What is the name of the following benzene derivative?

Q: Provide suitable IUPAC name for each of the following compounds.

A:

Q: What is the IUPAC name of the following substance?

A: This is an derivative of alkyne  Name is but-2-yne

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: Name the following using the IUPAC System

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: ne IUPAC name for the following carboxylic acid?

A:

Q: Draw structures of the following derivatives. ) the (E) isomer of the ethyl imine of propiophenone

A: SOLUTION: Step 1: The IUPAC name of ethylamine of propiophenone is N-ethyl-1-phenylpropan-1-imine.

Q: но,

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: Provide the IUPAC name for the following molecule.

A: The given compound is an alkane. During the IUPAC name of this compound select the principle chain…

Q: What is the product of 2-butanol and sodium amide in ammonia?

A: The given reactant is 2-butanol and reagents is sodium amide in the presence of ammonia.

Q: at is the IUPAC name of the following substance?

A: Write IUPAC name of the following---

Q: Give the IUPAC name of the following Benzene derivative

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: - correct IUPAC names for the following organic compounds:

A: The correct IUPAC names for the given compound can be written as,

Q: Provide the systematic name for the following benzene analogs and other aromatic compounds .

A:

Q: IUPAC name??

A: The nomenclature of the cyclic rings is done by giving priority to the functional groups. The…

Q: Can you deduce the structural formulas of benzoxazole and benzothiazole?

A: To find : The structural formulas of benzoxazole and benzothiazole

Q: Provide the systematic name for the following compound. :0:

A: In this question, we will give the systematic name of the given Compound.  You can see details…

Q: Which molecule is an amine?

A: In Organic Chemistry an amine is considered to be the functional group which contains a Nitrogen…

Q: Provide the IUPAC name for the following molecule:

A:

Q: What is the name of the following?

A:

Q: Provide the IUPAC name of the following compound:

A: alaknes are saturated compounds and names end with "ane" Identify the root name (longest continuous…

Q: но.

A: Given structures are aldehydes. Aldehydes in IUPAC system, are named by suffixing -al to parent…

Q: Provide suitable IUPAC name for each of the following compounds

A:

Q: What organic functional group does terephthalic acid contain? Enter its name. carboxy group

A: Check the structure for the terephthalic acid and write the name of functional group present in it.

Q: Provide the IUPAC names for the following molecules

A: The IUPAC names for the given molecules can be provided as,

Q: What is the systematic name for the compound shown? The name should have the format alkanamine.…

A:

Q: Write the iupac names of the following compounds

A: Nomenclature of organic compound is done according to the IUPAC nomenclature. There are certain…

Q: What is the name of the following benzene derivative? A) methylbenzene B) aniline C) phenol D)…

A: There is 2 types of naming of organic compound-  1- Common name 2- IUPAC name

Q: What are the IUPAC names of these compounds?

A: we have to name the given structures

Q: what the appropriate product and the corresponding product name:

A: The solution is given below -

Q: Name the following organic compound

A: The IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: What's the name of this organic compound?

A:

Q: Assign the required name for the following aromatic hydrocarbons.

A: 1. The IUPAC name for the compound is benzene-1,4-diol.

Q: what is the IUPAC name (using nomenclature) of the following molecule?

A:

Q: By simple chemical test, how can you distinguish between:                Cyclohexanol and…

A: Chemical test to distinguish between cyclohexanol and methoxybenzene is the reaction with sodium…

Q: Which of the following compounds is a tertiary amine?

A: Tertiary amine is a compound in which the Nitrogen group of amine functional group is directly…

Q: Provide the correct common name for the compound shown here. ..||||

A:

Q: Which of the following molecules is an ester?

A:

Q: Write the correct name of the following phenols:

A: IUPAC nomenclature is the naming system of all organic compounds. It is based on some nomenclature…

Q: Provide the IUPAC name of this molecule.

A: We are given an organic compound, we have to identify functional group, substituents, longest chain…

Q: What is the IUPAC name of the following amine?

A: For naming of amines carbon attached with NH2 group is taken into longest chain.Naming is done as…

Q: Provide the correct common name for the compound shown here.

A: Answer: Given compound is the tertiary amine, so we will follow the rules of writing down the common…

Q: name

A: We have to give IUPaC name of the compound

Q: What is the molecular formula of oxybenzone?

A: To give the molecular formula of oxybenzone.

Q: The IUPAC name of is: (a) N, N-Dimethyl aminobenzene (b) N, N-Dimethyl benzenamine (c) (a) and (b)…

A:

Q: Provide the IUPAC name for the molecule below:

A:

Q: Name the following Benzenes:

A: The first and the foremost step while naming the IUPAC name of an organic compound is the…

Q: What is Benzocaine?

A: Drugs: The chemical substances that have interaction with the proteins present in the body and that…

Q: Which is a meta-disubstituted benzenoid compound?

A:

Q: .What is the common name for the following compound?

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…