Write a complete IUPAC name for each of the following compounds.

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: Write the correct name according to IUPAC for these compounds

A: There are different type of bicyclic compounds, which have different IUPAC names. The names of…

Q: What is the systematic (IUPAC) name of the following compound?

A:

Q: Provide the correct IUPAC name for the compound shown here.

A: IUPAC nomenclature rules to cycloalkanes :  1. The ring is the parent chain  2. While numbering…

Q: What is the IUPAC name of the following compound?

A:

Q: correct IUPAC name

A:

Q: Write the IUPAC name for each of the following:

A: The alkene is given and we to tell the IUPAC name of the compound.

Q: (СНЗО)СССН(ОСНЗ)СНЗ

A:

Q: The IUPAC name of the compound below

A: Organic compounds are named according to the IUPAC nomenclature which has some general rules. The…

Q: correct IUPAC name of the following compound"

A: The correct IUPAC name of the given compound can be drawn as,

Q: Write the IUPAC name of the following compounds.

A: To find out the IUPAC nomenclature:- First, find out the highest priority functional group. Then…

Q: What is the IUPAC name of this compound?

A:

Q: Provide the correct IUPAC name for the compound shown here. عمليه

A:

Q: Give  the correct IUPAC name and spelling of the following compounds. Note proper notations (like…

A:

Q: What are the IUPAC names of the following?

A:

Q: The IUPAC name for the following molecule is:

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the IUPAC name of the compound,

A:

Q: What is the name of the following compounds using the IUPAC system?

A: The IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: What is the IUPAC name of the compound?

A: The IUPAC name of the given compound is given below.

Q: IUPAC Nomenclature. IUPAC name of the following compounds

A: Since you have posted a  question with sub-parts , we are entitled to answer the first three…

Q: What is the IUPAC name of these compounds

A: The naming of an organic compound can be done with help of rules of international union of pure and…

Q: Provide the IUPAC name of the following compound:

A: alaknes are saturated compounds and names end with "ane" Identify the root name (longest continuous…

Q: What is the IUPAC name of the following compound? он

A: The given compound can be numbered as follows,

Q: Provide the IUPAC names for the following molecules

A: The IUPAC names for the given molecules can be provided as,

Q: Write the iupac names of the following compounds

A: Nomenclature of organic compound is done according to the IUPAC nomenclature. There are certain…

Q: Give the correct IUPAC name for the following compound:

A:

Q: Provide the correct IUPAC name for the compound shown here. НО

A: • The longest carbon chain in the given compound contains four carbon atoms. Therefore, the root…

Q: Give the complete IUPAC name of the following compounds.

A: Given here the structures of two compounds and we are aksed to write the IUPAC name of the…

Q: What is the IUPAC name of the following compound? *

A: IUPAC rules :     1. Choose the longest chain  rule,    2. While give numbering , substituents…

Q: The IUPAC name of the compound below is

A: 9

Q: Write IUPAC name of following

A:

Q: What are the IUPAC names of the following compounds?

A: Following are the IUPAC nomenclature of A and B

Q: Provide the correct IUPAC name for the compound shown here. ☆

A:

Q: Give the IUPAC name for each of the following compounds:

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: the correct IUPAC name for the compound shown here.

A:

Q: What is the IUPAC name of the molecule shown?

A: When doing IUPAC name of a cycloalkane, start numbering the carbons of a cycloalkane with the…

Q: CI

A: The correct IUPAC name of the structure is given below.

Q: IUPAC name of the following compound

A: In this question, the name of the given compound has to be determined. The compound is :

Q: ОН

A:

Q: Give the complete IUPAC name and the common name for each of the following compounds

A: IUPAC system is used to name the organic compound.

Q: 13 Write a complete IUPAC name for each of the following compounds.

A: To write the IUPAC name we have to follow the following steps  (1) Identify the longest carbon chain…

Q: Please give the IUPAC name of these compounds

A:

Q: Give the IUPAC names for each of the following compounds

A: Nomenclature :  IUPAC name is in the order of   Prefix + Word root + Suffix   Rules : Choose the…

Q: Provide the correct IUPAC name for the compound shown below.

A: The given organic molecule contains  ketone functional group.

Q: Provide the IUPAC name for the following compound.

A: The given compound is a bicyclic compound.

Q: Select the correct IUPAC name for the following molecule

A: here, given question  IUPAC -  1-Methylcyclopetene

Q: Write a complete IUPAC name for each of the following compounds

A: In this question, the IUPAC name of the provided compounds has to be determined. (i) IUPAC Name:…

Q: Give the correct IUPAC name for the following compound.

A:

Q: What are the IUPAC names of the following compounds

A:

Q: 3. Provide the IUPAC name of each of the following

A:

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.