When the Pb2+ concentration is 1.30 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.344V. What is the Mg² concentration? Pb2*(aq) + Mg(s)→ Pb(s) + Mg²*(aq) Answer: M

When the Pb2+ concentration is 1.30 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.344V. What is the Mg² concentration? Pb2(aq) + Mg(s)→ Pb(s) + Mg²(aq) Answer: M

Principles of Instrumental Analysis

7th Edition

ISBN:9781305577213

Author:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Publisher:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Chapter22: An Introduction To Electroanalytical Chemistry

Section: Chapter Questions

Problem 22.11QAP: Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp...

See similar textbooks

Related questions

Q: When the Pb2+ concentration is 1.04 M, the observed cell potential at 298K for an electrochemical…

A: Given reaction is : 3Pb2+(aq) + 2Cr(s) → 3Pb(s) + 2Cr3+(aq) The half-reactions are : At anode:…

Q: When the Ag+ concentration is 3.64×10-4 M, the observed cell potential at 298K for an…

Q: When the Cu" concentration is 1.38 M, the observed cell potential at 298K for an electrochemical…

A: An electrochemical cell has two electrodes: cathode and anode. The cathode involves the reduction…

Q: When the Ag* concentration is 1.17 M, the observed cell potential at 298K for an electrochemical…

Q: When the Cu2+ concentration is 7.81×10-4 M, the observed cell potential at 298K for an…

Q: When the Hg2+ concentration is 1.25 M, the observed cell potential at 298K for an electrochemical…

A: An electrochemical cell is a device that can generate electrical energy from the chemical reactions…

Q: When the Ag+ concentration is 1.09 M, the observed cell potential at 298K for an electrochemical…

A: The reaction at cathode i.e; reduction. Ag+(aq)+e-→Ag(s) E0red=0.7996 V The…

Q: When the Ag+ concentration is 8.96x10-4 M, the observed cell potential at 298K for an…

A: Here we are required to find the concentration of Mn2+.

Q: When the Cu²+ concentration is 1.18 M, the observed cell potential at 298K for an electrochemical…

Q: What is the calculated value of the cell potential at 298K for an electrochemical cell with the…

A: The given cell reaction is as follows --- 3 Ag+ (aq) + Al (s) → 3 Ag (s) +…

Q: When the Hg2+ concentration is 1.25 M, the observed cell potential at 298K for an electrochemical…

A: We will first find the Eo,cell using the formula given below. Then the Eo of anode and cathode are…

Q: When the Hg2+ concentration is 1.23 M, the observed cell potential at 298K for an electrochemical…

A: In the given cell, mercury is undergoing reduction at cathode and chromium is getting oxidized at…

Q: When the Hg2+ concentration is 1.33 M, the observed cell potential at 298K for an electrochemical…

Q: When the Ag* concentration is 1.25×10-4 M, the observed cell potential at 298K for an…

A: Nernst equation can be used to determine the equilibrium concentration in galvanic cells

Q: When the Ag+ concentration is 4.98×10-4 M, the observed cell potential at 298K for an…

A: Given reaction is , 3Ag+(aq) + Al(s)----> 3Ag(s) + Al3+(aq) Nernst equation for the…

Q: When the Ag* concentration is 1.23 M, the observed cell potential at 298K for an electrochemical…

A: Given: Concentration of Ag+ = 1.23 M Cell potential = 3.264 V

Q: When the Ag* concentration is 1.25×104 M, the observed cell potential at 298K for an electrochemical…

Q: When the Hg2+ concentration is 8.85×10-4 M, the observed cell potential at 298K for an…

Q: When the Ag* concentration is 1.43 M, the observed cell potential at 298K for an electrochemical…

Q: When the Hg2+ concentration is 1.47 M, the observed cell potential at 298K for an electrochemical…

A: Nernst equation is used to determined the cell potential of reaction. Formula of Nernst equation.…

Q: When the Pb2+ concentration is 1.36 M, the observed cell potential at 298K for an electrochemical…

Q: When the Ag+ concentration is 1.38 M, the observed cell potential at 298K for an electrochemical…

A: In electrochemical cell, in one compartment the oxidation takes place and in another the reduction…

Q: When the Cu2+ concentration is 1.31 M, the observed cell potential at 298K for an electrochemical…

A: Given: An electrochemical cell reaction: Cu2+aq + Mgs → Cus + Mg2+aq Half cell reactions…

Q: When the Cu²+ concentration is 1.04 M, the observed cell potential at 298K for an electrochemical…

Q: When the Hg2+ concentration is 1.16 M, the observed cell potential at 298K for an electrochemical…

A: The given electrochemical cell is 3Hg2+(aq) + 2Al(s)→3Hg(l) + 2Al3+(aq) Which is can be obtained…

Q: When the Cu2* concentration is 1.35 M, the observed cell potential at 298K for an electrochemical…

Q: When the Cu2+ concentration is 4.58×10-4 M, the observed cell potential at 298K for an…

A: We are going to determine the concentration of Mn2+ as follows

Q: When the Pb2+ concentration is 3.87x10-4 M, the observed cell potential at 298K for an…

A: Given-> Concentration of Pb2+ = 3.87 × 10-4 M Ecell = 1.433 V T = 298 K

Q: When the Cu2+ concentration is 1.23 M, the observed cell potential at 298K for an electrochemical…

Q: When the Ag+ concentration is 1.11 M, the observed cell potential at 298K for an electrochemical…

A: We will use nernest Equation

Q: When the Cu²+ concentration is 1.02 M, the observed cell potential at 298K for an electrochemical…

Q: When the Pb2+ concentration is 1.16 M, the observed cell potential at 298K for an electrochemical…

A: Given, [Pb2+] = 1.16 M And Ecell = 0.732 V E° of Pb2+/Pb = -0.13 V and that of Zn2+/Zn = -0.76…

Q: Consider a cadmium (Cd) concentration cell. In one half-cell, there is a Cd metal electrode and a…

A: Since it is a concentration cell, the standardelectrode potential or cell potential of the system is…

Q: When the Ag+ concentration is 1.33 M, the observed cell potential at 298K for an electrochemical…

A: The given cell is an electrochemical cell.

Q: When the Ag+ concentration is 4.05×10-4 M, the observed cell potential at 298K for an…

A: Overall cell reaction: 2Ag+(aq) + Zn(s) <---> 2Ag(s) + Zn2+(aq)

Q: When the Pb2+ concentration is 1.37 M, the observed cell potential at 298K for an electrochemical…

A: The solution is given below -

Q: When the Ag+ concentration is 1.07 M, the observed cell potential at 298K for an electrochemical…

Q: When the Pb* concentration is 1.44 M, the observed cell potential at 298K for an electrochemical…

Q: When the Cu²+ concentration is 1.00 M, the observed cell potential at 298K for an electrochemical…

A: The given reaction is : The half reactions are : At cathode :Cu2+ + 2e- → Cu E°=+0.34 V…

Q: What is the calculated value of the cell potential at 298 K for an electrochemical cell with the…

Q: When the Pb2+ concentration is 1.32×104 M, the observed cell potential at 298K for an…

A: In the given cell, lead is undergoing reduction at anode and aluminium is getting oxidized at anode.…

Q: When the Cu2+ concentration is 1.21 M, the observed cell potential at 298K for an electrochemical…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: When the Cu2+ concentration is 1.21 M, the observed cell potential at 298K for an electrochemical…

A: We will use nernest Equation to get the answer

Q: When the Cu2+ concentration is 1.35 M, the observed cell potential at 298K for an electrochemical…

Q: Which of the following is the best reducing agent? You may use the table of standard cell potentials…

A: Reducing agent is the one which undergo oxidation itself. The standard cell potentials of given…

Q: When the Hg2+ concentration is 1.33 M, the observed cell potential at 298K for an electrochemical…

Q: When the Pb2+ concentration is 1.15 M, the observed cell potential at 298K for an electrochemical…

Q: When the Pb2+ concentration is 1.36 M, the observed cell potential at 298K for an electrochemical…

Q: When the Cu2+ concentration is 1.47 M, the observed cell potential at 298K for an electrochemical…

A: Nernst equation for electro chemical cell at standard condition is as follows, Ecell=…

Q: When the Ag+ concentration is 1.11 M, the observed cell potential at 298K for an electrochemical…

Question

When the Pb2+ concentration is 1.30 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.344V. What is the Mg²+
concentration?
*(aq) + Mg(s)– Pb(s) + Mg²*(aq)
Answer:
M

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
When the Pb2+ concentration is 1.10 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.361V. What is the Mg2+ concentration?Pb2+(aq) + Mg(s) Pb(s) + Mg2+(aq) Answer:___M
When the Pb2+ concentration is 1.28 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.362V. What is the Mg2+ concentration?Pb2+(aq) + Mg(s) Pb(s) + Mg2+(aq)Answer: _________ M
When the Hg2+ concentration is 1.25 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 3.340V. What is the Mg2+ concentration? Hg2+(aq) + Mg(s) Hg(l) + Mg2+(aq)Answer: M
When the Cu2+ concentration is 1.13 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.806V. What is the Mg2+ concentration?Cu2+(aq) + Mg(s)---> Cu(s) + Mg2+(aq)Answer: ____M
When the Pb2+ concentration is 1.13 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.357V. What is the Mg2+ concentration? Pb2+(aq) + Mg(s) Pb(s) + Mg2+(aq) Answer: M
When the Pb2+ concentration is 1.36 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 0.754V. What is the Zn2+ concentration?Pb2+(aq) + Zn(s) Pb(s) + Zn2+(aq)Answer: M
When the Cu2+ concentration is 3.82×10-4 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 1.893V. What is the Al3+ concentration?3Cu2+(aq) + 2Al(s)----> 3Cu(s) + 2Al3+(aq)Answer: ____ M
When the Pb2+ concentration is 1.17 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 1.154V. What is the Mn2+ concentration? Pb2+(aq) + Mn(s) Pb(s) + Mn2+(aq) Answer: M
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 1.34 M and the Mg2+ concentration is 8.81×10-4 M ?Cu2+(aq) + Mg(s) Cu(s) + Mg2+(aq)Answer: _____ VThe cell reaction as written above is spontaneous for the concentrations given: tue or false?