(1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction. half-reaction Ag+ (aq) + e-Ag(s) Cr2+ (aq) Cr³+ (aq) + e* identification (2) Write a balanced equation for the overall redox reaction. Use smallest possible integer coefficients. + +

(1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction. half-reaction Ag+ (aq) + e-Ag(s) Cr2+ (aq) Cr³+ (aq) + e* identification (2) Write a balanced equation for the overall redox reaction. Use smallest possible integer coefficients. + +

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 1RQ: What is a half-reaction? Why must the number of electrons lost in the oxidation half reaction equal...

See similar textbooks

Similar questions

For the following half-reactions, answer these questions. Ce4+(aq)+eCe3+(aq)E=+1.61VAg+(aq)+eAg(s)E=+0.80VHg22+(aq)+2e2Hg(l)E=+0.80VSn2+(aq)+2eSn(s)E=0.14VNi2+(aq)+2eNi(s)E=0.24VAl3+(aq)+3eAl(s)E=1.68V (a) Which is the weakest oxidizing agent? (b) Which is the strongest oxidizing agent? (c) Which is the strongest reducing agent? (d) Which is the weakest reducing agent? (e) Will Sn(s) reduce Ag+(aq) to Ag(s)? (f) Will Hg(l) reduce Sn2+(aq) to Sn(s)? (g) Which ion(s) can be reduced by Sn(s)? (h) Which metal(s) can be oxidized by Ag+(aq)?
Why is it not possible for hydroxide ion (OH-) to appear in either of the half-reactions or the overall equation when balancing oxidation—reduction reactions in acidic solution?
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
(a) Rank the following metals in their ability to function as reducing agents: Hg, Sn, and Pb. (b) Which halogens will oxidize mercury to mercury(II)?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The iron content of hemoglobin is determined by destroying the hemoglobin molecule and producing small water-soluble ions and molecules. The iron in the aqueous solution is reduced to iron(II) ion and then titrated against potassium permanganate. In the titration, iron(ll) is oxidized to iron(III) and permanganate is reduced to manganese(II) ion. A 5.00-g sample of hemoglobin requires 32.3 mL of a 0.002100 M solution of potassium permanganate. The reaction with permanganate ion is MnO4(aq)+8H+(aq)+5Fe2+(aq)Mn2+(aq)+5Fe3+(aq)+4H2O What is the mass percent of iron in hemoglobin?
What is a half-reaction? Why must the number of electrons lost in the oxidation half reaction equal the number of electrons gained in the reduction half-reaction? Summarize briefly the steps in the hall-reaction method for balancing redox reactions. What two items must be balanced in a redox reaction (or any reaction)?
Describe what you expect to happen when the following solutions are electrolyzed: a aqueous Na2SO4; b aqueous KBr. That is, what are the electrode reactions? What is the overall reaction?
Four metals, A, B, C, and D, exhibit the following properties: (a) Only A and C react with 1.0 M hydrochloric acid to give H2(g). (b) When C is added to solutions of the ions of the other metals, metallic B, D, and A are formed. (c) Metal D reduces Bn+ to give metallic B and Dn+. Based on this information, arrange the four metals in order of increasing ability to act as reducing agents.