1. The melting point of water is 0°C at 1 atm pressure because under these conditions a. 4S for the process H₂O(s) →H₂O(l) is positive. b. 4S and 4Ssurr for the process H₂O(s) →H₂O(l) are both positive. c. 4S and 4Ssurr for the process H₂O(s) →H₂O(1) are equal in magnitude and opposite in sign. d. 4G is positive for the process H₂O(s) →→→H₂O(1). e. None of these is correct.

1. The melting point of water is 0°C at 1 atm pressure because under these conditions a. 4S for the process H₂O(s) →H₂O(l) is positive. b. 4S and 4Ssurr for the process H₂O(s) →H₂O(l) are both positive. c. 4S and 4Ssurr for the process H₂O(s) →H₂O(1) are equal in magnitude and opposite in sign. d. 4G is positive for the process H₂O(s) →→→H₂O(1). e. None of these is correct.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 20Q: The melting point for carbon diselenide (CSe2) is 46C. At a temperature of 75C, predict the signs...

See similar textbooks

Similar questions

For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
What determines Ssurr for a process? To calculate Ssurr at constant pressure and temperature, we use the following equation: Ssurr = H/T. Why does a minus sign appear in the equation, and why is Ssurr inversely proportional to temperature?
The free energy change, G, for a process at constant temperature and pressure is related to Suniv and reflects the spontaneity of the process. How is G related to Suniv? When is a process spontaneous? Nonspontaneous? At equilibrium? G is a composite term composed of H, T, and S. What is the G equation? Give the four possible sign combinations for H and S. What temperatures are required for each sign combination to yield a spontaneous process? If G is positive, what does it say about the reverse process? How does the G = H TS equation reduce when at the melting-point temperature of a solid-to-liquid phase change or at the boiling-point temperature of a liquid-to-gas phase change? What is the sign of G for the solid-to-liquid phase change at temperatures above the freezing point? What is the sign of G for the liquid-to-gas phase change at temperatures below the boiling point?
Silver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.
A reaction has H298=100 kj/mol and S298=250 J/mol K. Is the reaction spontaneous at room temperature? If not, under what temperature conditions will it become spontaneous?
Chemists and engineers who design nuclear power plants have to worry about high-temperature reactions because it is possible for water to decompose. (a) Under what conditions does this reaction occur spontaneously? 2H2O(g) 2H2(g) + O2(g) (b) Under conditions where the decomposition of water is spontaneous, do nuclear engineers have to worry about an oxygen/hydrogen explosion? Justify your answer.
For the process H2O(l)H2O(g) at 298 K and 1.0 atm, H is more positive than E by 2.5 kJ/mol. What does the 2.5 kJ/mol quantity represent?
Indicate whether the following processes are spontaneous or nonspontaneous. (a) Liquid water freezing at a temperature below its freezing point (b) Liquid water freezing at a temperature above its freezing point (c) The combustion of gasoline (d) A ball thrown into the air (e) A raindrop falling to the ground (f) Iron rusting in a moist atmosphere
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
Why is it usually easier to use G to determine the spontaneity of a process rather than Su ?
Impure nickel, refined by smelting sulfide ores in a blast furnace, can be converted into metal from 99.90% to 99.99% purity by the Mond process. The primary reaction involved in the Mond process is Ni(s)+4CO(g)Ni(CO)4(g) a. Without referring to Appendix 4, predict the sign of S for the above reaction. Explain. b. The spontaneity of the above reaction is temperature-dependent. Predict the sign of Ssurr, for this reaction. Explain c. For Ni(CO)4(g), Hfo=607KJ/mol and S = 417 J/K mol at 298 K. Using these values and data in Appendix 4, calculate H and S for the above reaction. d. Calculate the temperature at which G = 0 (K = 1) for the above reaction, assuming that H and S do not depend on temperature. e. The first step of the Mood process involves equilibrating impure nickel with CO(g) and Ni(CO)4(g) at about 50C. The purpose of this step is to convert as much nickel as possible into the gas phase. Calculate the equilibrium constant for the above reaction at 50.C. f. In the second step of the Mood process, the gaseous Ni(CO)4 is isolated and heated to 227C. The purpose of this step is to deposit as much nickel as possible as pure solid (the reverse of the preceding reaction). Calculate the equilibrium constant for the preceding reaction at 227C. g. Why is temperature increased for the second step of the Mood process? h. The Mond process relies on the volatility of Ni(CO)4 for its success. Only pressures and temperatures at which Ni(CO)4 is a gas are useful. A recently developed variation of the Mood process carries out the first step at higher pressures and a temperature of l52C. Estimate the maximum pressure of Ni(CO)4(g) that can be attained before the gas will liquefy at 152C. The boiling point for Ni(CO)4 is 42C and the enthalpy of vaporization is 29.0 kJ/mol. [Hint: The phase change reaction and the corresponding equilibrium expression are Ni(CO)4(l)Ni(CO)4(g)K=PNi(CO)4 Ni(CO)4(g) will liquefy when the pressure of Ni(CO)4 is greater than the K value.]
A key component in many chemical engineering designs is the separation of mixtures of chemicals. (a) What happens to the entropy of the system when a chemical mixture is separated? (b) Are designs for chemical separation more likely to rely on spontaneous or nonspontaneous processes?