please solve parts 1, 2 and 3 Q1)Choose the right answer in the next questions:1- The compound with 3 electronic transitions in the UV-Visible spectrumd) [Co(en)]la) [Cr(acaac)] b) [Cu(phthalocyanine)] c) [Co(NH₂),CI]Cl₂2- In circular dichroism, CD, a plot is made between:a) n-no and A b) E-E and A c) and A d) n and A3-If two optically active compounds have the same Cotton effect:a) they have the same absolute configuration.b) they have different absolute configurations.c) they are enantiomers.d) they are diasteriomers.4- Which of the following compounds has optical activity?a) [Niclb) Ni(NH₂)₂Cl₂ c) Ni(en),d) [Ni(NH₂)Cl₂]5- Determine the ground state for the ion Ni² in octahedral fields.a. A₂ b. Tc. 'A d. Tax6- The main selection rule in IR spectroscopy:a. spin multiplicity must stay the sameb.gg transitions are not allowedc. the vibrations must change the bond angled. there must be a change in the dipole moment7- The complex with a strong IR peak at around 1600 cm¹:a. trans-[Cr(en),(H₂O), Cl, b. [Cr(NO₂) c. [Co(en)]" d. [Cr(acac)3]02Explain how IR spectroscopy is used to indicate that complexation of aligand with a metal has occurred.

b) [Cu(phthalocyanine)] b) εl.εD and λ a) they have the same absolute configuration

1- The compound with 3 electronic transitions in the UV-Visible spectrum a) [Cr(acaac)] b) [Cu(phthalocyanine)] c) [Co(NH₂),CI]Ch₂ d) [Co(en)]l 2- In circular dichroism, CD, a plot is made between: a) n-no and A b) ErEo and X c) and X d) n and A 3-If two optically active compounds have the same Cotton effect: a) they have the same absolute configuration. b) they have different absolute configurations. c) they are enantiomers. d) they are diasteriomers.

1- The compound with 3 electronic transitions in the UV-Visible spectrum a) [Cr(acaac)] b) [Cu(phthalocyanine)] c) [Co(NH₂),CI]Ch₂ d) [Co(en)]l 2- In circular dichroism, CD, a plot is made between: a) n-no and A b) ErEo and X c) and X d) n and A 3-If two optically active compounds have the same Cotton effect: a) they have the same absolute configuration. b) they have different absolute configurations. c) they are enantiomers. d) they are diasteriomers.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 108IP: a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the...

See similar textbooks

Similar questions

Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following ligands is expected to be monodentate, and which might be polydentate? (a) CH3NH2 (b) CH3CN (c) N3 (d) en (e) Br (f) phen
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
3 You have a neutral, 4-coordinate macrocyclic ligand that binds to Ni(II). When a weakly-coordinating perchlorate ion (CIO4-2) is the anion in solution, it produces a red-colored diamagnetic low-spin d8 complex. When perchlorate is replaced by two thiocyanate ions, (SCN-), the Ni-macrocycle complex turns violet and has two unpaired electrons. Predict what has happened to the geometry and the d-orbital splitting that has resulted in the change in color?
Heating 2.0 mol of a coordination compound gives 1.0mol NH3, 2.0 mol H2O, 1.0 mol HCl, and 1.0 mol(NH4)3[Ir2Cl9]. Write the formula of the original (sixcoordinate) coordination compound and name it.
Part A How many unpaired electrons are in the d orbitals of an octahedral complex of Ru3+ assuming a strong-field complex? Part B How many unpaired electrons are in the d orbitals of an octahedral complex of Rh3+ , assuming a strong-field complex?
The energy of the absorption band in the electronic spectrum of the [Ti(H2O)6]3+ complex is 20300cm-1. This complex is about 32.4 kJ/mol more stable than the [Ti(H2O)4]3+ complex. Show this situation by making the necessary calculations.
1) What role do the protons play in the transformation of [(SALEN)VO] to [(SALEN)Cl2]? --- Consider the number of anionic charges for all the ligands as well as the charge of the overall complex. Has the oxidation of vanadium changed in this reaction?
H2C2O4.2H2O + K2Cr2O7 → K[Cr(C2O4)2(H2O)2].2H2O What is the role of oxalate ion in this reaction other than being a bidentate ligand?
What do CO, ethylene (C2H4), H2, and NO+ ligands all have in common? Group of answer choices they are all in Zeise's Salt they are all liquids they all develop positive charges when coordinated to transition metal centers they are all pi-acceptor ligands