Write the empirical formula for at least four ionic compounds that could be formed from the following ions: e3+, Pb**, CN¯, C,H;O,

Iron forms a sulfide with the approximate formula Fe7S8. Assume that the oxidation state of sulfur is 2 and that iron atoms exist in both +2 and +3 oxidation states. What is the ratio of Fe(II) atoms to Fe(III) atoms in this compound?

Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.

Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)

How many moles of ionic species are present in 1.0 L of a solution marked 1.0 M mercury(I) nitrate?

The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate as fuel. A possible reaction is 3Al(s)+3NH4ClO4(s)Al2O3(s)+AlCl3(s)+3NO(g)+6H2O(g) Calculate H for this reaction

Please include parentheses and commas

Dimethyl oxalate, an important pharmaceutical chemical, can be prepared by reacting oxalic acid with methanol. The balanced reaction is shown using line structure representations of the molecules. \table[[Chemical formula:, C,H,O,CH,O,C,H,O,,H,O 2 2 4 4 4 6 4' 2 ง HO Dimethyl oxalate, an important pharmaceutical chemical, can be prepared by reacting oxalic acid with methanol. The balanced reaction is shown using line structure representations of the molecules. H OH + 2 H₂C-OH +2 H₁CO OCH Chemical formula: C₂H₂O CH₂O CHO₁ H₂O Name: oxalic acid methanol dimethyl oxalate water Molar mass: 90.04 g/mol 32.04 g/mol 118.1 g/mol 18.02 g/mol If 91.0 g of oxalic acid and 79.0 g of methanol react to form 89.0 g of dimethyl oxalate, what is the percent yield? percent yield:

Please don't provide handwritten solution.....

3. For each acid, name the anion bonded to hydrogen, then name the acid. Anion Name Acid Name (а) НBr (b) НF (c) H;S (d) HNO; (e) HC10;