Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed:CH2−O−C—(CH2);–CH=CH–CH2–CH=CH—(CH2)4—CH3CH-O-C-(CH2)14-CH3O11CH2−O−C— (CH2)14 — CH3Separate each name with a comma. You will find useful information in the ALEKS Data resource.1010ContinueOaX000YF8F9Submi

Fat after hydrolysis produces fatty acid (s) and glycerol

Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0=0 CH,—O–C—(CH2)—CH=CH–CH2–CH=CH—(CH2), CH3 O 11 CH—O—C—(CH2)14—CH3 O CH,—O—C—(CH2)14 –CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. A a X Y

Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0=0 CH,—O–C—(CH2)—CH=CH–CH2–CH=CH—(CH2), CH3 O 11 CH—O—C—(CH2)14—CH3 O CH,—O—C—(CH2)14 –CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. A a X Y

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter6: Reactions Of Alkenes

Section: Chapter Questions

Problem 6.31P: When 2-pentene is treated with Cl2 in methanol, three products are formed. Account for the formation...

See similar textbooks

Similar questions

When 2-pentene is treated with Cl2 in methanol, three products are formed. Account for the formation of each product (you need not explain their relative percentages).
The following compounds are given to you:2-Bromopentane, 2-Bromo-2-methylbutane, 1-Bromopentane(i) Write the compound which is most reactive towards SN2 reaction.(ii) Write the compound which is optically active.(iii) Write the compound which is most reactive towards P-elimination reaction.
describe how the following conversions could be carried out. In each case give reagents and conditions of the reactions and the structures of the products. a) CH2=CH2 -> CH2 COOH b) ethanol -> 2hydroxypropanoic acid
2,4,6-Trinitrophenol is known by the common name picricacid. Picric acid is a solid but is readily soluble in water. Insolution, it is used as a biological tissue stain. As a solid,it is also known to be unstable and may explode. In thisway, it is similar to 2,4,6-trinitrotoluene (TNT). Draw thestructures of picric acid and TNT. Why is picric acid readily soluble in water, whereas TNT is not?
potassium dichromate (Cr2O7^2-) oxidation of ethanol to acetic acid is the basis for the original breath-alcohol screening test used by law enforcement agencies to determine a person's blood alcohol content (BAC). the test is based on the difference in colour between the dichromate ion( redish orange) in the reagent and the chromium(iii) ion (green) in the product. deduce the reaction that is involved in this test and give the IUPAC name of the other product formed.
In an advanced synthetic chemistry experiment, a researcher prepares a compound, ZY-7, by reacting a ketone (C5H10O) with hydroxylamine (NH2OH), followed by heating in the presence of an acid catalyst. The resulting compound, ZY-7, is then treated with a solution of sodium nitrite (NaNO2) and hydrochloric acid (HCl) at low temperature. Identify the class of compound that ZY-7 most likely belongs to after this series of reactions." A) Amide B) Oxime C) Nitro compound D) Diazonium salt E) Ester Don't use chatgpt please provide valuable answer
Wittig reaction can occur intramolecularly. Name the alkene product of the Wittig reaction that occurs when 7-bromo-2-heptanone is trated with 1) PPh3, 2) n-BuLi
Three products with the molecular formula C6 H4BrCl form when bromobenzene is treated with chlorine, Cl2, in the presence of FeCl3 as a catalyst. Name and draw a structural formula for each product.
name and draw the product/s formed from the reaction of 3-methylpent-2-ene: 1. with HBr 2. with Cl2 3. H2O in the presence of H2SO4 4. ethanol in the presence of H2SO4 5. Br2, H2O 6. [1] 9-BBN; [2] H2O2, OH-
Following compounds are given to you:2-Bromopentane, 2-Bromo-2-methylbutane, 1-Bromopentane(i) Write the compound which is most reactive towards SN2 reaction.(ii) Write the compound which is optically active.(iii) Write the compound which is most reactive towards β – elimination reaction
Explain why methyl trifluoroacetate, CF3CO2CH3, is more reactive than methyl acetate, CH3CO2CH3, in nucleophilic acyl substitution reactions.
#B: Methyl acetate has methoxy, -OCH3 as the remaining of the alcohol part in the ester. Isopropyl acetate has isopropoxy, -OCH(CH3)2 as the remaining of the alcohol part in the ester. -OCH(CH3)2 is more electron donating than the methoxy, -OCH3 group due to the presence of two electron-donating -CH3 group in the former. Hence saponification reaction of Isopropyl acetate is much slower than methyl acetate. Hence the rate of saponification of methyl acetate, CH3CCO2CH3 is 50 times greater than that for isopropyl acetate.