Write the expression as the sine, cosine, or tangent of an angle cos 140° cos 50° – sin 140° sin 50°

Q: Evaluate the sine, cosine, and tangent of the angle 11π/4 without using a calculator.

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(1.9) – tan(4.2) 1 + tan(1.9)…

A:

Q: Write the expression as the sine, cosine, or tangent of an angle - sin x cos 2x + cos x sin 2x

A:

Q: Use an Addition or Subtraction Formula to simplify the equation. cos(?) cos(2?) + sin(?) sin(2?) =…

A: cos(x)cos(2x)+sin(x)sin(2x)=22[Formula cos(A)cos(B)+sin(A)sin(B)=cos(A-B)…

Q: State the sum and difference formulas for sine, cosine, and tangent

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 70° cos 5° + cos 70° sin 5°

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(1.1) – tan(4.7) 1 + tan(1.1)…

A: Given expression is, tan(1.1)-tan(4.7)1+tan(1.1)tan(4.7)

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 60° cos 5° + cos 60° sin 5°

A: The following formula is used in solving the given function.

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(7/15) + tan(4z/5) 1 –…

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 3x cos x - cos 3x sin x

A: Given,          sin3xcosx-cos3xsinxWe know that,        sinA-B=sinAcosB-cosAsinB

Q: Use words to describe the formula for, "the sine of double an angle."

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 50° cos 5° + cos 50° sin 5°

A:

Q: Simplify the trigonometric expression: sin B+ cos BcotB 4.

A: Given that: sinB+cosB.cotB

Q: Complete the half-angle identity. sin 스 =

A: To express sin(x/2) in terms of trigonometric ratios of x.

Q: Write the expression (tan π/5 + tan 4π/5)/(1 - tan π/5 tan 4π/5) as the sine, cosine, or tangent of…

A:

Q: Write the trigonometric expression in terms of sine and cosine, and then simplify. csc²(x) – cot?(x)

A: Given, csc2x - cot2x   We have to write the expression in terms of sine and cosine and simplify.…

Q: Write the expression (tan π/5 - tan π/30)/(1 + tan π/5 tan π/30) as the sine, cosine, or tangent of…

A: Formula used: tana+tanb1-tana·tanb=tana+b

Q: Evaluate the sine, cosine, and tangent of the angle without using a calculator. (If an answer is…

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(t/20) + tan(37/5) 1 -…

A: Using the following formulae :- tan(A + B) = (tanA +tanB)/(1-tanA tanB)  sin (A+B)= sinAcosB +…

Q: Write the expression as the sine, cosine, or tangent of an angle tan(7/15) + tan(27/5) 1. -…

A: In this question, following simple equation is used- tan(x+y)= (tanx + tany)/(1-tanx*tany)

Q: Write the expression as the sine, cosine, or tangent of an angle. 3 COS sin)sin() COS - 7

A: Note that: cos x cos y-sin x sin y=cos (x+y)

Q: Write the expression as the sine, cosine, or tangent of an angle. Then find the exact value of the…

A: Here given Use the compound angle formula

Q: Write the expression as the sine, cosine, or tangent of an angle. tan 130° − tan 80°/1 + tan 130°…

A: Using tan(a-b) =tan(a) - tan(b) /(1+tan(a) tan(b)

Q: Write the expression as the sine, cosine, or tangent of an angle. cos 140° cos 20° – sin 140° sin…

A: Given expression is cos140°cos20°-sin40°sin20° we have to write the expression as the sine , cosine…

Q: Which angles have the same sine value? and 3. O T and 3 3 o 4T and 3 - 3 and 3 3

A: As we know that from the trigonometric identities; 1). sinπ+x=-sinx2). sinπ-x=sinx   And 3).…

Q: Use the formula for the cosine of the difference of two angles to find the exact value of the…

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. cos 110° cos 50° - sin 110° sin…

A: Given the expression  Cos 110° Cos 50° - Sin 110° Sin 50°  we need to solve this. As we know that…

Q: Write the expression as the sine, cosine, or tangent of an angle. cos cos - sin sin 5

A: We know that  cosA+B=cosAcosB-sinAsinBA=2π7B=7π5

Q: Use words to describe the formula for:the sine of half an angle.

A: We can easily derive the formula for the sine of half an angle:   Let's use the trigonometric…

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(t/20) + tan(4/5) 1- tan(1/20)…

A:

Q: Use a reference angle to write sin(5π/4) in terms of the sine of a positive acute angle.

A: Given

Q: Write the expression as the sine, cosine, or tangent of an angle. sin(x) cos(8x) + cos(x) sin(8x)

A: Sin (A+B) = Sin A x Cos B + Cos A x Sin B

Q: Write the expression as the sine, cosine, or tangent of an angle. tan(7/12) + tan(47/3) 1- tan(7/12)…

A: Trigonometric identities are relations that hold true for any right triangle. Some of these…

Q: Write sin(275°) in terms of the sine of a positive acute angle. Provide your answer below: sin()

A: In the  IVth quadrant sin(θ) is negative:   Acute angle: it is an angle whose measure is less than…

Q: Write the expression as the sine, cosine, or tangent of an angle. 47T cos 47T sin CoS sin

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 70° cos 10° + cos 70° sin 10°

A: Given expression is sin70° cos10°+cos70° sin10°. To write the expression as the sine, cosine or…

Q: Write the expression as the sine, cosine, or tangent of an angle. tan 120° - tan 80° 1 + tan 120°…

A: Given that

Q: Simplify the expression by using a Double-Angle Formula or a Half-Angle Formula. (a) cos? 38° - sin?…

A: Since you have asked multiple questions in a single request, we would be answering only the first…

Q: Write the expression as the sine, cosine, or tangent of an angle. 6T sin 5. CO COS 7 - sin 7

A: Here we have to use the trigonometric identity

Q: The angle y whose sine is - the square root of 3 divided by 2 and which is in the interval [-?/2,…

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. sin cos 7 cos 5 sin 5

A: Consider the given expression as, E=cos4π7cos7π5-sin4π7sin7π5 Consider the required formulae,…

Q: Write the expression as the sine, cosine, or tangent of an angle. co(즉) Co()-sin(즉) an(쓸) 4л 2л 5

A: The given expression is cos2π7cos4π5-sin2π7sin4π5. Write the expression as the sine, cosine, or…

Q: Write the expression (tan 50° - tan 20°)/(1 + tan 50° tan 20°) as the sine, cosine, or tangent of an…

A: Given:          (tan50∘−tan20∘)(1+tan50∘tan20∘)

Q: Write the expression as the sine, cosine, or tangent of an angle. sin 3 cos 1.2 - cos 3 sin 1.2

A:

Q: sin 5 cos 1.8 - cos 5 sin 1.8

A:

Q: Write the expression as the sine, cosine, or tangent of an angle. tan 24° + tan 22° 1- tan 24° tan…

A:

Fundamentals of Trigonometric Identities

Trigonometric Identities are the equalities that involve trigonometry functions and hold for all the values of variables given in the equation.