The [H3O+] of Coca-Cola Classic ® is 3.2 x 10-3. What is its pH? Is it acidic or basic?

Q: 4 What is the pH of a solution which has a pOH= 10.57

A:

Q: What is the pH of a 0.55 M solution of (CH3)3N?

A:

Q: Calculate the pH of a 3.5 × 10–3 M HNO3 solution.

A: Hydrogen ion concentration is an important parameter of an aqueous solution. The concentration of…

Q: What is the pH of a solution with [H3O+] of 1.9 x 108 M?

A:

Q: If [H* ] = 4.3 x 10-4 M, what is [OH]?

A: The given problem can be solved by using the formula given below as; H+ OH- = Kw= 1.0×10-14…

Q: What is the pH of a solution with a [H3O*] concentration of 7.44 x 10-5 M?

A: Given: [H3O+] concentration = 7.44 × 10-5 M We have to calculate the pH of the solution.

Q: What is the pH of 0.03 M HNO2?

A: Given :-  Molar concentration of HNO2 = 0.03 M  Ka = 4.6 × 10-4  To calculate :-  pH of the solution

Q: 6) What is the pH and pOH of a solution with a [OH] of 7.79 X 10* M? Is the solution acidic, basic…

A:

Q: What is the pH of a 1 x 104 M solution of HNO3?

A: using the given question, concentration is given, apply the formula, pH=-logH+  hydrogen ion…

Q: Calculate the pH of a .10 M solution of formic acid (HCHO2). The Ka of formic acid is 1.8 x 10-4.

A:

Q: What is the pH of a 0.200 M solution of HNO3?

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: 4. a. What is the pH, and the equilibrium concentrations for [H*], [CH³COO-], [CH3COOH] and [OH-] in…

A:

Q: A solution of hydrobromic acid has [HBr] = 1.3×10-2 M. What is the pH of this solution

A: As per guidelines if multiple questions, first question is allowed to answer, please post  questions…

Q: What is the pH of a 2.1 M solution of HCIO4? pH =

A: HClO4 is a strong acid. So it dissociates completely to produce H+ ions in its aqueous solution.…

Q: Which of the following is NOT amphoteric? O H20 O Al(OH)3 Be(OH)2 PbO2 O Mg(OH)2

A:

Q: What is the pH of 8.1 x 10-5 M HClO4 solution?

A:

Q: Calculate the pH of a 0.400M solution of phosphoric acid, H3PO4.     Ka = 7.11*10^-3

A: Given: Concentration of H3PO4 = 0.400 M And Ka of H3PO4 = 7.11 × 10-3  NOTE: Since only the 1st Ka…

Q: What is the hydronium ion concentration in an aqueous perchloric acid solution with a pH of 2.780?…

A: Perchloric acid is a strong mineral acid having chemical formula HClO4.

Q: Find the pH of a 0.22 M AlCl3 (aq) solution if Ka of Al3+ is 1.2 × 10–5

A:

Q: 2. What is the pH, the pOH and the [OH] of a solution in which the [H*] = 2.43 x 10-6 M? %3!

A: pH is defined as  the negative log of hydrogen ion concentration  pOH is defined as the negative log…

Q: What is the pH of a solution that is O.245 MH2S and 0.160 M sodium hydrogen sulfide (NaHS)? The Ka…

A: The reaction between Hydrogen sulfide and sodium hydroxide is

Q: Calculate the pH of the following solutions and indicate whether they are acidic, basic, or neutral.…

A: Answer:

Q: What is the pH of a 0.605 M solution of HNO₃?

A: The given data is as follows: The concentration of HNO3 = 0.605 M The pH of HNO3 solution = ? The pH…

Q: What is the pH of a 3.1 x 10-4 M CsOH solution?

A: Given : concentration of CsOH = 3.1 × 10-4 M  To calculate :- pH of solution

Q: Calculate the pH of 0.10 M (COOH)½ (aq), oxalic acid. Ka1 = 5.9 x 10-² ; Ka2 = 6.4 x 10-5.

A:

Q: What is the pH of 6.3 x 10-4 M Ba(OH)2 (aq)? Ο 11.1 O 10.8 O 3.2 O 2.9 O 7.6

A: We have to calculate the pH of 0.00063M Ba(OH)2 solution.

Q: What is the pH of an aqueous solution of HNO3 with a concentration of 3.33 x 10-3 M? О А. 5.5 о в.…

A: Given the aqueous solution of HNO3 with a concentration of 3.33×10-3we are asked to the pH of…

Q: What is the pH of a 1.45 X 10-6 M solution of HNO3?

A: We have given that   Concentration of HNO3 = 1.45×10-6M  We know that  HNO3 is strong acid and…

Q: Calculate the pH of a 5.7 x 10 M aqueous solution of hydrobromic acid (HBr). -5

A: Given :- concentration of HBr solution = 5.7 × 10-5 M  To calculate :- pH of solution  pH =…

Q: Determine the pH of a 0.100 M solution of HC₃H₅O₂ (Ka = 1.3 × 10⁻⁵).

A: The concentration of HC3H5O2 solution is 0.100 M. In the solution, HC3H5O2 (aq) ⇔H+ (aq) + C3H5O2-…

Q: Calculate [H3O+] and pH for a 0.317 M solution of HF; Ka = 6.8 × 10−4.

A: Given, Concentration of HF (C) = 0.317 M Dissociation constant of HF , Ka = 6.8×10-4 [H3O+] = ? pH =…

Q: What is the pH of a solution that has a [H3O+] = 4.5 × 10^_5?

A: Given:[H3O+] = 4.5 × 10-5 M.

Q: What is the pH of a 0.031 M solution of aqueous Sr(OH)2? 1.21 1.51 12.49 12.79

A: pH :-  The negative logarithm to the base 10 of hydrogen ion concentration expressed in mol/L of a…

Q: What is the pH of a solution if the [H+] = 7.2 x 10^-9?

A: The pH is a scale that is widely used to measure the acidity or basicity of a solution. The pH is…

Q: What is the hydronium ion concentration in an aqueous hydroiodic acid solution with a pH of 3.970?…

A:

Q: What is the pH of 2.7 x 102 M NaOH(aq)? O 3.6 O 1.6 Ο 12.4 O 13.1 O 10.4

A:

Q: The pH for 0.050 M of CH3NH3Cl ?

A: Methylammonium chloride (CH3NH3Cl) dissociates into quaternary ammonium ion (CH3NH3+) and chloride…

Q: Calculate the pH of a 0.0200M solution of nitrous acid, HNO₂. Ka = 4.0 *10^-4

A: pH is commonly known as power of hydrogen, it is obtained by negative logarithm of hydrogen ion…

Q: If [H*]=1.7 x 10-3 M, what is the pH of the solution? al 2.13 b. 2.77 1.83 5.42

A: Given data is as follows: H+=1.7×10-3 M The pH of a solution can be calculated as follows: pH=-logH+…

Q: What is the pH of a solution with a [H3O^+] concentration of 7.44 x 10^-5 M?

A: Given, Concentration of H3O+ ion = [H3O+] = 7.44 x 10-5 M pH of the solution = ? Note: pH: it can…

Q: What is the pH of a solution with [H3O+] of 1.9 x 10-8 M?

A: Given that, [H3O+] = 1.9×10-8 M pH = ?

Q: Calculate the concentration of HCO3 in an aqueous solution of 0.1120 M carbonic acid, H,CO3 (aq).…

A:

Q: pH

A:

Q: The pH of 0.01 m Potassium hydrogen phthalate is... O 2.05 O 3.55 O 4.00 O 5.00 O 6.00

A: Here we are required to find the pH of the solution of 0.01M of KHP.

Q: What is the hydronium ion concentration in an aqueous hydrobromic acid solution with a pH of 1.200?

A: pH of solution is defined as the concentration of hydronium ion H3O+ present in the solution…

Q: What is the pH of a solution with [H3O+] = 4.5 x 10-5M?

A:

Q: What is the pH of a 0.025M solution of sulfuric acid? Ka₂ = 1.2 x 10-² pH = [?]

A:

Q: What is the pH of a 0.10 M solution of HNO3?

A: pH is used for measurement of hydronium ion concentration. In case of strong acids, their…

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.