1. Provide the IUPAC name of the following compounds: CH3 CH3-C-CH2-CH3 CH3

Can you explain the IUPAC name that best helps understand Chloroacetophenone structure?

Can someone help me find the IUPAC for (CH3CH2)3CCH2CH3? I think the longest carbon chain is 9 (nonane) but I'm probably wrong.

Give the IUPAC name for following compound.       CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2

Provide IUPAC names for the following compounds.(a) (CH3)2CHCH2CH3                          (b) CH3¬C(CH3)2¬CH3

Draw all possible constitutional isomers for C2H6O and give common and IUPAC names for each structure.

For Tylenol (Acetaminophen), what is the primary and secondary carbon? Any enantiomers? (R and S)

1. Complete the following diagram so that it represents (R)-2-bromobutane.

3. Write the IUPAC names of the following compounds   1.CH3CH2CH2CH2OH 2. CH3 -O- CH2CH3

Write the IUPAC name of the following: CH3— CH2 — CHO