When the redox reaction Mn²+(aq)reaction belowH+H* (aq) is+ Bi03 →>>>(aq)Bi3+ isMnO4 (aMn²+ (aq) is(aq) +_Mn²+,(aq) +_BiO3(aq)→ _MnO4 (aq) +.What are the lowest whole number coefficients that would balance the reaction?Bi³+(aq)H2O is+ Bi³+,is balanced it turns into the(aq)BiO3(aq) is(aq) +_H₂0 (1)MnO4-

We have to balance the given reaction and determine the coefficients

When the redox reaction Mn²+ reaction below H+ H* (aq) is (aq) + Mn2+, (aq) Bi3+ is + Bi03 (a + (aq) +_BiO3(aq) →MnO4 (aq) +_Bi³+ What are the lowest whole number coefficients that would balance the reaction? (aq) Mn²+ (aq) is MnO4 (aq) + Bi³+ (aq) H2O is BiO3 (aq) is balanced it turns into the is (aq) + H₂0 (1) MnO4-

When the redox reaction Mn²+ reaction below H+ H* (aq) is (aq) + Mn2+, (aq) Bi3+ is + Bi03 (a + (aq) +_BiO3(aq) →MnO4 (aq) +_Bi³+ What are the lowest whole number coefficients that would balance the reaction? (aq) Mn²+ (aq) is MnO4 (aq) + Bi³+ (aq) H2O is BiO3 (aq) is balanced it turns into the is (aq) + H₂0 (1) MnO4-

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 25QAP: For the following half-reactions, answer these questions....

See similar textbooks

Similar questions

The iron content of hemoglobin is determined by destroying the hemoglobin molecule and producing small water-soluble ions and molecules. The iron in the aqueous solution is reduced to iron(II) ion and then titrated against potassium permanganate. In the titration, iron(ll) is oxidized to iron(III) and permanganate is reduced to manganese(II) ion. A 5.00-g sample of hemoglobin requires 32.3 mL of a 0.002100 M solution of potassium permanganate. The reaction with permanganate ion is MnO4(aq)+8H+(aq)+5Fe2+(aq)Mn2+(aq)+5Fe3+(aq)+4H2O What is the mass percent of iron in hemoglobin?
An electrolytic cell is set up with Cd(s) in Cd(NO3)2(aq) and Zn(s) in Zn(NO3)2(aq). Initially both electrodesweigh 5.00 g. After running the cell for several hours theelectrode in the left compartment weighs 4.75 g. (a) Which electrode is in the left compartment? (b) Does the mass of the electrode in the right compartmentincrease, decrease, or stay the same? If the masschanges, what is the new mass? (c) Does the volume of the electrode in the right compartment increase, decrease, or stay the same? If the volumechanges, what is the new volume? (The density of Cd is8.65 g/cm3.)
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
. To obtain useful electrical energy from an oxidation-reduction process, we must set up the reaction in such a way that the Oxidation half-reaction and the reduction half-reaction are physically one _____another.
Atomic masses can be determined by electrolysis. In one hour, a current of 0.600 A deposits 2.42 g of a certain metal, M, which is present in solution as M+ ions. What is the atomic mass of the metal?
Consider three metals, X, Y, and Z, and their salts, XA, YA, and ZA. Three experiments take place with the following results: • X+hotH2Obubbles • X+YAnoreaction • X+ZAXdiscolored+Z Rank metals X, Y, and Z, in order of decreasing strength as reducing agents.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
One of the few industrial-scale processes that produce organic compounds electrochemically is used by the Monsanto Company to produce1,4-dicyanobutane. The reduction reaction is 2CH2CHCH+2H++2eNC(CH2)4CN The NC(CH2)4CN is then chemically reduced using hydrogen gas to H2N(CH2)6NH2, which is used in the production of nylon. What current must be used to produce 150.kg NC(CH2)4CN per hour?
Describe what you expect to happen when the following solutions are electrolyzed: a aqueous Na2SO4; b aqueous KBr. That is, what are the electrode reactions? What is the overall reaction?
For the following half-reactions, answer these questions. Ce4+(aq)+eCe3+(aq)E=+1.61VAg+(aq)+eAg(s)E=+0.80VHg22+(aq)+2e2Hg(l)E=+0.80VSn2+(aq)+2eSn(s)E=0.14VNi2+(aq)+2eNi(s)E=0.24VAl3+(aq)+3eAl(s)E=1.68V (a) Which is the weakest oxidizing agent? (b) Which is the strongest oxidizing agent? (c) Which is the strongest reducing agent? (d) Which is the weakest reducing agent? (e) Will Sn(s) reduce Ag+(aq) to Ag(s)? (f) Will Hg(l) reduce Sn2+(aq) to Sn(s)? (g) Which ion(s) can be reduced by Sn(s)? (h) Which metal(s) can be oxidized by Ag+(aq)?
Why is it not possible for hydroxide ion (OH-) to appear in either of the half-reactions or the overall equation when balancing oxidation—reduction reactions in acidic solution?
In theory, most metals should easily corrode in air. Why? A group of metals called the noble metals are relatively difficult to corrode in air. Some noble metals include gold, platinum, and silver. Reference Table 17-1 to come up with a possible reason why the noble metals are relatively difficult to corrode.