1. Consider the following reaction: CO:(g) + CCl (g) → 2COCL(g) a. Calculate the standard Gibbs free energy change at 298 K using the formation free energies in your textbook. b. Calculate AG for this reaction at 298 K under the following conditions. P(CO2 g) = 0.112 atm P(CCla g) = 0.174 atm P(COCI2 g) = 0.744 atm %3D %3D

1. Consider the following reaction: CO:(g) + CCl (g) → 2COCL(g) a. Calculate the standard Gibbs free energy change at 298 K using the formation free energies in your textbook. b. Calculate AG for this reaction at 298 K under the following conditions. P(CO2 g) = 0.112 atm P(CCla g) = 0.174 atm P(COCI2 g) = 0.744 atm %3D %3D

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter16: Spontaneity Of Reaction

Section: Chapter Questions

Problem 83QAP

See similar textbooks

Similar questions

What is the standard free energy change, G, for a reaction? What is the standard free energy of formation, Gf for a substance? How are Gf values used to calculate Grxn? How can you use Hesss law to calculate Grxn? How can you use H and S values to calculate Grxn? Of the functions H, S, and G, which depends most strongly on temperature? When G is calculated at temperatures other than 25Cwhat assumptions are generally made concerning H and S?
At 298 K, G = 70.52 kJ for the reaction 2NO(g) + O2(g) 2NO2(g) (a) Calculate _G at the same temperature when PNO = 1.0 104 atm, PO2=2.0103 atm, and PNO2=0.30 atm. (b) Under the conditions in part a, in which direction is the reaction spontaneous?
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
Many plastic materials are organic polymers that contain carbon and hydrogen. The oxidation of these plastics in air to farm carbon dioxide and water is a spontaneous process; however, plastic materials tend to persist in the environment. Explain.
Consider the decomposition of red mercury(II) oxide under standard state conditions.. 2HgO(s,red)2Hg(l)+O2(g) (a) Is the decomposition spontaneous under standard state conditions? (b) Above what temperature does the reaction become spontaneous?
A reaction has H298=100 kj/mol and S298=250 J/mol K. Is the reaction spontaneous at room temperature? If not, under what temperature conditions will it become spontaneous?
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
In a spontaneous process, S(universe) is (a) 0 (b) = 0 (c) 0
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
The decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?
What is the third law of thermodynamics? What are standard entropy values, S, and how are these S values (listed in Appendix 4) used to calculate S for a reaction? How would you use Hesss law to calculate S for a reaction? What does the superscript indicate? Predicting the sign of S for a reaction is an important skill to master. For a gas-phase reaction, what do you concentrate on to predict the sign of S? For a phase change, what do you concentrate on to predict the sign of S? That is, how are Ssolid, Sliquid, and Sgas related to one another? When a solute dissolves in water, what is usually the sign of S for this process?