (4) To provide the observation when 1.00 g mixture of 1:1 benzoic acid and benzil is 10 ml of the…

Question

What is the IUPAC name for the following alkane?
O 6-isopropyl-3-methyloctane
3-isopropyl-6-methyloctane
O 3-ethyl-2,6-dimethyloctane
O 6-ethyl-3,7-dimethyloctane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the molecular formula for each of the following hydrocarbons? a. 5-carbon alkene with one double bond b. 5-carbon alkene with two double bonds c. 5-carbon cycloalkene with one double bond d. 5-carbon cycloalkene with two double bonds
What is the molecular formula for each of the following hydrocarbons? a. 1,2-Dimethylcyclohexane b. 1,3-Dimethylcyclohexane c. 2,2-Dimethylhexane d. 2,3-Dimethylhexane
Explain why each of the following names is incorrect: (a) 2,2-Dimethyl-6-ethylheptane (b) 4-Ethyl-5,5-dimethylpentane (c) 3-Ethyl-4,4-dimethyl hexane (d) 5,5,6-Trimethyloctane (e) 2-Isopropyl-4-methyl heptane
The IUPAC name for the following compound is: 1. 2-ethyl-4,5-dimethylheptane 2. 2-(1-methylpropyl)-4-methylhexane 3. 6-ethyl-3,4-dimethylheptane 4. 3,5,6-trimethyloctane 5. 3,4,6-trimethyloctane
What is the IUPAC name of this compound? CL-CH2-CH2-CH2-CH2-CL
What is the IUPAC name of the compound shown (CH3)3-C-CH2-CH2-CH3
What is the correct IUPAC name for the compound with the following condensed structural formula? CH3-CH(CH3)-CH2-CH2-CH(OH)-CH2-CH2-CH3
A correct IUPAC name for the following compound is: 1. 2-isopropyl-1-pentene 2. 2-methyl-3-methylenehexane 3. 2-methyl-3-propyl-3-butene 4. 2-methyl-3-propyl-1-butene 5. 3-methyl-2-propyl-1-butene
Write the IUPAC name of the following ALKYNES: CHΞCH CH3-CH2-CΞCH CHΞC-CH|CH3|-CH2-CH3
What is the IUPAC name for the following compound ? A. 3,7-dichloro-5-ethyl-6-methyloctane B. 2-chloro-3-methyl-4-(2-chlorobutyl)hexane C. 2,6-dichloro-4-ethyl-3-methyloctane D. 3-chloro-5-(2-chloro-1-methylpropyl)heptane E. 2,3,4,6-dichloroethylmethyoctane
What is the IUPAC name for the following compound? A) hexylcyclopentane B) 1-cyclopentylhexane
What is the IUPAC name for the following structure? CH2Cl-CH2-CH2Cl