Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:Since, molar mass of ethyl alcohol is 46.068g/mol, therefore, number of moles of ethyl…
Q: Asnwer are already written in pink, I would just like an explanation of how the answers where…
A: Part 2:Explanation: Reaction 1:1. Step 1: 3 NaNH2, NH3 - This step involves the use of sodium…
Q: At 100° C, the Keq for the Haber process is 4.51 x 10-5: N2 + 3 H2 ------> 2 NH3 Consider the…
A: The Haber process is a chemical reaction in which nitrogen (N2) and hydrogen (H2) combine to form…
Q: HELP! Lab Thermodynamics of Solubility: Use the formulas that are provided on the graph. 1.Using…
A: 1. Using equation 1, calculate the K for each temperature:K = (s)(s) = s²Trial 1:K = (7.9)(7.9) =…
Q: could you anwer this?
A: (a) Lewis structure:As per the given number of valence electrons, sulfur has 6 valence electrons…
Q: Give me detailed Solution with explanation needed. don't use Ai for answering this
A: Step 1:When atoms with different electronegativity forms a covalent bond then shared electrons…
Q: A 13C NMR spectrum is shown for a molecule with the molecular formula of C4H8O2. Draw the structure…
A:
Q: Chain-growth polymerization is a polymerization process that where unsaturated oligomers molecules…
A: Answer: FALSE Chain-growth polymerization is a polymerization technique where unsaturated MONOMER…
Q: Show a synthesis of the following mostly (Z)-alkene molecule starting from benzene (C6H6), any other…
A: Here's a detailed explanation of each step in the synthesis:**Step 1: Grignard Reaction**The first…
Q: Please answer in tipping format
A: Step 1: Step 2: Step 3: Step 4:
Q: Numbering the main chain of branched alkanes For each organic compound in the table below, enter the…
A: The locant number can be found from IUPAC nomenclature. For that purpose, first identify the longest…
Q: Naming the parent hydrocarbon of branched alkanes For each organic compound in the table below, name…
A: Step 1: Step 2: Step 3: Step 4:
Q: A substance has a half-life of 2.141 minutes. If the initial amount of the substance was 307.2…
A: The first step is to determine the number of half-lives that have passed. This can be done by…
Q: Please help me solve the following question, explain it and pls pls make sure its correct, its…
A: The key information given in the problem is:Four research teams measured the rotation period of a…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Step 2: Lithium aluminum hydride(LiAlH4) is a powerful reducing agent used in chemistry. It…
Q: Naming the parent hydrocarbon of branched alkanes For each organic compound in the table below, name…
A: The main carbon chain which has the longest carbon chain or has the principal carbon chain is the…
Q: 44) What is the coefficient of phosphorus after balancing the following equation?__ P(s) + __ O2 (g)…
A: The unbalanced chemical equation is P(s) + O2 (g) º P2O5 (s). In this equation, we need to find the…
Q: The reaction of Nb (CH2CMe3)3Cl2 with two equivalents of LiCH2CMe3 leads to the formation of…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Approach to solving the question: Detailed explanation: Biological oxygen demand (BOD) is a measure…
Q: The non-polar molecule among the following is CI CI C H H Type here to search Εί prime video CI…
A: In chemistry, polarity refers to the distribution of electric charge around atoms, ions, or…
Q: Help me solve the following question, explain and make sure everything is correct thanks 100!!
A:
Q: Please correct answer and don't use hend raiting
A: Approach to solving the question: When crafting a response to a message like the one provided, it's…
Q: Please correct answer and don't use hend raiting
A: Step 1: Boiling point elevation is given by:ΔT = ((RT2)/ΔHVap) XsolHere, ΔT = Boling point…
Q: Chemistry
A: To calculate ΔH, ΔS, ΔG, and ΔA for the process described, we will use the given data and standard…
Q: None
A: Thank you,
Q: Give detailed mechanism Solution with explanation needed..don't give Handwritten answer...
A:
Q: None
A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…
Q: Identifying the main chain of branched alkanes Tag each carbon atom in the main chain of the…
A: Marked by green line is the main chain.2-methylpentane :- Hydrogen replaced by Methyl group in…
Q: Please don't provide handwritten solution ...
A: To determine the hybridization of an atom, we need to consider the number of regions of electron…
Q: Chemistry
A: Step 1:Step 2:Step 3:
Q: Draw the reaction mechanism for the synthesis of complex N: show electron transfer arrows
A: The starting material, Cp2TiCl2, is a titanium complex containing two Cp ligands and two chlorine…
Q: At 100° C, the Keq for the Haber process is 4,51 x 10-5: N2 + 3 H2 ó 2 NH3…
A: Step 1: Step 2: Step 3: Step 4:
Q: che.3
A: A chiral center (also called a stereocenter or asymmetric carbon) is a carbon atom that is bonded to…
Q: (i) Suggest structures for the reagents and products in the boxes labelled A to H in the reaction…
A: Step 1:Step 2: Step 3: Step 4:
Q: Which of the following molecules can be classified as a lipid?…
A: Lipids are a diverse group of biomolecules that share the common property of being hydrophobic,…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Step 2:Step 3: Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: To give IUPAC name for any compound, firstly we have to select longest chain, that is…
Q: None
A: Step 1:Step 2:Step 3:
Q: 3. Draw 1,3-cyclohexanedione and CIRCLE any a-acidic hydrogens (Box A). Place the number of a-acidic…
A: According to this question, let's first draw the structure of 1, 3 - cyclohexanedione and identify…
Q: 5.. Write the two cyclized products that are obtained upon base catalyzed cyclizaion of A EtO ཨི།…
A: Step 1: There two types of carbanions cn be forms A and B from 2 types of protons in path a and…
Q: Help me solve this
A: STEP - 1:Given that,Diameter of air bubble is, d1=2cmDepth of submarine h=40mdensity of water…
Q: Please don't provide handwritten solution.... Show how the aldol condensation could be used to…
A: In an aldol condensation, the first step is to identify the alpha carbon and the carbonyl group in…
Q: Nitrogen dioxide is one of the many oxides of nitrogen (often collectively called "NOx") that are of…
A: The chemical reaction of nitrogen dioxide (NO2) forming dinitrogen tetroxide (N2O4) can be…
Q: Umesh
A: Step 1: As the substance or compound is not mentioned for first 2 questions, it is considered as…
Q: Identify the functional groups in the following molecules. (Use names from the table below. List…
A: To identify the functional groups in the given molecules, we will examine each molecule and list the…
Q: 3. Provide the major organic product of the following reaction. Use line angle structures to show…
A: Step 1:Hydrazene 2 is a nucleophile. The ketone oxygen takes up proton from the acid and polarizes…
Q: None
A: Part A :Step 1:Monoprotic acid means the acid has one replaceable hydrogen atom. Let formula of the…
Q: Plz draw out the full mechanisms for problem 3!
A: Step 1: Step 2: Step 3:Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Explanation : We know, unit conversion :1 km = 1000 m and 1 m = 100 cm Therefore, 1 km = 1000 x 100…
Q: Give detailed Solution with explanation needed with structures. Don't give Handwritten answer
A: Step 1:Despite having chiral center when a compound has an element of symmetry then it gets turned…
- What molar concentration of hydrazine, N2H4 (Kb = 1.7 x 10-6) yields a solution with a pH of 10.46?
Unlock instant AI solutions
Tap the button
to generate a solution
Click the button to generate
a solution
- What was the original 1. concentration (M) of an aqueous acetic acid (CH3COOH) solution whose pH is 2.68 (25.0 oC)? The Ka = 1.80 x 10–5When ammonium sulfate dissolves, both the anion and cation have acid-base reaction: (NH4)2SO4(s) 2NH4* + SO42- NH4* + NH3(aq) + H* SO2- + H2O → HSO4 + OH Ksp = 276 Ka = 5.70 x10-10 Кь 3 9.80 х 10-13 (a) (b) (c) Write a charge balance for this system. Write a mass balance for this system. Find the concentration of NH3(aq) if the pH is fixed at 9.25.Q3. This question is about the pH of several solutions. Give all values of pH to 2 decimal places. (a) (i) Write an expression for pH. (b) (ii) Calculate the pH of the solution formed when 10.0 cm³ of 0.154 mol dm-³ hydrochloric acid are added to 990 cm³ of water. The acid dissociation constant, Ka, for the weak acid HX has the value 4.83 x 10-5 mol dm-³ at 25 °C. A solution of HX has a pH of 2.48 Calculate the concentration of HX in the solution. Page 4 of 14
- Calculate the pH of a 0.052 M (C2H5)2NH solution (Kb = 1.3 × 10-³). pH =A diprotic acid (H₂A) has Kal = 4.54 x 10-7 and K₁2 = 5.59 x 10-¹1. What is the pH of a 0.396 M H₂A solution? pH =Calculate the pH of a weak base solution ([B]o > 100 • Kp). Calculate the pH of a 0.104 M aqueous solution of triethanolamine (C,H1503N, K, = 5.8×10") and the equilibrium concentrations of the weak base and its conjugate acid. pH (C,H1503N]equilibeium (C,H15O3NH"]equilibrium Check & Submit Answer Show Approach Calculate the pH of a weak base solution (quadratic equation). Calculate the pH of a 0.0362 M aqueous solution of ethylamine (C,H;NH2. Kg – 4.3×10“) and the equilibrium concentrations of the weak base and its conjugate acid. pH (C,H;NH;lequilibrium M. (C,H,NH3" Jequilibrium M. Check & Submit Answer Show Approach
- Calculate the molar concentration of formic acid, HCOOH (Ka = 1.80 x 10-4) that was 3% ionized.2:10 2- 3C₂²- + 1 2 3 4 N Complete the balanced chemical reaction for the following weak base with a strong acid. In this case, write the resulting acid and base as its own species in the reaction. NH3(aq) + HCl(aq) (s) Question 1 of 10 O Reset LO 5 OH H₂O 6 CI 7 6 个 x H₂O Tap here or pull up for additional resources Submit 8 9 11 (aq) O H H3O+Calculate the pH of a 6.9 x 10¬³-M solution of H2SO4 ( 1.2 x 10-2). -3 a2 pH =