What is the pOH of (3.88x10^-5) M Li2O?

Q: A solution has a H3O*concentration of 1.3 x 10-4. What is the pOH of the solution at 25°C?

A: Given- [H3O+]= 1.3 x 10-4 To find - pOH   Formula- pH + pOH = 14 pH = -log [H3O+]

Q: What is the pOH of a 0.013 M Ca(OH)2 solution?

A: The dissociation of Ca(OH)2 is shown as, Concentration of each specie is given as, [Ca(OH)2] =…

Q: The hydroxide ion concentration in a bottle of household ammonia is 0.0082 M. What is the pH, pOH,…

A: • The values provided in the question are:-    i) Hydroxide ion concentration of a ammonia solution,…

Q: The OH⁻ concentration in an aqueous solution at 25 °C is 2.7 × 10⁻³. What is [H⁺]?

A:

Q: What are the [H3Oʻ] and pH of 0.085M weak base C2HSNH2?

A:

Q: What is the concentration of OH− at 25o C in 0.25 M nitric acid solution?

A:

Q: What is the pH of a solution of 0.300 M HNO, containing 0.180 M NANO,? (Ka of HNO2 is 4.5 x 10-4)

A: Given- Concentration of HNO2=0.300M Concentration of NaNO2=0.180M Ka of HNO2= 4.5×10-4

Q: What is the pOH of an aqueous solution of 3.66×10-2 M barium hydroxide?

A: Given data, Molarity of Barium hydroxide=3.66×10-2Mwe calculate pOH as follows:pOH=-log[OH-]

Q: Determine the [OH−], pH, and pOH of a solution with a [H+] of 7.3×10−8 M at 25 °C.

A: Given :- [H+] =7.3×10^−8 M  To calculate :-  [OH−], pH, and pOH

Q: The pH for 0.050 M HNO3?

A: All aqueous solutions always carry particular characteristics in terms of their pH value. [H+] ions…

Q: The hydronium ion concentration of a sample of river water is found to be 5.4 x 10-6M at 25°C.  What…

A: Given, The hydronium ion concentration, H+ = 5.4 × 10-6 M at 25°C

Q: An aqueous solution at 25.0 °C contains |H30*| = 0.09613 M. What is the pOH of the solution?

A: Given that:  [H3O+] = 0.09613M  pH tells the information about free H3O+ ion in a solution. pH =…

Q: Would a 1.0 * 10-8M solution of HCl have pH 6>7, pH = 7, or pH <7?

A:

Q: The H⁺ concentration in an aqueous solution at 25 °C is 9.3 × 10⁻⁶. What is [OH⁻]?

A: • The values provided in the question are:-      i) Hydrogen ion concentration of a solution, H+ =…

Q: What is the pOH of a 0.76 M solution of citric acid, if Ka = 7.4 x 10-4 of HC6H7O7.

A: Weak acids are not completely dissociated into ions in an aqueous solution. So, when it is dissolved…

Q: What is the pH of a peach with a [OH¯]=3.2x10-11 М ОН"?

A: In the Question, we want to determine the pH of the Solution.  You can see details Solution below.

Q: The triprotic acid H, A has ionization constants of K -9.31 x 10, Ka = 4.94 x 10, and K 6.54 x 10…

A:

Q: What is the pOH of an aqueous solution of 0.216 M hydroiodic acid?  pOH = ___________

A:

Q: What is the pOH of a 7.361 x 10^-4 M HCI solution?

A:

Q: The H⁺ concentration in an aqueous solution at 25 °C is 2.9 × 10⁻⁶. What is [OH⁻]?

A: For an aqueous solution, The H⁺ concentration, [H⁺]=2.9 × 10⁻⁶ M The concentration of OH⁻ ions has…

Q: What is the pOH of an aqueous solution of 5.81×10 M nitric acid? pOH =

A:

Q: What is the pH of a solution containing 9 gram of HCl (MW 18 am) dissolved in 50 ml of water?

A: In order to calculate the pH of solution we need to calculate firstly the number of moles of HCl.…

Q: What is the pOH of an aqueous solution of 0.250 M hydroiodic acid?

A: Given: 0.250 M Hydroiodic acid

Q: Why is [H3O]=[OH]=1.0*10-2 M not feasible in water? What would happen if we tried to make such a…

A: Since the water has an equilibrium with H3O+ and OH- ions as per the reaction  2 H2O (l)…

Q: The concentration of H3O* in a solution is 6 x 10 4 M at 25°C. What is its hydroxide-ion…

A: At 25°C  [H3O+].[OH-] = kw = 1 × 10-14 given :- [H3O+] = 6 × 10-4 M

Q: Which of the following indicates the most acidic solution? A. [OH]=0.5 M B. [H] =0.3 M C. pOH = 5.9…

A: pH = - log [H+] pOH = - log [OH-]   [OH-] = 10-pOH  [H+] = 10-pH    pH + pOH = 14    pH = 7 :…

Q: What is the pH of a HCI solution with a concentration of 6 x 104 M?

A: pH= -log [H^+]

Q: if the concentration of hydrogen ionsis 6.33 x10''-3 what is the concentration of hydroxide ions?

A: concentration of hydrogen ion = H+ = 6.33 x 10-3 concentration of hydroxide ion = OH- = ?

Q: Calculate the molarity of an phosphoricacid (H3PO4) solution if 75.00 mL is completely neutralized…

A:

Q: Calculate the pOH of an aqueous solution at 25°C that is (a) 0.011 M in HNO3 , (b) 3.5 × 10-3 M in…

A: pOH of solution can be can be calculated as, pH=-log[H+]pH+pOH=14pOH=14-pH

Q: An aqueous solution at 25°C has a pOH of 13.10, Calculate the pH. Round your answer to 2 decimal…

A:

Q: The H⁺ concentration in an aqueous solution at 25 °C is 3.7 × 10⁻⁴. What is [OH⁻]?

A: In this question we have to calculate the concentration of hydroxide ion by the given concentration…

Q: The OH concentration in an aqueous solution at 25 °C is 2.1 × 10 3. What is [H ]?

A:

Q: Identify each of the following oxides as an acid or baseanhydride. Write the chemical formula and…

A: The chemical formula and the name of the acid or base formed upon reaction with water has to be…

Q: What is the pOH of an aqueous solution of 0.233 M hydroiodic acid? _________ pOH

A: since we know that  pH + P(OH) = 14

Q: What is the pOH of a .0767 M HydroIodic Acid Solution?

A: We know that, pH is the negative logarithm of hydrogen ion concentration and pOH is the negative…

Q: An aqueous solution at 25.0 °C contains |H3O+| = 0.06704  M. What is the pOH of the solution?

A: Given  [H3O+]  =   0.06704 M     POH   =   ?

Q: What concentration of NH4NO3 is required to make [OH−] = 1.0 × 10−5 in a 0.200-M solution of NH3?

A: It is given that the [OH-] in a 0.200 M solution of NH3 is 1.0 ×10-5 and the concentration of NH4NO3…

Q: What is the pH of a 1.0 x 10 M BalOH), solution at 25 °C: 7

A:

Q: Will a solution whose [H] = 5.04 x 10 be acidic, basic or neutral?

A: Given : Concentration of H+ ions=5.04×10-3  To identify : The nature of solution

Q: What is the pOH of a 0.0027 M Ba(OH)2 solution?

A: Given: Concentration of Ba(OH)2 = 0.0027 M.

Q: Determin the pOH for a 1650 mL solution of 3.00 g of Mg(OH)2

A: Given that:                        Volume of the solution = 1650 ml = 1.65 L           Mass of…

Q: What concentration of NH4NO3 is required to make [OH‐] = 1.0 × 10‐⁵ in a 0.200 M solution of NH3?

A:

Q: Which one of the following 0.1 M aqueous solutions has pH = 7? OA. NaF O B. NHẠNO3 O C. NaHSO, D.…

A: pH is defined as the negative logarithm of the H+ion concentration.                       pH =…

Q: The hydronium ion concentration of an aqueous solution of 0.558 M isoquinoline (a weak base with the…

A:

Q: What is the pOH of a 0.00502 molar HCl solution at 25 °C?

A: Hydrogen chloride is a strong acid that dissociates completely in aqueous solution.

Q: If it takes 50.00 mL of 0.500 M KOH solution to completely neutralize 125 mL of sulfuric acid…

A: The balanced chemical equation for the reaction of potassium hydroxide and sulphuric acid can be…

Q: What is the pH of a 4.5×102M solution of KOH at 25 °C?

A: Given:   The concentration of KOH is 4.5×10-2 M. The value of temperature is 25 ˚C.

Q: What is the pOH of 0.350 M HNO3?

A: Nitric acid, HNO3 is a strong acid which completely dissociate into H+ and nitrate ions, NO3-. As it…

Q: according to Arrhenius theory, Ca (OH) 2 is basic because: a) calcium is a very active metal b) when…

A: According  to Arrhenius  theory that bases ionize in water to yield hydroxide ions (OH−).