What is the IUPAC name of this compound?

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: The correct IUPAC name is

A: The objective of the question is to give the IUPAC name of the given organic compound.

Q: What is the IUPAC name for the compound shown in the image?

A: The given compound is saturated hydrocarbon and has a ring structure with 5 carbon atoms. Since it…

Q: Which of the following is the IUPAC name for the following compound?

A: Select the principle carbon chain  Numbering  Naming (prefix + word root + suffix)

Q: What is the IUPAC name of the following compound?

A:

Q: What is the IUPAC name?

A:

Q: What is the correct IUPAC name?

A: IUPAC nomenclature helps in providing unique names to organic compounds bounded with some rules of…

Q: What is the IUPAC name for this molecule? но

A: For IUPAC naming following steps are required-> First of all identify the longest carbon chain…

Q: IUPAC name for the following compounds ?

A: The first step in nomenclature is to choose the longest carbon chain which should contain the…

Q: What is the IUPAC name for this molecule?

A: In IUPAC nomenclature, the C-atoms chain which covers maximum C-atoms is considered as "parent…

Q: What is the IUPAC name of the compound:

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: OH HOʻ

A:

Q: The IUPAC name is:

A: Explanation Nomenclature of cycloalkanes (IUPAC) Cycloalkanes having only carbon and hydrogen…

Q: HO

A:

Q: What is the IUPAC name of these compounds

A: The naming of an organic compound can be done with help of rules of international union of pure and…

Q: What is the IUPAC name of this compound? H

A: Given compound is:-

Q: What is the iupac name?

A: The given compound consist of two amine group.

Q: What is the IUPAC name of the following compound? он

A: The given compound can be numbered as follows,

Q: Write the correct IUPAC name:

A: Rules for assigning IUPAC Name :-  Longest chain is selected first. Substituents should be given…

Q: e IUPAC names

A:

Q: What is the IUPAC name for this compound?

A: The IUPAC nomenclature of the following compound is

Q: What is the proper IUPAC name for this compound

A: In the given compound, the carbonyl group gets the highest priority and lowest locant number and…

Q: What is the IUPAC name for the compound? HO H3C

A: Cycloalkanes are monocyclic compounds. They are saturated hydrocarbons. They contain hydrogen and…

Q: What is the IUPAC name of the following compound? *

A: IUPAC rules :     1. Choose the longest chain  rule,    2. While give numbering , substituents…

Q: What is the correct IUPAC name for the compound?

A:

Q: What is the IUPAC name

A: Select the longest chain of carbons as principle carbon chain. Numbering  Naming (prefix + word root…

Q: What is the IUPAC name?

A: All chemical compounds can be named with certain rules which are purposed by IUPAC. It purposed to…

Q: The IUPAC name of

A: A systematic name is given to an organic compound by IUPAC nomenclature. The set of rules which are…

Q: what is the iupac name of the following compound?

A: As per the policy, we are allowed to answer only 1st three subparts of the question. To get the…

Q: The correct IUPAC name for this compound is

A: The IUPAC naming of the compound gives the precise and accurate naming which is acceptable and…

Q: IUPAC name of the following compound

A: In this question, the name of the given compound has to be determined. The compound is :

Q: What is the IUPAC name for the following compound? CI.

A: The iupac name is as follows:

Q: OH

A: Numbering will start from the carbon of carboxylic acid.

Q: What is the IUPAC name of this compound? H Other Exp

A: Write IUPAC name of the given structure ?

Q: What is the IUPAC name for the compound?

A: Alcohol is an organic compound having      -OH functional group and while doing IUPAC naming suffix…

Q: What is the IUPAC name for the following compound? но.

A: Given compounds:

Q: What is IUPAC name of this compound?

A: Given compound has 7 carbon longest chain  Has one OH  Has one double bond  Has one methyl group

Q: What is the IUPAC Name for this molecule?

A: Note: Parent hydrocarbon is cyclohexane. Priority functional group is alcohol. Start numbering with…

Q: Please give the IUPAC name of these compounds

A:

Q: Give the IUPAC name of these compounds.

A:

Q: Give the IUPAC name of these compounds

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: The IUPAC name of the following molecule is:

A: The above compound has the formula C6H10.

Q: How do I determine what the IUPAC name of this compound is?

A: The structure is given for the compound of which the IUPAC name is to be determined, given as-…

Q: IUPAC name for the following compound.

A: As the given structure is Alkane. So prefix used is ane. In iupac name. First we select longest…

Q: c)

A: IUPAC naming is standard naming accepted across whole world.  In this we select parent chain and…

Q: Give the correct IUPAC name for the following compound.

A:

Q: What is the IUPAC name of the molecule?

A: The given compound is : The IUPAC name of the compound has to be determined.

Q: CI 心

A:

Q: What is the iupac name of the compound

A: IUPAC nomenclature rules for carboxylic acid: a) Identify the longest continuous carbon chain. b)…

Q: Write the correct IUPAC name

A:

Reactions of Ethers

Ethers (R-O-R’) are compounds formed by replacing hydrogen atoms of an alcohol (R-OH compound) or a phenol (C6H5OH) by an aryl/ acyl group (functional group after removing single hydrogen from an aromatic ring). In this section, reaction, preparation and behavior of ethers are discussed in the context of organic chemistry.

Epoxides

Epoxides are a special class of cyclic ethers which are an important functional group in organic chemistry and generate reactive centers due to their unusual high reactivity. Due to their high reactivity, epoxides are considered to be toxic and mutagenic.

Williamson Ether Synthesis

An organic reaction in which an organohalide and a deprotonated alcohol forms ether is known as Williamson ether synthesis. Alexander Williamson developed the Williamson ether synthesis in 1850. The formation of ether in this synthesis is an SN2 reaction.