Question 12CoWhat is the IUPAC name of the following compound?CH;CH=CCH,CH,OH(A 5-Hydroxy-3-phenylpent-2-eneB 3-Phenylpent-3-enol3-Phenylpent-2-en-5-olD 3-Benzenepent-3-enolE 3-Phenylpent-2-enol33 minutes remaining

Answered: Image /qna-images/answer/90054d20-504a-4a3f-a3d1-565e6fdd03f4.jpg

Answered: What is the IUPAC name of the following…

What is the IUPAC name of the following compound? CH;CH=CCH,CH,OH A 5-Hydroxy-3-phenylpent-2-ene B 3-Phenylpent-3-enol C 3-Phenylpent-2-en-5-ol D 3-Benzenepent-3-enol E 3-Phenylpent-2-enol

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter9: Nucleophilic Substitution And Β-elimination

Section: Chapter Questions

Problem 9.60P: Another important pattern in organic synthesis is the construction of CC bonds. Using your reaction...

See similar textbooks

Related questions

Q: What is the IUPAC name of the following compound? Ме. "Ме Ме O A.…

A: 1. Given that : We have to give the IUPAC name for the following compound :

Q: Give the IUPAC name for each ketone. C-CHCH,CH3 b. a.

A: A molecule or compound has many names. Different naming systems exist in the world. Among these…

Q: What is the correct IUPAC name for the following structure? H;C, CH, O A. 1-phenyl-3-methyl-4- OB.…

A: Given here a structure of a compound and we are asked to write the correct IUPAC name for it.

Q: What is the IUPAC name for the following molecule? OH 3-hydroxyhexen-4-one…

Q: - IUPAC name for the following compound is CH-C=C-CH-CH3 ČH3 CH3 (a) 2, 4-dimethyl-5-phenyl-3-…

A: The systematic IUPAC nomenclature of any organic compound involves three steps- Principal chain…

Q: The IUPAC name of the structure is_ O: Br 3-bromo-5,7-diethyl-2,6-dimethyl-octenal…

A: The objective of the question is to find the IUPAC name of the given compound.

Q: 6. What is the correct IUPAC name of the following compound? CH3 HOH A) (2S, 3S)-3-bromo-2-butanol…

A: The principal functional group is OH. So, naming will be ended with 'ol'. The longest carbon chain…

Q: What is the IUPAC name ofthis structure? HO (E)-4-methylhex-4-en-1-ol (2-4-methylhex-4-en-1-ol…

Q: Name the following compound: CH3 HgC HgC OH 4-methyl-2-(2-methylpropyl)-3-hexanol…

A: Usually organic compounds are the chemical compounds that contain carbon-hydrogen bonds . Lots of…

Q: What is the IUPAC name for the following compound? OH OCH (1R, 2R,…

Q: What is the IUPAC name for the following compound? of O t-butyl cyclohexanecarboxylate O…

A: Write IUPAC name of the given structure---

Q: What is the IUPAC name of the following molecule? a E O 3-ethyl-4-sec-hexyl-hexan-3-ol O…

Q: What is the IUPAC name for the following compound? Br. ) (R)-6-bromo-2-heptanal O…

A: The IUPAC name of an organic compound includes the following features: The name of the longest…

Q: f. 2-ethyl-cyclopentane-1,3- dicarbaldehyde g. 2-chloro-3-hydroxy-4-oxo-pentanal h.…

A: Please find your solution below : Structural formula is a representation of a chemical compound…

Q: What is IUPAC name of this compound? Br OH O 4-Bromo-5-methyl-2-hepten-6-ol O…

Q: What is the IUPAC name for the following compound? CI 4-ethyl-3,5-dimethylhexanoyl chloride O…

A: First identify functional group. Choose longest carbon chain. Numbering of molecule. Position of…

Q: at is the correct IUPAC name of the compound below? O 3-(2-propyl)-6,6-dimethylhexan-2-ol O…

A: For IUPAC naming select the longest hydrocarbon chain containing all the functional groups and…

Q: 6. What is the correct IUPAC name of the following compound? A)…

A: We will be naming the above mentioned organic compound by using IUPAC nomenclature rule.

Q: What is the IUPAC name of the following compound? * OH Br N=C O 2-bromo-4-cyanophenol O…

A: First Look at the substituents attached and allot the priorities. The First Priority will be given…

Q: 3. CH3CH2CH2 O CH3-CH-CH-C-H CH3 What is the correct IUPAC name for the compound above?…

A: The numbering is starting with the aldehyde group. only 6 carbon is involved in this structure.

Q: What is the IUPAC name of the following compound? O (E)-5-methyl-2-hexen-5-ol O…

Q: 5. What is the IUPAC name of the following molecule? OH 1,2,3,3-tetramethylpropan-1-ol b.…

A: The alcohol is an organic compound which consists of a hydroxyl functional group. The hydroxyl…

Q: OH 12. - CH3 What is the IUPAC name for the above? Oa. 3-methylcyclohexanol Ob. 3-methylphenol O c.…

A: The given compound: The name of the given compound has to be determined. There are two…

Q: draw a structure or determine an IUPAC n ame for these structures OH H 1.1 1.2 HO- OH CI H. 1.3…

A: Rules for IUPAC naming of compounds • Find out the parent chain ( longest continous carbon chain ).…

Q: Give the IUPAC name for each compound.

A: a). The aldehyde contains four carbon straight chain. It is a derivative of butane. Numbering from…

Q: What is the IUPAC name of the following compound? OH A. 4-methyl-5-penten-1-ol B.…

A: What is the IUPAC name of the given compound ?

Q: What is the IUPAC name of the following compound? но ÓCH3 O 3-Methoxy-4-hydroxybenzaldehyde O…

Q: What is the IUPAC name of the following compound? O 4-phenyl-3-hexanone O 3-phenyl-4-hexanone O…

Q: 10. Give the structure corresponding to each name. a. 7,7-dimethyl-4-octanol b.…

Q: 12. CH3-C-CHCH, CH,CHCH, What is the correct IUPAC name for the compound above? Oa.…

A: To write the IUPAC name , we first search is the longest carbon chain ,here the longest chain has 5…

Q: Draw the following: 1. a. 3-methyl-1-butanethiol (skunk scent) b. triphenylmethanol c.…

A: (a) The structure of 3-methyl-1-butanethiol is given below.

Q: What is the correct IUPAC name of an Aldehyde below? CH, H;C 4-methyl pentanal 2-methyl pentanal…

A: The answer is as follows:

Q: H;C. CH3 What is the systematic IUPAC name of this compound? H;C Select one: a.…

A: Find the IUPAC nomenclature

Q: What is the correct IUPAC name of the following compound? g O 3-ethoxy-1-isopropoxycyclohexane O…

A: In this question we have to tell name of the given compound.

Q: 10. What is the IUPAC name for the compound shown below? CH3 CH3-Ö-CH-CH-CH3 A. 2-methyl-4-pentanone…

A: We have an organic compound , we have to predict the IUPAC nomenclature of the compound.

Q: What is the IUPAC name of the following compound? * CEN H2 | H2 H3C-CEC ---C-C -OH H3C…

A: The IUPAC name of the given compound is, 2-Hydroxymethyl-2-methylhex-4-yne nitrile

Q: What is the correct name of this compound? OH O 3-Isopropylphenol O p-tert-butylphenol…

A: In the above structure of organic compound, we have a benzene ring with a alcohol and a tert butyl…

Q: What is the IUPAC name for the following compound? A) 3,5-dimethylhex-4-en-2-ol B)…

Q: What is the IUPAC name of the following compound? * CEN H2 | H2 H3C-CEC-C-C-C-OH H3C O…

Q: What is the IUPAC name of the following compound? OH Br N=C A. 3-bromo-4-hydroxybenzonitrile O B.…

Q: (1R,2R)-2-methylcyclohexanol same as (1R,2R)-2-methylcyclohexan-1-ol

Q: Give the IUPAC name for each aldehyde. CH, CH;CHCH-č-H CH,CH;CH;-C-CH;CH; сно b. c.…

A: a. 2,3-dimethylbutanal b. 2-ethylpentanal c. 3-methylbutanal d. 3,3,4,4-tetramethylpentanal

Q: What is the IUPAC name for the following structure? OH a) cyclohexenol b) 3-cyclohexen-1-ol c)…

A: According to IUPAC ,the prority of Alcohol is higher than the double bond,so alcohol will be here…

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C Ni + H2

A: The reaction given is,

Q: Name the following compound. CH;-CH;-CH,-ċ-o-CH;-CH; A) ethyl propyl ether B) ethyl propanoate C)…

Q: Which of the following are a. hemiacetals? b. acetals? OH 1. CH,-C-CH, ÓCH, OCH,CH, 2. CH-C-H…

Q: 12. OH CH3 What is the IUPAC name for the above? O 3-methylcyclohexanol 3-methylphenol O…

A: Write IUPAC name of the given above structure-

Q: What is the IUPAC name of this structure? но. (E)-4-methylhex-4-en-1-ol (Z)-4-methylhex-4-en-1-ol…

A: Step1 - identify the longest carbon chainStep2 - start numbering from that side such that senior…

Q: What is the IUPAČ name of the following compound? * Br OH CN 3-(3-Bromo-5-hydroxyphenyl)…

A: To name a bicyclo compound we first determine the priorities. Now here among the two phenyl , ring…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

QUESTION 8 What reagent and condition are required to convert dicyclobutyl ketone to di-cyclobutyl methanol? A. KMnO4, acetone, H3O+ B. Propanoic acid, HCl, 30oC ? C. NaBH4, ethanol, H3O+ D. CH3CH2MgBr, ether, H3O+
HURRY ASAP I WILL RATE NO NEED FOR EXPLANATION WHICH OPTIN Which of the following statement(s) about the alcohols of which their structures/IUPAC names are given below is/are true? I. CH3-CH(OH)-CH2-CH2-CH(CH3)-CH2-CH3 II. CH3-CH(OH)-CH2-CH2-CH2-CH3 III. Cyclohexanol IV. (CH3)2-C(OH)-CH2-CH2-CH3 V. CH3-CH2-OH The IUPAC name of compound I is 3-methyl-6-heptanol. Compound V is a secondary alcohol Compound III is primary alcohol. Compound IV is tertiary alcohol Compounds I and II are primary alcohols
Long explanations are not needed. Direct answers are fine. a. Which of the following organic compounds dissolves in 10% NaOH?I. diethyletherII. 3-methyl-3-pentanolIII. 1-hexanolIV. 2-pentanol b. Which of the following organic compound dissolves in water?I. diethyletherII. 3-methyl-3-pentanolIII. 1-hexanolIV. 2-pentanol
Assuming a 56.8% yield, how kany ml of alkene is required to produce 22.5 mL of 2,3-dimethyl-2-butanol? MW of alkene: 84.16, d: 0.653 MW of 2,3-dimethy-2-butanol: 102.17, d:0.823
Please provide a correct aanswer Answer the following and Identify the reagent (and its concentration) that is used to confirm the presence of each given: a. CO32- b. S2- c. I-
Give the structure of the principal product(s) when each of the following alcohols reactswith (1) Na2Cr2O7>H2SO4, (2) PCC, (3) DMP, and (4) 1 equiv NaOCl-TEMPO.(a) octan-1-ol (b) octan-3-ol(c) 4-hydroxydecanal (d) 1-methylcyclohexan-1,4-diol
What is the structure ,melting point,boiling point ,molecular weight and molecular formula for 2,4 dinitrochlorobenzen, 2,4 dinitrophenylaniline and 2,4 dinitrochloroaniline thank u just want these i just put a blank pic coz it doesnt submit
4. draw the structure of the organic product for each alcohol reacting with permanganate. Look on the internet for an explanation of why the tertiary alcohol in presence of KMnO4 might react. (hint may involve dehydration.) - methanol - ethanol - propanol - 2-methyl-2-propanol
thanks. Name the following compounds using IUPAC nomenclature: (include R/S and E/Z designations when necessary)
What reagents / catalysts are necessary to carry out each conversion?i) Benzene to nitrobenzeneii) Benzene to 3-nitrobenzenesulfonic acidIii) 1,4-dichlorobenzene to 2-bromo-1,4-dichlorobenzene
a. If the equilibrium constant for the reaction of acetic acid and ethanol to form ethyl acetate is 4.02, what is the concentration of ethyl acetate at equilibrium if the reaction is carried out with equal amounts of acetic acid and ethanol?b. What is the concentration of ethyl acetate at equilibrium if the reaction is carried out with 10 times more ethanol than acetic acid? Hint: Recall thequadratic equation: for ax2 + bx + c = 0, c. What is the concentration of ethyl acetate at equilibrium if the reaction is carried out with 100 times more ethanol than acetic acid?
Another important pattern in organic synthesis is the construction of CC bonds. Using your reaction roadmap as a guide, show how to convert propane into hex-1-en-4-yne. You must use propane as the source of all of the carbon atoms in the hex-1-en-4-yne product. Show all reagents needed and all molecules synthesized along the way.