1. Balance this equation and determine how many molecules of Ag2CO3(s) are produced if 20 molecules of Na2CO3 are reacted. Na2CO3(aq) + AGNO3(aq) → NaN0;(aq) + A92CO3(s) 8. Balance each equation. a. NH4NO3 –→ N2O + H2O b. TiBr4 + H2O → TiO2 + HBr c. C3H5N3O9 → CO2 + N2 + O2 + H2O

1. Balance this equation and determine how many molecules of Ag2CO3(s) are produced if 20 molecules of Na2CO3 are reacted. Na2CO3(aq) + AGNO3(aq) → NaN0;(aq) + A92CO3(s) 8. Balance each equation. a. NH4NO3 –→ N2O + H2O b. TiBr4 + H2O → TiO2 + HBr c. C3H5N3O9 → CO2 + N2 + O2 + H2O

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter3: Molecules, Moles, And Chemical Equations

Section: Chapter Questions

Problem 3.14PAE: 3.14 A number of compounds are used in cement, and reactions among them occur when water is added....

See similar textbooks

Related questions

Q: How to balance this chemical equation? KO2(s) +H2O(l) ----> KOH(aq) + O2(g) + H2O2

A: Balanced chemical equation of a reaction is written according to law of conservation of mass. Thus,…

Q: The following change occurs in acidic solution: ____ S2–(aq) + ____ Cr2O72–(aq) → ____ S(s) + ____…

A: The given reaction is,

Q: Which equation below is the balanced molecular equation for the reaction of potassium chloride with…

Q: Consider the unbalanced equation for the neutralization of acetic acid:…

A: Neutralization reaction is defined as the reaction between acid or base to form salt and water. The…

Q: Balance the following equations. 1. AgCH3COO(aq) + NH4Cl(aq) -----> AgCl(s) + NH4CH3COO(aq)

A: Since you have posted a question with sub-parts , we are entitled to answer the first three…

Q: 63: Consider the reaction between NiS2 and O2: 2NIS2(s) + 502(g) -> 2NIO(s) + 4SO2(8). When 11.2 g…

Q: used to scrub SO2 gas from the exhaust gases of powerplants. One possible reaction gives hydrated…

A: Spontaneity of a reaction is determined by the gibbs free energy change of a reaction. The word…

Q: Which equation or half equation is balanced? Select one: a. 4Fe3+ + 2NH3OH+ → N2O + H2O +…

A: To get the Balanced chemical equation , we have to see the number of different atoms on the both…

Q: 1. Balance the following reaction: Cr + O2 -> CrO3

A: Cr + O2 -> CrO3 after the balancing this equation :

Q: According to the balanced chemical equation 5 H2C2O4(aq) + 2 MnO4-(aq) + 6 H+(aq) 10 CO2(g) + 2…

A: We have to calculate the volume of MnO4- required.

Q: KCI H2 + F2 HF 9. Fe + O2→ Fe:O4 10. Mg + HCI → MgCl2 8. +. + H2

A: 4 reactions are given . We have to balance them and identify the type of reaction . When two species…

Q: Balance the following reactions: a) Mg + N2 + MgsN2 PCes + H20 + H3PO4 + HCe Al + FesO4+ Al,O3+ Fe…

A: Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: 17. When aluminum reacts with hydrochloric acid, the predicted products would be (you do not n to…

A: Dear student, since the given question is a multiple question ,hence I solved first three question .

Q: he following series of reactions were carried out. PbCO3(s) +2HNO3(aq) ---> Pb(NO3)2(aq)…

A: The balanced equations are PbCO3(s) +2HNO3 (aq) ---> Pb(NO3)2 (aq) +H2O (l)+CO2 (g) Pb(NO3)2(aq)…

Q: What is the coefficient of oxygen in the balanced chemical equation? FeS2 + O2 --> SO2 + Fe2O3

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: When the following equation is completed and balanced, what is/are the product(s)?…

A: Balanced reaction:

Q: In the textile industry, chlorine is used to bleach fabrics. Any of the toxic chlorine that remains…

A: Given data: The mass of Na2S2O3 is 138.96 kg=138960 g. The mass of Cl2 is 52.72 kg=52720 g. Given…

Q: Pb(C2H3O2)2(aq) + H2O(l)+CO2(g)---PbCO3(s)+HC2H3O2(aq) suppose a aqueous solution containing 1.40…

A: Mass of lead (II) acetate = 1.40 g Mass of carbon dioxide = 5.80 g Molar mass of lead (II) acetate…

Q: C. Single Replacement reactions Reactants Products AGNO3 + Cu Balanced equation: Copper (II) nitrate…

A: (A) Combination reaction is a reaction where two or more reactant join together to form a product.…

Q: Section 5.3 Relationships in Balanced Chemical Reactions 1 Write all possible mole ratios for the…

Q: alculate the theoretical yield of (in grams) of Ca3(PO3)2 when 7.15 g of calcium hydroxide reacts…

A: The balanced equation is: 3Ca(OH)2 + 2H3PO4 → 6H2O + Ca3(PO3)2 The given mass of Ca(OH)2 = 7.15 g…

Q: Constants Penodic Table Lakes that have been acidified by acid rain ( HNO, and H2SO4) can be…

A: Molarity :- The number of moles of solute dissolved in one litre of solution is defined as molarity…

Q: ABS plastic is a polymer consisting of three monomer units: acrylonitrile (CsHsN), butadiene (C&H6),…

A: Let the mass of the ABS plastic be 100 g. Mass of nitrogen in the ABS plastic = 11.9 g So, moles of…

Q: b To make NaTcO4, the metal is dissolved in nitric acid 7 HNO3 (aq) + Tc(s) → HTCO4(aq) + 7 NO2(g) +…

A: The question is based on the concept of chemical reactions. we have to write chemical equation for…

Q: a. Balance the equation given below. Li2S2O3 +Br2 - LiBr +LiS4O6 B. Write the product of each of the…

A: The answer to the following questions is-

Q: ‍‍‍‍‍‍‍‍‍‍‍‍S₈(s)+Na₂So₃(aq)+H₂O(℩)→Na₂S₂O₃·5H₂)(s) (unbalanced) What is the theoretical yield of…

A: The theoretical yield of a substance is the expected yield that is found by calculation using the…

Q: Balance each of the following chemical equations, and identify the type of reaction: a). TiCl4(s) +…

A: a) The balanced equation can be written as, TiCl4(l) + 2Mg(s) -------> Ti(s) + 2MgCl2(s) It is a…

Q: Consider the reaction of zinc metal with hydrochloric acid, HCl(aq). Zn(s) + 2 HCl(aq) --> H2(g) +…

A: Balanced chemical equation: Zn(s) + 2 HCl(aq) ----> H2(g) + ZnCl2(aq) From the above equation:…

Q: The solubility of nitrates of alkali metals in water is C a. LiNO3< KNO3 < NaNO3 < FrNO3…

A: "Like dissolves like" is the thumb rule for dissolution of solute in solvent. This means covalent…

Q: person’s

A: We will use stoichiometry of the reaction to get the answer

Q: How to balance this equation? NH3(g) + O2(g) ----> NO(g) + H2O

A: The reaction is balanced by making the number of elements of each atom equal on left side and right…

Q: In certain reaction Fe and O2 combine to form irom(III) oxide. 18.1 moles of Fe and 12.4 mole of O2…

A: Given, moles of Fe = 18.1 moles Moles of O2 = 12.4 moles First we find the limiting and the excess…

Q: 4. HCI (aq) + Ba(NO3)2 (aq) 5. HCI (aq) + HNO3 (aq) 6. Pb(NO3)2 (aq) + H2SO4 (aq) 7. Pb(NO3)2 (aq) +…

A: Simce you have posted multiple questions in a single session. we are entitiled to answer only first…

Q: Write the balanced equation for the following reactions a. C6H10(g) + O2(g) ⟶⟶ CO2(g)…

A: Solution- Above unbalanced equations with balanced is given below- a. 2 C6H10(g) + 17 O2(g)…

Q: One of the stages in obtaining iodine from oil brines is the conversion of aqueous iodide (as FeI2)…

A: The physical states of the reactants and products are ;

Q: Which of the following represent the balanced equation between calcium carbonate dihydrate and…

A: The Law of Conservation of Mass states that the mass of the reactants must balance the mass of the…

Q: What mass of FeS is required to produce 87g Fe2O3 with excess O2 by this reaction 4FeS + 7 O2 —>…

Q: Balance these chemical equations (Use the lowest possible whole number coefficients, and enter 1 if…

A: We have to predict the balance chemical reaction

Q: Hydrofluoric acid, HF(aq), cannot be stored in glass bottlesbecause compounds called silicates in…

Q: 1. Which is TRUE for the equation (NH4)2SO4? The equation is balanced. The total mass of the product…

A: Balanced chemical equation is the equation in which equal number of atoms of every element are…

Q: How to balance this chemical equation? Br2(g) + H2O(l) + SO2(g) ------> HBr(aq) + H2SO4(aq)

A: A balanced chemical equation is an equation which contains same elements in same number on both the…

Q: Acid rain is rain that has a relatively high amount of sulfuric acid in it. This sulfuric acid is…

Q: A piece of magnesium with a mass of 0.0501 grams was placed into a solution containing an excess of…

A: Magnesium reacts with hydrogen chloride to form magnesium chloride and hydrogen gas. The equation…

Q: Al2O3 + 2Fe -------> Fe2O3 + 2Al How many moles of Iron (III) oxide is produced from if 8.2…

Q: Balance the following equation by filling the gaps with appropriate numbers. OHgCl2 Hg + ICI → + H2

Q: In this experiment, magnesium metal is heated until it reacts with oxygen in the air according to…

A: Given information: Mass of crucible + cover =18.500 g Mass of crucible + cover + Mg = 18.702 g Mass…

Q: Antimony is produced by heating powdered antimony trisulphide with iron and removing the molten…

A: Limiting reactant is one that gets exhausted on completion of reaction. It is present in less than…

Q: 6. NaBr + Cl2 → NaCl + Br2 7. Fe203 + CÓ → Fe + CO2 8. CO + I2O5 → CO2 + I2 9. 2 Fe3* (aq) + Sn2+ →…

Q: . Balance the following reactions: H2SO4(aq) Sr(OH)2(aq) H20 (I) + -> + SrSO.(s) P4010 (s) H20 (1)…

Question

7. Balance this equation and determine how many molecules of Ag2CO3(s) are produced if
20 molecules of Na2CO3 are reacted.
Na2CO3(aq) + AgNO3(aq) → NaN0;(aq) + A92CO3(s)
8. Balance each equation.
a. NH4NO3
N20 + H2O
b. TiBr4 + H2O → TiO2 + HBr
c. C3H5N3O9→ CO2 + N2 + O2 + H2O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.
Aqueous hydrogen fluoride (hydrofluoric acid) is used to etch glass and to analyze minerals for their silicon content. Hydrogen fluoride will also react with sand (silicon dioxide). (a) Write an equation for the reaction of solid silicon dioxide with hydrofluoric acid to yield gaseous silicon tetrafluoride and liquid water. (b) The mineral fluorite (calcium fluoride) occurs extensively in Illinois. Solid calcium fluoride can also be prepared by the reaction of aqueous solutions of calcium chloride and sodium fluoride, yielding aqueous sodium chloride as the other product. Write complete and net ionic equations for this reaction.
4.47 Silicon carbide is, an abrasive used in the manufacture of grinding wheels. A company is investigating whether they can be more efficient in the construction of such wheels by making their own SiC via the reaction SiO2+3CSiC+2CO (a) If this reaction consistently has a yield of 85%, what is the minimum amount of both silicon dioxide and carbon needed to produce 3400 kg of SiC for the manufacture of cutting wheels? (b) The silicon dioxide is to he obtained from sand and the carbon is derived from coal. If the available sand is 95% SiO2 by weight and the coal is 73% C by weight, what mass of coal is needed for each metric ton of sand used?
Magnesium metal (a component of alloys used in aircraft and a reducing agent used in the production of uranium, titanium, and other active metals) is isolated from sea water by the following sequence of reactions: Mg2+(aq)+Ca(OH)2(aq)Mg(OH)2(s)+Ca2+(aq)Mg(OH)2(s)+2HCl(aq)MgCl2(s)+2H2O(l)MgCl2(l)electrolysisMg(s)+Cl2+Cl2(g) Sea water has a density of 1.026 g/cm3 and contains 1272 parts per million of magnesium a5 Mg2+(aq) by mass. What mass, in kilograms, of Ca(OH)2; is required to precipitate 99.9% of the magnesium in 1.00103 L of sea water?
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
3.93 Adipic acid is used in the production of nylon, so it is manufactured in large quantities. The most common method for the preparation of adipic acid is the reaction of cyclohexane with oxygen. Balance the skeleton equation shown be1ow.
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
On Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?
ABS plastic is a tough, hard plastic used in applications requiring shock resistance. The polymer consists of three monomer units: acrylonitrile (C3H3N), butadiene (C4H6), and styrene (C8H8). a. A sample of ABS plastic contains 8.80% N by mass. It took 0.605 g of Br2 to react completely with a 1.20-g sample of ABS plastic. Bromine reacts 1: 1 (by moles) with the butadiene molecules in the polymer and nothing else. What is the percent by mass of acrylonitrile and butadiene in this polymer? b. What are the relative numbers of each of the monomer units in this polymer?