Answered: What is the mass in grams of carbon…

What is the mass in grams of carbon dioxide that would be required to react with 38.4 g of LIOH in the following chemical reaction? 2 LİOH(s) + CO2(g)→ LI2CO3(s) + H2O(1)

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.19PAE: 4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according...

See similar textbooks

Related questions

Q: How many moles of ammonia would be required to react exactly with 0.248 moles of copper(II) oxide in…

A: Stoichiometry, in balanced chemical reaction is defined by the ratio at which reactants are reacting…

Q: What mass of CO is required to react with 25.13 g of Fe2O3 according to the equation Fe2 O3 + 3CO ⟶…

A: Applying concept of limiting reagent and mole concept.

Q: Silicon nitride (Si3N4), a valuable ceramic, is made by the direct combination of silicon and…

A: Percent yield is defined as the percentage ratio of the actual yield to the theoretical yield…

Q: From the given reaction: 2 I2 + KIO, + 6HCI = 5ICI + KCI + 3H,0 How many grams of iodine are needed…

A: 2I2 + KIO3 + 6HCl --> 5ICl + KCl + 3H2O Weight of ICl = 28.6 gm

Q: If 3.71 mol of C5H12 reacts with excess O2, how many moles of CO2 will be produced by the following…

A: The balanced reaction taking place is given as, => C5H12 + 8 O2 -------> 5 CO2 + 6 H2O

Q: What is the mass in grams of NO that will be produced from 12.7 g of NO, reacted with excess water…

A: From a balance equation we can calculate the mass of the product .

Q: What is the mass in grams of carbon dioxide that would be required to react with 43.9 g of LiOH in…

A: The above problem is based on mole concept (stoichiometry).

Q: What is the mass in grams of carbon dioxide that would be required to react with 19.8 g of LiOH in…

Q: What is the mass in grams of H₂ that can be formed from 43.8 grams of NH₃ in the following reaction?…

A: From the balanced equation: Number moles of H2 produced per mole of NH3 = 3/2 = 1.5 Mass = Number of…

Q: How many moles of ammonia would be required to react exactly with 0.468 moles of copper(II) oxide in…

Q: The reaction between iron(II) oxide and carbon monoxide produces iron and carbon dioxide. How many…

A: Given: Moles of FeO = 1.50 mol

Q: What is the percentage yield of a reaction in which 200 g of phosphorus trichloride reacts with…

Q: How many moles of ammonia would be required to react exactly w 0.430 moles of copper(II) oxide in…

Q: If 4.37 mol of C5H12 reacts with excess O2, how many moles of CO2 will be produced by the following…

A: The given reaction is shown below, Here, 4.37 mol of C5H12 is reacted with excess Oxygen to form CO2…

Q: How many grams of carbon dioxide would be required to react with 37.9 g of LiOH in the following…

A: Stoichiometry, in balanced chemical reaction is defined by the ratio at which reactants are reacting…

Q: What is the mass in grams of carbon dioxide that would be required to react with 71.9 g of LiOH in…

A: We have to calculate the mass of carbon dioxide .

Q: What is the mass in grams of H₂ that can be formed from 43.6 grams of NH₃ in the following reaction?…

A: Molar mass of NH3 = Atomic mass of N + H x 3 = 14 g/mol + 1 g/mol x 3…

Q: What is the mass in grams of magnesium chloride that can be produced from 9.10 moles of chlorine gas…

A: In the question it is given Mg is in excess so the limiting reagent must be Cl2. From the reaction…

Q: Which of the reactant is limiting reagent? Calculate the mass of (NH2)2CO How much excess reagent…

A: Ammonia + Carbon dioxide → Urea + waterBalanced Chemical Equation…

Q: What is the mass in grams of carbon dioxide that would be required to react with 68.1 g of LIOH in…

A: Given,

Q: What is the mass in grams of carbon dioxide that would be required to react with 80.2 g of LiOH in…

A: Mass of LiOH = 80.2 g Mass of CO2 required to react with 80.2 g LiOH = ? The balance chemical…

Q: How many grams of reactant are needed to obtain 38 g of oxygen in the following reaction? 2NaNO3 →…

A: Given data,Mass of O2=38gReaction given:-2NaNO3→ 2NaNO2 + O2

Q: How many moles of ammonia would be required to react exactly with 0.692 moles of copper(II) oxide in…

A: Moles of ammonia required is calculated as follows

Q: What is the mass in grams of carbon dioxide that would be required to react with 20.2 g of LiOH in…

Q: What is the mass in grams of H₂ that can be formed from 55.6 grams of NH₃ in the following reaction?…

A: Mass of NH3= 55.6gm Mole of NH3= 55.6÷17= 3.27 Apply mole-mole relationship. Mole of H2=3.27×3/2=…

Q: How many moles of ammonia would be required to react exactly with 0.550 moles of copper(II) oxide in…

A: Given chemical reaction, 2NH3(g) + 3CuO(s) ---> 3Cu(s) + N2(g) + 3H2O(g) Moles of Copper (II)…

Q: What is the mass in grams of carbon dioxide that would be required to react with 60.7 g of LiOH in…

A: Interpretation: The mass in grams of carbon dioxide required to react with 60.7 g of LiOH in the…

Q: How many moles of ammonia would be required to react exactly with 0.740 moles of copper(II) oxide in…

A: The given reaction is, 2NH₃(g) + 3CuO(s)---->3Cu(s) + N₂(g)+3H₂O(g)

Q: What is the mass in grams of carbon dioxide that would be required to react with 57.7 g of LiOH in…

A: 2 LiOH(s) + CO2(g) → Li2CO3(s) + H2O(l) Molar mass of lithium hydroxide=23.95 g/molmass of lithium…

Q: When elemental phosphorus oxidizes, it produces a covalently bonded molecule known as…

A: Given :- Mass of P4 = 1.33 g Mass of O2 = 5.07 g To calculate :- Theoretical yield of P4O10

Q: What is the mass in grams of H2 that can be formed from 55.8 grams of NH: in the following reaction?…

A: To solve this problem we will use the given balanced chemical equation .

Q: What is the mass in grams of carbon dioxide that would be required to react with 61.4 g of LiOH in…

A: Dear student, lithium hydroxide is used in the purification of air. The above reaction is very…

Q: How many moles of ammonia would be required to react exactly with 0.598 moles of copper(II) oxide in…

A: The given reaction is - - > 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3H₂O(g) 2 moles NH3 reacts…

Q: What is the mass in grams of carbon dioxide that would be required to react with 53.1 g of LiOH in…

Q: What is the mass in grams of carbon dioxide that would be required to react with 32.3 g of LiOH in…

Q: How many moles of nitrogen gas would be produced if 3.40 moles of copper(II) oxide were reacted with…

A: Consider the given reaction. 2NH3g+3CuOs→3Cus+N2g+3H2Og

Q: How many moles of ammonia would be required to react exactly with 0.158 moles of copper(II) oxide in…

A: Well-balanced chemical reaction: 2 NH₃(g) + 3 CuO(s) → 3 Cu(s)…

Q: How many moles of ammonia would be required to react exactly with 0.352 moles of copper(II) oxide in…

A: Given: moles of CuO = 0.470 mol Chemical reaction is given by, 2NH3(g)+3CuO(s)→3Cu(s)+N2(g)+3H2O(g)

Q: what mass of CO2 is produced by the reaction?

A: Molar mass of carbon is 12.01 g/ mol. Molar mass of CO2= Atomic weight of C + 2× Atomic weight of O…

Q: How many moles of nitrogen gas would be produced if 7.19 moles of copper(II) oxide were reacted with…

Q: How many moles of ammonia would be required to react exactly with 0.610 moles of copper(II) oxide in…

Q: What is the mass in grams of NO that will be produced from 30.0 g of NO, reacted with excess water…

Q: Morphine (C1„H19NO3) is a painkiller in the opiate family. A sample of morphine was discovered that…

A: Balanced Combustion reaction of morphine : 4C17H19NO3 + 85O2 ....> 68CO2 + 38H2O + 4NO2 Mass of…

Q: What is the mass in grams of carbon dioxide that would be required to react with 15.0 g of LiOH in…

A: The balanced reaction taking place is given as, => 2 LiOH (s) + CO2 (g) -------> Li2CO3 (s) +…

Q: What is the mass in grams of carbon dioxide that would be required to react with 16.4 g of LiOH in…

A: The no of moles of any substance is the ratio of given mass to that of molar mass of that substance.…

Q: How many grams of carbon dioxide would be required to react with 78.4 g of LiOH in the following…

A: The reaction given is 2 LiOH(s) + CO₂(g) → Li₂CO₃(s) + H₂O(l)

Q: What is the mass in grams of H₂ that can be formed from 30.8 grams of NH₃ in the following reaction?…

A: In the given reaction: 2 NH₃(g) → 3 H₂(g) + N₂(g) The molar mass of NH3 is 17.031 g/mol. The molar…

Q: What is the mass in grams of H₂ that can be formed from 47.0 grams of NH₃ in the following reaction?…

A: The question is based on the concept of Reaction Stoichiometry. We have to calculate the mass of…

Q: How many grams of reactant are needed to obtain 291 g of oxygen in the following reaction? 2H2O2 →…

Q: What is the mass in grams of carbon dioxide that would be required to react with 84.6 g of LIOH in…

A: Stereochemical coefficients tells about the ratio in which the reactants the react in a chemical…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

What is the mass in grams of carbon dioxide that would be required to
react with 38.4 g of LIOH in the following chemical reaction?
2 LİOH(s) + CO2(g)→
LI2CO3(s) + H2O(1)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
How many grams of beryllium (Be) are needed to react completely with 45.0 g of nitrogen (N2) in the synthesisof Be3N2?
Nitrogen fixation in the root nodules of peas and other legumes occurs with a reaction involving a molybdenum-containing enzyme named nitrogenase. This enzyme contains two Mo atoms per molecule and is 0.0872% Mo by mass. Calculate the molar mass of the enzyme.
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
4.24 Ammonia gas can be prepared by the reaction CaO(s)+2NH4Cl(s)2NH3(g)+H2O(g)+CaCl2(s) If 112 g of CaO reacts with 224 g of NH4Cl, how many moles of reactants and products are there when the reaction is complete?