100 mL of 0.1 M NaOH solution was poured into 20 mL of 0.2 M H2SO4 solution and mixed well.  What was the final pH of the mixture? (a)   pH =1.00               (b) pH= 1.08              (c)pH=12.0               (d)pH=1.80             (e)pH = 12.2

Q: What is the pH of a .100M CH3COOH(aq) solution?

A: Acetic acid is a weak acid, it does not dissociate completely but exists in equilibrium with acetate…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 5.3 × 10⁻⁴ M, then [OH⁻] is:

A: Given [H3O+] = 5.3*10^-4 M  Kw = [ H3O+][OH-]

Q: In the atoms of an aqueous 1 M solution of NaCl, are there ony Na+ions and Cl-ions present?

A: Aqueous NaCl solution means , NaCl solution in water. If water is solvent then the solution is…

Q: What is the pH of a 0.590 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: Given the concentration of [OH-} = 1.7 x 10 -9,  What is the pH?

A: The pH of any solution is given by  pH = 14 + log[OH- ] where [OH- ] = concentration of OH- ions in…

Q: It Senwater has a pH of 8.45, then what is the LOH]? ot

A:

Q: Given that the pH of a solution is 6.7, what is the [H3O+]?

A: Since pH = -log[H3O+]

Q: Write the balanced molecular equation for the neutralization reaction between HIHI and…

A: When an acid and base reacts with each other to form salt and water and involves H+ and OH- ions in…

Q: What is the pH of a 0.720 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca1OH22?

A: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca(OH)2?

Q: What is the pH of a 0.650 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: Write a net ionic equation for the reaction of the following. (a) HOBR and NaOH (b) HOAC and NH3 (c)…

A: The net ionic reaction represents the effective ions undergoing the reaction to form product by…

Q: The pH of a lime is 1.90. What is the [H3O*]?

A: Power of hydrogenpH value indicates the acidic and basic nature of a solution. pH ranges between 0…

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 1.3 × 10⁻⁴ M, then [OH⁻] is:

A: [OH-] = 7.7 x 10-11 M

Q: The odor of vinegar isdue to the presence of acetic acid.CH.COH, a weak acid Which of the following…

A: Given: Concentration of acetic acid in the solution = 1 M. And the solvent is water.

Q: The pH of a 0.0040 M solution of HNO₃ is

A: The concentration of HNO3 is 0.0040M HNO3 is a monobasic acid. So, 1 mol HNO3 after dissociation…

Q: 2. The pH of a lime is 1.90. What is the [H3O*]?

A: pH is negative log of Proton concentration.

Q: n, what is the molarity of the acetic acid, CH;COOH?

A:

Q: Complete the equation for the reaction of NaHCO3(s) with HC2H3O2(aq). Include phase symbols.

A: Given,

Q: What is the pH of a 0.0760 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: Given salt is a mixture of W.B + SA  HONH3Cl it undergo salt hydrolysis  It's  pH = 7 - 1/2(pkb +…

Q: What is the pH of a 0.870 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Answer:- This question is answered by using the simple concept of hydrolysis of the salt formed by…

Q: The pH of a 0.0031 M solution of HNO, is 3

A:

Q: The pH of a solution of HBr was 2.633. What was the hydronium ion concentration?

A: pH =  - log(H+)

Q: At the freezing point of water, Kw = 1.2 x 1015, What is the pH of ice water?

A:

Q: 3. If 0.3041 g of a diprotic solid acid is neutralized by 35.45 mL of 0.0997 M NaOH, calculate the…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: Given that the pH is 10.285 What is the: [H3O+] pOH [OH-] Is it an acid or base?

A: It is given that the pH of a solution is 10.285 and the [H3O+], the pOH and [OH-] needs to be…

Q: What is the pH of a 0.510 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Given information: Concentration of solution = 0.510 M

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 6.7 × 10⁻⁴ M, then [OH⁻] is

A: In an aqueous solution [H₃O⁺] ×   [OH⁻]  = Kw

Q: The pH for a solution with a [H3O]+ of 1.0 x 10^-6 is

A:

Q: A study of the acid shows that the pH of an acid HA O.12 MIK2.62. What is the K, of this acid?

A: Acid Dissocaition constant, Ka has to be determined for the Acid HA of 0.12 M with pH 2.26.

Q: For  K w, the product of [H 3O +] and [OH -] is

A: Kw is the water constant and is defined as product of hydronium ion and hydroxyl ion  Kw = [H3O+]…

Q: In the following reaction, A* (aq) + H20 (0) → HOA (aq) + H* (aq), which is the conjugate base of…

A:

Q: ) What is the pH of a solution of 0.626 M of a weak base if K, = 3.2x10-³? (Assuming X is very…

A:

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 6.2 × 10⁻⁴ M, then [OH⁻] is:

A: pH +pOH = 14

Q: What is the pH of a 0.380 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of a 0.330 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)

A: Given : Concentration of C₅H₅NHBr = 0.330 M And Kb of C₅H₅N = 1.7 X 10-9  Since the salt C₅H₅NHBr is…

Q: 4) Acid react with base to form Salt and---- O a. Acid O b. NaCl Oc. Base O d.Water

A:

Q: What is the degree of ionization (i) for H₂SO₄(aq)?

A: H2SO4 is a strong acid.

Q: In an aqueous solution at 25°C, if [H₃O⁺] = 1.1 × 10⁻⁴ M, then [OH⁻] is:

A: We know that  Kw  for water  =  10-14 at 25oC Given [H3O+] concentration is 1.1×10-4 M      [ OH-] =…

Q: What is the pH of a 0.0380 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: pH = 3.73

Q: If the concentration of [H30+] = 4.2 x 10-5, what is the pH of the solution?

A: pH is a measure of acidity or basicity of the solution. The lesser the pH of a substance, the more…

Q: Chemists working with fluorine and its compounds some- times find it helpful to think in terms of…

A: (a) would the acid in this system be the fluoride donor or fluoride exceptor  (b) Identify the acid…

Q: What is the pH of a 0.500 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: If pH = 5.7, what is [OH ] ?

A: Given a PH = 5.7  Calculate the [OH-] concentration.    calculate the [OH-] of first of calculate…

Q: The pH of a 0.0080 M solution of HNO₃ is

A:

Q: 2. How many grams of MgCl2 will be produced if 250 mL of 0.23 M Mg(OH), reacts with excess HCl?

A:

Q: The [H3O+] of Coca-Cola Classic ® is 3.2 x 10-3. What is its pH? Is it acidic or basic?

A: The pH of the given solution can be defined as the measure of its basicity or the acidity. It is…

Q: What is the molar concentration of all the ions in a solution of 0.120M Al2(SO4)3?

A:

Q: What are the pH and pOH of 0.075 M NaOH(aq)?

A: Since NaOH is a strong base Hence it will dissociate completely in solution  Since the dissociation…