Answered: 1. Given the structure below, give the…

1. Given the structure below, give the complete name of the following peptide 2. Write the name of the peptide above using the one-letter symbol.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter7: Covalent Bonding

Section: Chapter Questions

Problem 38QAP

See similar textbooks

Related questions

Q: Draw the formula of each of the following tripeptides: (a) Lysine- phenylalanine- threonine (b)…

A: (a) The given tripeptide is Lysine-Phenylalanine-Threonine. The tripeptide Lys-Phe-Thr is formed by…

Q: The above is the structure of a ___ pentapeptide? Basic Acidic Neutral

A: The above pentapeptide structure is basic.

Q: Answer the questions in the table below about this molecule: - CH2 -C-NH-CH -C-NH-CH-COO CH2 CH2 OH…

A: The question is based on the concept of biomolecules. we have to identify the type of compound…

Q: Which labeled bond in the following molecule is known as the peptide bond?

A: The amino acids can be defined as the organic compound containing both amino and carboxylic groups…

Q: What amino acid is at the N-terminus of the following peptide? CO2 H3N

A: Given : Peptide chain To find : Amino acid present at N terminus Solution: Amino acids are those…

Q: Draw the structure of alanine. Draw the structure of Phenylalanine. Now draw them as a dipeptide

Q: Write the structures of the peptides given below. 1. Pro-His-Ala 2. Met-Cys-Tyr

A: A peptide bond is an amide-type bond between two amino acids. An amino acid contains amino and…

Q: Explain the process of protein de maturation with an appropriate example

A: Biomolecules can be defined as the molecules which are involved in different biochemical reactions…

Q: Highlight each peptide bond in the molecule below. In addition, list the common names of the smaller…

A: We have to identify peptide bond and give the product on hydrolysis of given peptide

Q: an amino acid in its zwitterionic form.

A: Note: Since you have posted multiple independent questions in the same request, we will solve the…

Q: What type of bond is broken when peptides undergo hydrolysis?

A: Proteins are polymers of alpha-amino acids and these amino acids are linked with each other through…

Q: What is a peptide bond? explain in detail.

A: A peptide bond is formed by a dehydration synthesis or reaction at a molecular level. In the…

Q: Dehydration synthesis always results in the formation of which of the following? A. Peptides…

A: The dehydration synthesis has to be mentioned

Q: III. Identify the amino acids in this peptide

Q: Vancomycin, as shown in the figure contains all the proteinogenic amino acids and sugar moieties

A: Vancomycin is an amphoteric Glycopeptide antibiotic.It inhibit the cell wall formation of

Q: Select the correct option(s) regarding denaturation of proteins.

A: All statements are correct

Q: 1. How many peptide bonds does each of the oligopeptides in the figure above contain? (a) (b) 2.…

Q: What is the name of this Amino Acid?

A: The given compound is Asparagine(Asn) which is an α-amino acid. It contains an α-amino group (-NH2),…

Q: What is the name of this amino acid

Q: 1) Identify the common scaffold to all ten amino acids. How does this scaffold compare to a peptide…

A: "Since there are multiple questions and it is not mentioned that which one has to be solved so I am…

Q: How many peptide bonds are present in each of the molecules in the problem 20.62?

A: The peptide bond occurs between carboxyl group in an amino acid and another amino molecule.…

Q: Amino acid structure and composition: Assuming physiological pH conditions, draw the peptide…

A: Answer: 1. The peptide chain is positively charged at physiological pH due to the side chain of…

Q: Consider the peptide structure shown in the figure, below. List a set of six atoms in the structire…

A: When some amino acids are linked with each other in a particular sequence by peptide bonds (-CONH-),…

Q: Draw the structure of the following molecules The dipeptide resulting from the amino acid sequence:…

A: here two amino acid is given, A peptide bond formed between two amino acid by loss of water molecule…

Q: Why is knowing the protein sequence important?

A: Sequencing protein is important due to the following reasons.

Q: There are four amino acids shown in this problem: two are on this page, and two are on the following…

A: We are given 4 different amino acids in 3D diagram through ball and stick model. In ball and stick…

Q: Give the complete name of the peptide below

A: Amino acid have amine group and carboxylic acid and have different side chain R

Q: Draw the formula of the following: a. Lysine- phenylalanine-threonine b. Alanine-leucine-valine…

A: an amino acid has two group the acidic COOH group and basic NH2 group general formula NH2 CH(R)-COOH…

Q: Question 3. Draw the structure of the following peptide as it would be at pH = 7. Does the molecule…

A: Protein are essential biomolecules for living, which are made of a number of amino acids.…

Q: c. What is the pI of the peptide

A: you are asking only part c The isoelectric point (pI) of a protein, peptide, or any other…

Q: lentify the peptide bond in the following

A: A peptide bond is an amide-type bond between two amino acids. An amino acid contains amino and…

Q: Draw the dipeptide that results when a peptide bond is formed between the two glycine molecules…

A: The structure is given below -

Q: Consider the structure of the peptide below. Name it using the three-letter abbreviation.…

A: Amino acids can be defined as the organic compound containing an amino group and carboxylic group.…

Q: What is the correct one letter symbol for the following amino acid? HO, NH2

A: Given here a structure of an amino acid and we are aksed to write the correct one letter symbol of…

Q: How many peptide bonds are in this peptide? (Just write the number or none) H. N- H,N-

A: Peptide bond is formed by the condensation reaction between a carboxylic group of one amino acid and…

Q: Shown below is the structure of a polypeptide. There are [Select] and [Select] H₂N peptide bonds in…

Q: Draw the structure of peptide with the followi

A: Peptide bond : This bond is formed by a chemical reaction between two amino acids Carboxylic…

Q: What are peptide bonds?

A: Protein are the polymers of amino acids. Peptides are formed when amino acids combine with…

Q: Part A. Draw the peptide formed between asparagine and histidine. Part B Fill out the…

Q: Which of the following compounds is not an amino acid?

Q: Combining the amino acids proline and cysteine could create the peptide prolylcysteine A) True B)…

A: A) True

Q: Draw the tetrapeptide Phe-Pro-Met-Gln. Put an X on all the peptide bonds. Circle all the chirality…

Q: How long is a fully extended peptide chain that contains the same number of amino acids?

A: An alpha helix is a common shape of an amino acid which is formed by amino acids chain linked…

Q: Refer to the structure of (S)-(-)-Serine below

A: Serine is amino acid dextro and levo properties are optical properties

Q: For the two dipeptides that can result from the reaction between switterions of the amino acid and…

Q: draw

A: Ala : Alanine Glu : Glutamic acid Cys : Cysteine

Question

1. Given the structure below, give the complete name of the following peptide

2. Write the name of the peptide above using the one-letter symbol.

H
H
H.N.
соон
N.
CH
CH, CH;SCH,
H
но
2-H

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Hi! Are tou sure it's not [H2O] / [CO] [H2] ?
part: 6a: g,h,i
hat is meant by the term driving forces? Why are mailer spread and energy spread considered to be driving forces?
Explain- Conversion of RCOOH to RCOOR' ?
1. Please explain how an FTIR works 2. Why it's so important and useful for organic chemistry
SOURCE: GENERAL ORGANIC AND BIOLOGICAL CHEMISTRY by Smith 4th Edition
why do you have -k2 in the L.H.S and -(-w)2 in the R.H.S ?
1. _________ FeBr3 + ______H2SO4 -----> _____Fe2(SO4)3 + ____HBr Show work on how you solve this.
Compund C12H22O11 find %C, %H, and %O
HOCI HF HCN H₂SO4 HOBr 2.29 x 10-8 O 2.30 K₂= 3.510-8 O 1.17 x 108 O 1.45 x 10-7 K₂ = 7.2 10-4 K₂ = 4.010-10 K₁ = very large K₂ = 1.2 10-2 Ka = 2.5210-⁹ (COOH)2 CH3COOH C6H5NH2 NH3 K₁ = 5.9 x 10-² K₂ = 6.4 x 10-5 K₂ = 1.8 x 10-5 Refer to Equilibrium Constants. What is the [H3O+] of a solution that is 0.0100 M in HOCland 0.0300 M in NaOCI? Kb = 4.2 x 10-10 Kb = 1.8 x 10-5
Dot and cross diagram for carbon monoxide and tell me whhat the cross meaan and dot and why its that way many thanks
C6H12O6(s)→C3H6O3(s)+C2H5OH(l)+CO2(g) Calculate ΔH∘rxn