1. At 100 C the equilibrium constant, Kc is 4.6 x 10° for the reaction,CO (g) + Cl₂ (g) = COC1₂ (g).If 0.20 moles of COCl2 is placed in a 10.0 liter container, what is the concentration of all speciesat equilibrium?

Answered: Image /qna-images/answer/8d6766a3-f36d-46ff-8757-a6727560e719.jpg

1. At 100 C the equilibrium constant, K. is 4.6 x 10⁹ for the reaction, CO (g) + Cl₂ (g) = COC1₂ (g). If 0.20 moles of COCl₂ is placed in a 10.0 liter container, what is the concentration of all species at equilibrium?

1. At 100 C the equilibrium constant, K. is 4.6 x 10⁹ for the reaction, CO (g) + Cl₂ (g) = COC1₂ (g). If 0.20 moles of COCl₂ is placed in a 10.0 liter container, what is the concentration of all species at equilibrium?

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 14.51QE

See similar textbooks

Similar questions

The creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their food and aqueous environment, as well as some complex equilibrium processes, a hard calcium carbonate shell can be produced. One important equilibrium reaction in this complex process is HCO3(aq)H+(aq)+CO32(aq)K=5.61011 If 0.16 mole of HCO3 is placed into 1.00 L of solution, what will be the equilibrium concentration of CO32?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The value of the equilibrium constant, K, is dependent on which of the following? (There may be more than one answer.) a. the initial concentrations of the reactants b. the initial concentrations of the products c. the temperature of the system d. the nature of the reactants and products Explain.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Consider the reaction 2N2O(g) + O2(g) 4NO(g) Suppose the system is at equilibrium, and then an additional mole of N2O(g) is injected into the system at constant temperature. Once the reaction reestablishes equilibrium, has the amount of N2O increased or decreased from its original equilibrium amount? Explain. What happens to the value of the equilibrium constant with this change?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?